Find the value of x

Find The Value Of X

Answers

Answer 1

Answer:

11

Step-by-step explanation:


Related Questions

Solve the following inequalities and represent the solution on the number line.
d) 5x ≥ 15
e) 3(2x + 1) ≤ 15

Answers

d) 5x ≥ 15

Let's solve your inequality step-by-step.

5x≥15

Step 1: Divide both sides by 5.

[tex]\frac{5x}{5} \geq \frac{15}{5}[/tex]

[tex]x\geq 3[/tex]

(Attachment #1)

e) 3(2x + 1) ≤ 15

Let's solve your inequality step-by-step.

3(2x+1)≤15

Step 1: Simplify both sides of the inequality.

6x+3≤15

Step 2: Subtract 3 from both sides.

6x+3−3≤15−3

6x≤12

Step 3: Divide both sides by 6.

[tex]\frac{6x}{6} \leq \frac{12}{6}[/tex]

[tex]x\leq 2[/tex]

(Attachment #2)

The surface area of the cone below is about 151.58 inches squared. The radius of the base is 4 inches. What is the slant height? Use 3.14 for Pi. Round your answer to the nearest whole number.

Answers

The slant height of the given cone will be 12.06 inches.

What is slant height?

The measurement from the base to the peak along the "center" of a lateral face of an object, such as a cone, is its slant height.

Given that:-

The surface area of the cone below is about 151.58 inches squared. The radius of the base is 4 inches.

The slant height will be calculated as:-

Surface area = π r l

151.58 = π x 4 x l

l = 151.58 / ( π x 4 )

l = 12.06 inches.

Therefore slant height of the given cone will be 12.06 inches.

To know more about slant height follow

https://brainly.com/question/6613758

#SPJ1

A sample of substance x that has a mass of 326.0 g releases 4325.8 cal when it freezes at its freezing point. if substance x has a molar mass of 58.45 g/mol, what is the molar heat of fusion for substance x? use q equals n delta h.. 13.31 cal/mol 74.00 cal/mol 775.6 cal/mol 19054.7 cal/mol

Answers

The molar heat of fusion for substance X , given the data is 775.6 cal/mol

How to determine the mole of the substance XMass = 326 gMolar mass = 58.45 g/molMole = ?

Mole = mass / molar mass

Mole = (326 / 58.45) moles

How to determine the heat of fussionMole (n) = (326 / 58.45) molesHeat (Q) = 4325.8 calHeat of fusion (ΔHf) = ?

Q = n × ΔHf

4325.8 = (326 / 58.45) × ΔHf

4325.8 = (326 × ΔHf ) / 58.45

Cross multiply

326 × ΔHf = 4325.8 × 58.45

Divide both sides by 326

ΔHf = (4325.8 × 58.45) / 326

ΔHf = 775.6 cal/mol

Learn more about heat transfer:

https://brainly.com/question/6363778

#SPJ1

There are 20 dogs and 15 cats in a pet shop. Find the ratio of cats to dogs.

Answers

The ratio is 4:3 or 4/3

Using a standard deck of cards, find the probability of selecting a jack, replacing the card, and then selecting a king.

please explain

Answers

The probability of selecting a jack, replacing the card, and then selecting a king is 1/169

How to determine the probability?

In a standard deck of cards, we have:

Total = 52

Jack = 4

King = 4

The probability of each is:

P(Jack) = 4/52

P(King) = 4/52

So, we have:

P = 4/52 * 4/52

Simplify

P = 1/13 * 1/13

Evaluate

P = 1/169

Hence, the probability is 1/169

Read more about probability at:

https://brainly.com/question/25870256

#SPJ1

Find all real numbers $a$ that satisfy \[\frac{1}{a^3 + 7} -7 = \frac{-a^3}{a^3 + 7}.\]

Answers

The real number of the given expression is a=-2.

Given that the expression is [tex]\frac{1}{a^3+7}-7=\frac{-a^3}{a^3+7}[/tex]

Real numbers is known as the union of both rational and irrational numbers. Real numbers can be both positive or negative and are denoted by the symbol “R”.

To compute the value of a.

