(feso4.(Nh4) So4. 6H2o) +Kmno4+H2So4_Fe2(So4)3+K2So4+mnSo4+(Nh4)2So4+H2o​

Answers

Answer 1

Answer:

balancing the equation?


Related Questions

In order to dissolve a chemical sample in a recrystallization solvent, add the room-temperature solvent ___________ in an Erlenmeyer flask on a hot plate. Turn on the heat, starting at __________________. Using a _______, add additional solvent from a second container on the heat source. Swirl the sample flask after each addition, and try to add _______________ in order to dissolve the solid.

Answers

Answer:

just until it covers the sample

a low setting and increasing gradually

pipet

as little solvent as possible

Explanation:

In order to dissolve a chemical sample in a recrystallization solvent, add the room-temperature solvent just until it covers the sample in an Erlenmeyer flask on a hot plate. Turn on the heat, starting at a low setting and increasing gradually. Using a pipet, add additional solvent from a second container on the heat source. Swirl the sample flask after each addition, and try to add as little solvent as possible in order to dissolve the solid.

In the benzene molecule, carbon atoms form a ring with alternating single and double bonds in between each of them. Each carbon atom forms one σ bond with one carbon atom and one σ and one π bond with another. The π bonding electrons are delocalized over the entire molecule. Thus, benzene is a resonance hybrid of two equivalent structures, and the single and double bonds oscillate from one position to the other.

Required:
Calculate the bond order for one carbon-carbon bond in the benzene molecule, taking σ and π bonding into consideration.

Answers

Answer:

1.5

Explanation:

From;

BO = ½(B – A)

BO= Bond order

B= Number of bonding electrons

A = Number of antibonding electrons

For the sigma bonds, there are 2 bonding electrons and 0 nonbonding electrons.

σ BO = ½(B – A) = ½(2 – 0) = 1

π bond order for 6 C-C bonds;

π BO = ½(B – A) = ½(6 – 0) = 3

For each  π bond, BO = 3/6 = 0.5.

Hence, for a single C-C bond in benzene, the total Bond order = σ + π = 1 + 0.5 = 1.5.

At STP, in the equation C(g) + O2(g) --> CO2(g), one liter of O2 yields how many liters of CO2?

Answers

Answer:

3 I think but ask someone else too

The foam football Coach Johnson left in his chair will stay there until he
moves it to sit in the chair.


A. Newton’s first law
B. Newton’s second law
C. Newton’s third law

Answers

Answer:

B. Newton’s second law

Explanation:

correct me if im wrong

Answer:

Its c newton third law

Explanation:

His third law states that for every action (force) in nature there is an equal and opposite reaction. In other words, if object A exerts a force on object B, then object B also exerts an equal and opposite force on object A. Notice that the forces are exerted on different objects.

the amount of copper sulphate used in dissolution is​

Answers

Answer:

80 gm/mol

Explanation:

it may be helpful

A taco from a fast food restaurant contains 7.0 g of fat, 25. g of carbohydrate, and 11 g of protein. How many kJ of energy does the cheeseburger contain? (The caloric values for foods are 38 kJ/g for fat, for carbohydrate, and 17 kJ/g for protein.)

Answers

Answer: 878 kJ of energy is there in cheeseburger

Explanation:

Given : calorific value of fat = 38kJ/g

calorific value of carbohydrate = 17 kJ/g

calorific value of protein = 17kJ/g

1 g of fat contains energy = 38 kJ

7.0 g of fat contains energy = [tex]\frac{38}{1}\times 7.0=266 kJ[/tex]

1 g of carbohydrate contains energy = 17 kJ

25 g of fat contains energy = [tex]\frac{17}{1}\times 25=425kJ[/tex]

1 g of protein contains energy = 17 kJ

11 g of protein contains energy = [tex]\frac{17}{1}\times 11=187kJ[/tex]

Total energy = (266+425+187) kJ = 878 kJ

Why does Hydrogen not belong to any group?