In the given expression multiply both sides with (a³+7) as

[tex]\frac{(a^3+7)}{a^3+7}-7=\frac{-a^3(a^3+7)}{a^3+7}[/tex]

Simplify the expression as,

1-7(a³+7)=-a³

Expand out terms of the left hand side

1-7a³-49=-a³

-7a³-48=-a³

Taking out minus common from both sides and cancel them

-(7a³+48)=-(a³)

7a³+48=a³

Add -a³-48 on both sides

7a³+48-a³-48=a³-a³-48

6a³=-48

Divide both sides with 6

(6÷6)a³=(-48÷6)

a³=-8

write -8 in the expansion form which is (-2)×(-2)×(-2)=-8

a³=(-2)³

From above it says that

a=-2

Hence, real number that satisfy [tex]\frac{1}{a^3+7}-7=\frac{-a^3}{a^3+7}[/tex] is a=-2.

Learn about real numbers from here brainly.com/question/10180279

#SPJ4

1
2 3
4
5
6
7
8
9 10
Which set of angle measures could be the measures of the interior angles of a triangle?
O 90°, 42°, and 58°
O 60°, 60°, and 60°
O 100°, 48°, and 42°
O 31°, 75°, and 70°
TIME REMAI
42:34

Answers

Answer:

1) -
2) +

3) -
4) +

Step-by-step explanation:

сумма внутренних углов треугольника не должна превышать 180 градусов

Karl’s math class is playing a number game. Each student is given a number card containing the numbers 1 to 6. The rules of the game are that each student must put a cross through two numbers on the card and hand it in to the teacher. The teacher has a bag containing six balls numbered 1 to 6. When all the number cards have been handed in the teacher draws out two balls from the bag. Every student who had chosen the same two numbers shown on the balls wins a prize. If there are 30 students in Karl’s class, how many students are likely to win a prize? Describe your reasoning

Answers

By finding the probability, we can expect that 2 out of the 30 students will win the prize.

How many of the 30 students will win the prize?

First, we should get the probability of winning this game.

Here the students select two numbers out of 6, just to make the calculations let's say that these numbers are 1 and 2.

Now, we need to get these two numbers in two balls. The probability of getting the ball with the number 1 out of the 6 balls is:

p = 1/6

The probability of getting the ball with the number 2 out of the remaining 5 balls (because we already got one) is:

q = 1/5

The joint probability is then:

P = 2*(1/6)*(1/5) = 1/15.

Where the factor 2 comes to take in account the permutations, for the case where we first draw the number 2 and then the number 1.

Then the expected number of students that will win is equal to the probability times the total number of students:

(1/15)*30 = 2

So out of the 30 students, we can expect that 2 will win.

If you want to learn more about probability:

https://brainly.com/question/25870256

#SPJ1


5(2x - 12) + 21 = 2x + 41
05
08
O 10
072

Answers

Answer:

x = 10

Step-by-step explanation:

5(2x - 12) + 21 = 2x + 41 ← distribute parenthesis and simplify left side

10x - 60 + 21 = 2x + 41

10x - 39 = 2x + 41 ( subtract 2x from both sides )

8x - 39 = 41 ( add 39 to both sides )

8x = 80 ( divide both sides by 8 )

x = 10

Suzanna’s doctor told her to lose 9 kg, which was 10% of her body weight.
a) How much did Suzanna weigh?
b) If Suzanna lost 12% of her body weight, what is her new weight?

Answers

(a) 10% of x = 9

x = 9 ⋅ (100/10)

x = 90 kg

(b) 12% of x = 12/100 of 90

Weight she lost = 10.8

Her new weight = 90 - 10.8

= 79.2kg

a) 9x 10=90
b) 10%=9 so 2%= 1.8
Now add 9 and 1.8 to get 10.8kg as your answer

If the bearing of p from y is 048degrees what is the bearing of y from p

Answers

Step-by-step explanation:

see photo for detailed analysis

Set up a proportion to solve for x in the following similar triangles

Answers

Answer:

[tex] \frac{18}{12} = \frac{24}{x - 2} [/tex]

In a factory, the chance that a certain machine works without overheating in the morning is 50%. if it runs smoothly all morning, then there is an 85% chance that it will continue for the rest of the day and a 15% chance that it will stop due to overheating. what is the probability that on a given day it will work in the morning and overheat later on? a. 4% b. 3.75% c. 7.5% d. 3.5%

Answers

Answer: C. 7.5%

Solve as decimal

0.5*0.15=0.075

Move two decimal points over

0.075 -> 7.5

Change back to percent

7.5%

Doubling the dimensions of a rectangle increases the area by a factor of 4.