Answers

Answer: Hydrogen is not in any group because it only has on electron

Explanation:

MQ : Which parts of the brain had most likely been affected?

Answers

Answer:

the cerebrum

Explanation:

answer is A

Decide whether a chemical reaction happens in either of the following situations. If a reaction does happen, write the chemical equation for it. Be sure your chemical equation is balanced and has physical state symbols. situation chemical reaction.


A strip of solid tin metal is put into a beaker of 0.074M MgBr2 solution .

Answers

Answer:

Sn(s) + MgBr2(aq) --> SnBr2(aq) + Mg(s)

Explanation:

Decide whether a chemical reaction happens in either of the following situations.

- A reaction happens. The type of this reaction is the single replacement reaction.

If a reaction does happen, write the chemical equation for it.

Sn(s) + MgBr2(aq) --> SnBr2(aq) + Mg(s)

How can weak acids and weak bases cause pH stress to cells?

a. Weak bases will only cause pH stress at low pH.
b. If a cell has transporters that are not well regulated, weak acids or weak bases can accumulate inside the cells and cause stress.
c. Only weak acids can cause stress by diffusing across a membrane at low pH.
d. At certain pH levels, both weak acids or weak bases will be uncharged, and thus are small uncharged molecules that can diffuse across a membrane and cause pH stress inside the cell. e. Weak acids and weak bases do not cause stress.

Answers

Answer:

b

Explanation:

If a cell has transporters that are not well regulated, weak acids or weak bases can accumulate inside the cells and cause stress.

molecular formula of CH3-CH2-CH2-CH2-CH2-Cl​

Answers

Answer:

C₅H₁₁Cl

Explanation:

Count all the carbon, hydrogen, and chlorine atoms. The number of atoms of each element is the subscript for each element in the formula. No subscript is understood to be one. Carbon goes first, hydrogen goes second, and chlorine goes last when writing the formula.

Can someone help me please

Answers

Answer:

the answers are a, f, g

and lastly e because they all describe a liquid

To date, scientific tests of astrology have never found that its predictive methods work.


True
False

Answers

true______________________

Can someone help me with these two?

Answers

Answer:

adding

opposite

Explanation:

dont blame me if u get them wrong

Answer:

first one is adding i belive and second one is opposite

Explanation:

Is this the correct formula for magnesium acetate? Mg(C2H3O)2

Answers

Answer:

no

Explanation:

magnesium acetate= Mg(C2H3O2)2

Why does there appear to be another duck head in the water?
A
The water in the pond reflects light from the Sun, making a mirror image
B
The molecules in the atmosphere refract the light, splitting it into two ima
С
The duck scatters the light, making hundreds of tiny refractions that collec
D
The bottom of the pond absorbs the light, then projects it toward the surfa

Answers

Answer:

it's A. The water in the pond reflects light from the Sun, making a mirror image

Explanation:

i just took the test

1. Fill in the blanks. Example: A nitrogen atom takes on a 3- charge when it forms an anion and becomes nitride. a. A magnesium atom takes on a ___ charge when it forms a(an) ____ion and becomes . b. A chlorine atom takes on a ___ charge when it forms a(an) ____ion and becomes . c. An oxygen atom takes on a ___ charge when it forms a(an) ____ion and becomes . d. A potassium atom takes on a ___ charge when it forms a(an) ____ion and becomes .

Answers

Answer: a. +2, cation and magnesium ion .

b. -1,  anion, chloride

c. -2, anion, oxide

d. +1. cation , potassium ion

Explanation:

When an atom accepts an electron negative charge is created on atom and is called as anion.

When atom loses an electron positive charge is created on atom and is called as cation.

Magnesium (Mg) with atomic number of 12 has electronic configuration of 2,8,2 and thus it can lose 2 electrons to form [tex]Mg^{2+}[/tex] cation and becomes magnesium ion.

Chlorine (Cl) with atomic number of 17 has electronic configuration of 2,8,7 and thus it can gain 1 electron to form [tex]Cl^{-}[/tex] anion and becomes chloride.

Oxygen (O) with atomic number of 8 has electronic configuration of 2,6 and thus it can gain 2 electrons to form [tex]O^{2-}[/tex] anion and becomes oxide.

Potassium (K) with atomic number of 19 has electronic configuration of 2,8,8,1 and thus it can lose 1 electron to form [tex]K^{+}[/tex] cation and becomes potassium ion.

Beryllium oxide, Beo, is an electrical insulator. How
many moles of beryllium oxide qre in a 250 gram
sample of the compound?

Answers

Answer:

There are 10.0 moles of beryllium oxide in a 250 grams sample of the compound.

Explanation:

We can calculate the number of moles (η) of BeO as follows:

[tex] \eta = \frac{m}{M} [/tex]

Where:

m: is the mass = 250 g

M: is the molar mass = 25.0116 g/mol

Hence, the number of moles is:

[tex] \eta = \frac{250 g}{25.0116 g/mol} = 10.0 moles [/tex]

Therefore, there are 10.0 moles of beryllium oxide in a 250 grams sample of the compound.  

I hope it helps you!

A tank contains one hundred fifty kmol of an aqueous phosphoric acid solution with 5.00 mole% H3PO4. The solution is concentrated by adding pure phosphoric acid at a rate of 30.0 L/min. Molecular weight of phosphoric acid is 98. Density of phosphoric acid is 1.834 kg/L. Determine the mole fraction of phosphoric acid in the tank at 25 minutes.

Answers

Answer:

Mole fraction  = 0.1313

Explanation:

given data

Addition rate of pure phosphoric acid = 30L/min

Phosphoric acid added in 25 min = 750 L

solution

mass is express as here

mass = density × volume and number of moles = mass ÷ molar mass

So, In terms of moles

phosphoric acid added = (750 × 1.834) ÷ 98

phosphoric acid added = 14.036 kmol

and

moles of phosphoric acid in tank = 0.05 × 150 + 14.036

moles of phosphoric acid in tank = 21.536 kmol

and

Moles of water in tank = 0.95 × 150

Moles of water in tank = 142.5 kmol

So that Mole fraction of phosphoric acid in tank

Mole fraction = 21.536 ÷ (21.536+142.5)

Mole fraction  = 0.1313

Which process breaks down sugars to release energy that powers bodily functions?

Answers

Answer:

Cellular respiration

Explanation:

Would you expect a reaction to occur with Hydrogen gas and Copper (II) chloride?

Answers

Yes

The copper itself can react with hydrogen

Here is the chemical reaction

2CuCl2(aq) + H2(g) -> 2CuCl(s) + 2HCl(g)

structure of 2,6-diiodo-4-methyl-5-propylheptane​

Answers

Explanation:

2,6-Dibromo-4-isopropylphenol

2432-16-8

2,6-dibromo-4-propan-2-ylphenol

Phenol, 2,6-dibromo-4-(1-methylethyl)-

4-isopropyl-2,6-dibromophenol

In this stage of team building, the team is running smoothly and they are comfortable in their roles.


norming

performing

forming

storming

Answers

What are you asking?

Answer:

performing

Explanation:

A: A 21.3−g sample of dinitrogen monoxide is confined in a 5.76−L vessel. What is the pressure (in atm) at 111°C?

B: Find the density of Freon−11 (CFCl3) at 157°C and 4.65 atm.
g/L = ?

Answers

Answer:

A. 2.65 atm.

B. 18.11 g/L.

Explanation:

A. Determination of the pressure

Mass of N₂O = 21.3 g

Volume = 5.76 L

Temperature (T) = 111 °C

Pressure (P) =.?

First, we shall determine the number of mole in 21.3 g of dinitrogen monoxide, N₂O. This can be obtained as follow:

Mass of N₂O = 21.3 g

Molar mass of N₂O = (14×2) + 16

= 28 + 16

= 44 g/mol

Mole of N₂O =?