If p represents doubling the dimensions of a rectangle and q represents the area increasing by a factor of 4, which are true? Select two options.

Answers

p → q  represents the original conditional statement and the contrapositive of the original conditional statement. Then the correct options are A and E.

The missing options are given below.

What is dilation?

Dilation is the process of increasing the size of an item without affecting its form. Depending on the scale factor, the object's size can be raised or lowered.

There is no effect of dilation on the angle.

Doubling the dimensions of a rectangle increases the area by a factor of 4.

If p represents doubling the dimensions of a rectangle and q represents the area increasing by a factor of 4.

Then the true statement will be

Then the correct options are A and E.

More about the dilation link is given below.

https://brainly.com/question/2856466

#SPJ1

Given a function f : a → b and a subset y ⊆ b, is f (f −1 (y)) = y always true? prove or give a counterexample

Answers

If the subset y is the empty set, then the statement is false. That is the counterexample.

Is the statement true?

We know that for an invertible function, we always have that:

[tex]f(x) = y\\f^{-1}(y) = x[/tex]

Now, the range of f(x) is the set b. This means that the domain of the inverse is the set b. Such that:

f^{-1} is defined on b→a

Now we want to work on a subset y ⊆ b.

And here comes the problem.

The empty set {∅} is a subset of ay other set. So, if y is the empty set, there are no elements where we can evaluate the inverse function. From that counterexample, we conclude that the statement is false.

If you want to learn more about inverse functions:

https://brainly.com/question/14899241

#SPJ12

What is 5 x -1 =
Doing summer homework

Answers

5 x-1 =-5 anything times a negative is a negative

Answer:

x=1/5

Step-by-step explanation:

You have to isolate x. First, add the one to the sider to give you 5x=1. In order to get the x by itself, you have to divide the 5 into both sides. In the end, this gives you x=1/5.

the money in a bank account increased from $400 to $1000.
copy and complete these sentences.

a) $1000 is ........% of $400.

b) the money has increased by .......%​

Answers

Answer:

a).1000/400*100

= (1000*100)/400

= 100000/400 = 250

b).600

Step-by-step explanation:

a). Percentage solution with steps:

Step 1: We make the assumption that 400 is 100 % since it is our output value.

Step 2: We next represent the value we seek with x.

Step 3: From step 1, it follows that 100 % = 400.

Step 4: In the same vein, x % = 1000 .

Step 5: This gives us a pair of simple equations:

100 % = 400(1).

x % = 1000(2).

Step 6: By simply dividing equation 1 by equation 2 and taking note of the fact that both the LHS

(left hand side) of both equations have the same unit (%); we have

100 % / x % = 400/1000

Step 7: Taking the inverse (or reciprocal) of both sides yields

x/100 = 1000/400

x = 250 %

Therefore, 1000 is 250 % of 400.

b) $1000-$400= 600

= $400+$600=$1000

Chocolate cost $1.50 and was paid for with $5 which three coins were given as change

Answers

Answer: $3.5

Step-by-step explanation:

If a product cost $1.50 and you paid $5, the change will be equal to

$5 - $1.50 = $3.5 for change

City worker drain a community pool that contains 403,920 gallons of water. The pump they use removes water at a rate of 40 cubic feet per minute. One cubic foot of water contains 7.48 gallons how long in hours will it take to remove all the water from the pool

Answers

Answer:

22.5 hours

Step-by-step explanation:

One cubic foot of water contains 7.48 gallons, so 40 cubic feet of water would equal 7.48 × 40, or 299.2 gallons. So the pumping rate is 299.2 gallons per minute. Multiplying 299.2 by 60, we have

299.2 × 60, or 17952 gallons per hour. Finally, divide 403,920 by 17,952 to find the number of hours to remove all the water: 403,920 ÷ 17,952 = 22.5 hours

Select the correct answer.
As part of a community-service project, a local club has decided to paint 864 walls across town. The club has 36 volunteers. If the work is divided evenly, how many walls must each volunteer paint?

A.
24
B.
29
C.
34
D.
39

Answers

The 24 walls must paint by each volunteer if the work is divided evenly and the club has 36 volunteers.

What is a fraction?

Fraction number consists of two parts, one is the top of the fraction number which is called the numerator and the second is the bottom of the fraction number which is called the denominator.

We have:

As part of a community-service project, a local club has decided to paint 864 walls across town. The club has 36 volunteers.

Total number of volunteers = 36

Number of walls = 864

The number of walls each volunteer paint can be expressed as a fraction:

= 864/36

= 24

Thus, the 24 walls must paint by each volunteer if the work is divided evenly and the club has 36 volunteers.

Learn more about the fraction here:

brainly.com/question/1301963

#SPJ1

A shipment of tile cost $64,500. each tile costs 15 dollars. how many pieces of tile are in the shipment?

Answers

Answer:

4,300

Step-by-step explanation:

total cost of the shipment of tile cost =$64,500

each tile cost =$15

how many pieces will now be the total cost of shipment tile divided by the cost of each tile

which will be

64500/15

=4,300 tiles are there

i am glad I helped

What is the greatest area of a rectangle with a perimeter of 60cm? What is the length and width of this rectangle?

Answers

The length and width of this rectangle are 15 cm respectively

How to determine the greatest area?

The perimeter is given as:

Perimeter, P = 60

The greatest area is calculated as:

Greatest = (P/4)^2

Substitute 60 for P

Greatest = (60/4)^2

Evaluate the quotient

Greatest = 15^2

Evaluate the exponent

Greatest = 225 square centimeters

Hence, the greatest area is 225 square centimeters

How to determine the length and width

We understand that the area is the greatest.

In such a scenario;

Length = Width

This means that:

Area =Length^2 =Width^2

So, we have:

Length^2 =Width^2 = 225

Take the square root

Length =Width = 15

Hence, the length and width of this rectangle are 15 cm respectively

Read more about areas at:

https://brainly.com/question/24487155

#SPJ1

Which statement about proportional relationships is false?
A proportional relationship must graph as a line.
A graph of a proportional relationship must pass through (0, 0).
Each point (or pair) in a proportional relationship must share the same ratio.
O Each point (or pair) in a proportional relationship must share the same difference.
Mark this and return
Save and Exit
Next
Submit

Answers

Answer:

Each point (or pair) in a proportional relationship must share the same difference is the false statement.

Can I add [tex]2\sqrt{3} + 5\sqrt{3}[/tex] further?

Answers

Yes, they can be added and simplified further. 2√3 + 5√3 = 7√3 .

Take √3 as common factor:

2√3 + 5√3

(2 + 5)√3

7√3

The two irrational numbers sums to form another irrational number 7√3 . In decimals that is 12.12435...

[tex] \sf{\qquad\qquad\huge\underline{{\sf Answer}}} [/tex]

Yes, The terms assigned above are alike so they can be added easily by simple algebric method where root number can be treated as a variable.

[tex]\qquad \sf  \dashrightarrow \: 2 \sqrt{3} + 5 \sqrt{3} [/tex]

[tex]\qquad \sf  \dashrightarrow \: (2 + 5) \sqrt{3} [/tex]

[tex]\qquad \sf  \dashrightarrow \: 7 \sqrt{3} [/tex]

Error Analysis Your classmate says that there is not enough information to determine whether the two triangles below are congruent. Is your classmate correct? Explain.

Answers

Answer:

Your classmate says that there is not enough information to determine whether the two triangles below are congruent. Is your classmate correct?

yes it is

The two triangles are congruent triangles by RHS theorem of congruent triangles

What are Congruent Triangles?

Transformations change the size or position of shapes. Congruent shapes are identical, but may be reflected, rotated or translated. Scale factors can increase or decrease the size of a shape. Congruent Triangles simply mean the triangles that possess the same size and shape

The three sides are equal (SSS: side, side, side)

Two angles are the same and a corresponding side is the same (ASA: angle, side, angle)

Two sides are equal and the angle between the two sides is equal (SAS: side, angle, side)

A right angle, the hypotenuse and a corresponding side are equal (RHS, right angle, hypotenuse, side)

Given data ,

Let the first triangle be represented as ΔMLJ

Let the second triangle be represented as ΔLJK

Now , the measure of ∠MLJ = 90°

The measure of ∠LJK = 90°

The measure of side MJ = measure of side LK

So , the two sides of the triangles are similar and they have a common hypotenuse

Therefore , the triangles are congruent by right angle, the hypotenuse and a corresponding side are equal (RHS, right angle, hypotenuse, side)

Hence , the triangles are congruent

To learn more about congruent triangles click :

https://brainly.com/question/26131452

#SPJ2

Vertex A in quadrilateral ABCD lies at (-3, 2). If you rotate ABCD 180° clockwise about the origin, what will be the coordinates of A′ of the rotated quadrilateral A′B′C′D′?