Mole = mass /Molar mass

Mole of N₂O = 21.3/44

Mole of N₂O = 0.484 mole

Next, we shall convert 111°C to Kelvin temperature. This can be obtained as follow:

T(K) = T(°C) + 273

Temperature (T) = 111 °C

Temperature (T) = 111 °C + 273

Temperature (T) = 384 K

Finally, we shall determine the pressure. This can be obtained as follow:

Number mole of N₂O = 0.484 mole

Volume = 5.76 L

Temperature (T) = 384 K

Gas constant (R) = 0.0821 atm.L/Kmol

Pressure (P) =.?

PV = nRT

P × 5.76 = 0.484 × 0.0821 × 384

Divide both side by 5.76

P = (0.484 × 0.0821 × 384) / 5.76

P = 2.65 atm

B. Determination of the density of CFCl₃

Temperature (T) = 157°C

Pressure (P) = 4.65 atm.

Density of CFCl₃ =?

First, we shall determine the molar mass of CFCl₃. This can be obtained as follow:

Molar mass of CFCl₃ = 12 + 19 + (35.5×3)

= 12 + 19 + 106.5

= 137.5 g/mol

Next, we shall convert 157°C to Kelvin temperature. This can be obtained as follow:

T(K) = T(°C) + 273

Temperature (T) = 157 °C

Temperature (T) = 157 °C + 273

Temperature (T) = 430 K

Finally, we shall determine the density of CFCl₃. This can be obtained as follow:

Temperature (T) = 430 K

Pressure (P) = 4.65 atm.

Molar mass of CFCl₃ (M) = 137.5 g/mol

Gas constant (R) = 0.0821 atm.L/Kmol

Density (D) of CFCl₃ =?

D = PM / RT

D = (4.65 × 137.5) / (0.0821 × 430)

D = 18.11 g/L

What is full ground state electron configuration of C-?

Answers

Answer:

[tex]1s^{2}[/tex] [tex]2s^{2}[/tex] [tex]2p^{2}[/tex]

Explanation:

Simply [tex]1s^{2}[/tex] [tex]2s^{2}[/tex] [tex]2p^{2}[/tex]

Coal has two valent electrons, so there is 2 in 2p orbital

Farsighted people have trouble seeing objects that are close to their eyes.
True
False

Answers

True, while nearsightedness, is one of the most common eyesight problems. People with this condition can't focus their eyesight on far-away objects, making them appear blurry. Farsighted is when people cannot see objects that are up close.

Which half reaction is associated with the anode?
Sn(s) —> Sn2+ (aq) + 2e-
Sn2+ (aq) + 2e- → Sn(s)
Pb2+ (aq) + 2e-->Pb(s)
Pb(s)->Pb2+ (aq) + 2e-

Answers

Answer:

vgf

Explanation:

Answer:

its either A or B

Explanation:

took the test twice and guessed LOL
its not C or D :>

The eye can see colors because:
a. the cones in the retina send signals to the brain.
b. the rods in the cornea send signals to the brain.
c. the optic nerve determines the color of the object and sends signals to the brain
d. None of the choices are correct.

Answers

Answer:

The answer is A, I think.

Answer:

the answer is A

Explanation:

The human eye and brain together translate light into color. Light receptors within the eye transmit messages to the brain, which produces the familiar sensations of color. Newton observed that color is not inherent in objects. Rather, the surface of an object reflects some colors and absorbs all the others.



A sample of a compound was found that has 40.25g of (C) Carbon and 59.75g of (O) Oxygen.

What is the empirical formula for this sample.

Answers

Answer:

CO

Explanation:

From the question given above, the following data were obtained:

Mass of Carbon (C) = 40.25 g

Mass of oxygen (O) = 59.75 g

Empirical formula =?

The empirical formula of the compound can be obtained as follow:

C = 40.25 g

O = 59.75 g

Divide by their molar mass

C = 40.25 / 12 = 3.354

O = 59.75 / 16 = 3.734

Divide by the smallest

C = 3.354 / 3.354 = 1

O = 3.734 / 3.354 = 1

The empirical formula of the compound is CO

5.6 g of an organic compound on burning with excess
of oxygen gave 17.6 g of CO2, and 7.2 g of H,O. The
organic compound is :​

Answers

Answer:organic compound is :​ C₄H₈

Explanation: The equation of the reaction of the organic compound burning with excess oxygen gives us the general equation as

C xHy  + 1/2(x+ y/2 )O₂ → xCO₂ + y/2H₂O

We first find the number of moles of CO₂ and H₂O

Number of moles of CO₂= Mass/ molar mass

= 17.6g/ 44g/mol ( 12+ 16 x2)

=0.4 moles

Number of moles of H₂O= Mass/ molar mass

= 7.2g/ 18g/mol ( 1 X 2+ 16)

=0.4 moles

From the reaction , we can see that  

x = 0.4

and  [tex]\frac{y}{2}[/tex]= 0.4  such that y= 0.4 x 2= 0.8

Their ratios become

[tex]\frac{x}{y}[/tex] =[tex]\frac{0.4}{0.8}[/tex]= [tex]\frac{4}{8}[/tex]

Therefor the organic compound CxHy  = C₄H₈

​  

 

Other Questions
Write 3 sentences that you could use to convince a friend or family member to be physically active with you. A drug company testing a pain medication wants to know the impact of different dosages on patients' painlevels. They recruited volunteers experiencing pain to try one of 6 different dosages and then rate their painlevels on a scale of 1 to 10. Here are the results: HELP PLEASE !! URGENT !! Brandon has a board that is 10 feet long. He wants to cut the board into 4 shelves. The lengths of 3 shelves are shown in the table. How long will the fourth shelf be? This is land awarded to people from the King/Queen, or Viceroy. Please helpA MissionsB ReconquestC GrantD Caste System What progress did women make as a group in the power war period? would you expect a plant to produce more oxygen on a cloudy day or a sunny day? explain PLEASE HELP ASAPJonathan has a rectangular rug with whose length is 5 inches less than its width. The area of the rug is 36 square inches Solve x for -2x- 1 = -7 How did population growth influenced urbanization in the US Select the most appropriate response. An event A will occur with probability 0.4. An event B will occur with probability 0.6. The probability that both A and B will occur is 0.20. We may conclude Question options: that events A and B are independent. that events A and B are dependent. that either A or B always occurs. that events A and B are mutually exclusive. 4. What domain name should replace the question mark in this chart?5 pointsUnicellular ProtozoaUni/multicellularalgaoMulticollularheterotrophcell walls chitin?Multicoulluarautotrophcell wallsof celluloseMulticellularheterotrophLack cell wallsO a. Archaeab. BacteriaO c. EukaryaO d. Monera What are some other biotic and abiotic factors that may influence the mouse and hawk populations? Find the mean,median,mode, and range:5,2,5,2 What did it mean to be considered one of the log cabin presidents, as Andrew Jackson was?He refused to live in the White House during his term.He came from humble or common beginnings.He made his fortune in the logging business.He preferred to live in small houses, such as log cabins. Deepak is a landscaper who charges $30 for each job he does plus an additional $15 for each hour he works. He only accepts jobs if he will earn at least $90 per job. He writes this inequality to determine x, the number of hours he must work during each job in order to accomplish this.30 + 15 x greater-than-or-equal-to 90Which best describes the restrictions on the jobs Deepak will accept?He only accepts jobs that last 4 or more hours.He only accepts jobs that last 5 or more hours.He only accepts jobs that last 8 or more hours.He only accepts jobs that last 9 or more hours. Fill in the blank with the correct word or phrase.Do you know it will be cold tonight? what's the answer for 1/2 of 3/5? Why does Frankenstein's monster kill in the novel? This is a deceptively simple question, so let me elaborate just a bit. What is his reason and motive for revenge? How does the monster admit that all of his killing could have been avoided? What moral burden does this place on us as readers? what is the answer pls give me the answer pls with explanations