Answers

The answer is the letter

A

Which of the following is equivalent to √?
O
2
√2
O 2√2
2+√√√2

Answers

Answer:

2 sqrt(2)

Step-by-step explanation:

To simplify a square root

sqrt(8)

sqrt(4*2)

sqrt(4) sqrt(2)

2 sqrt(2)

Answer:

2√2

Step-by-step explanation:

√8 =[tex]\sqrt{4 \times 2}[/tex]

= 2√2 (√4 = 2)

Hence, 2√2 is the required answer.

Given: cot = -0.59 in QII, find sin

Answers

The value of sin x in Q II is 0.86 .

What are Trigonometry ?

This the field in Maths which deals with a right angled triangle and the other angles in the triangle.

It is given that cot = -0.59

cot x = cos x / sin x

Using online trigonometric calculator

sin x in Q II is 0.86 .

To know more about Trigonometry

https://brainly.com/question/26719838

#SPJ1

find the measure of arc DB in P

please hurry if you can​

Answers

[tex]\quad \huge \quad \quad \boxed{ \tt \:Answer }[/tex]

[tex]\qquad \tt \rightarrow \:m\overbrace{DB}= 90 \degree[/tex]

____________________________________

[tex] \large \tt Solution \: : [/tex]

[tex] \qquad \tt \rightarrow \: m \overbrace{DB} + m \overbrace{TB} = 180 \degree[/tex]

[ linear pair ]

[tex] \qquad \tt \rightarrow \: m \overbrace{DB} + 90 \degree = 180 \degree[/tex]

[tex] \qquad \tt \rightarrow \: m \overbrace{DB} = 180 \degree - 90 \degree[/tex]

[tex] \qquad \tt \rightarrow \: m \overbrace{DB} = 90 \degree[/tex]

Answered by : ❝ AǫᴜᴀWɪᴢ ❞

A green gold bracelet weighs 56g. The bracelet is made from 75% gold, 20% silver and 5% copper.
(a) What is the mass of the gold in the bracelet?
(b) What is the mass of the copper in the bracelet?

Answers

Answer:

a. 42 g

b. 2.8 g

Step-by-step explanation:

a. Since the entire thing weighs 56g and gold is 75% of the mass you simply find 75% of the mass. This is done by converting the 75% into decimal form by dividing it by 100 to get 0.75 and then multiply it by the 56 g to get (0.75 * 56 g) = 42 g

b. same thing here as the previous answer. 5%/100 = 0.05. (0.05 * 56 g) = 2.8 g

Other Questions
Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please what are the main functions of drinking water and sanitation project in Western Nepal Which best explains why a firework being ignited is an example of an exothermic reaction and not an endothermicreaction ?O The fireworks produce colors.O The fireworks give off heat.O Igniting the fireworks requires energy.O Igniting the fireworks makes an odor. What countries in Europe have the highest population densities? Jeremy is reading a 60-page book. He read the first 20 pages in 30 minutes. If Jeremy continues to read a the same rate, how long will it take him to finish the book? Predict the shape of the molecule. write 9 430 049 in international number system Let f(x) = (x 3)2. Find all values of c in (1, 4) such that f(4) f(1) = f '(c)(4 1). (Enter your answers as a comma-separated list. If an answer does not exist, enter DNE.)c = Based off of this information, what conclusions can be made about the Mean Value Theorem?This contradicts the Mean Value Theorem since f satisfies the hypotheses on the given interval but there does not exist any c on (1, 4) such that f '(c) = f(4) f(1)4 1.This does not contradict the Mean Value Theorem since f is not continuous at x = 3. This does not contradict the Mean Value Theorem since f is continuous on (1, 4), and there exists a c on (1, 4) such that f '(c) = f(4) f(1)4 1.This contradicts the Mean Value Theorem since there exists a c on (1, 4) such that f '(c) = f(4) f(1)4 1, but f is not continuous at x = 3.Nothing can be concluded. What is the value of x?tox = [? ]36EnterI will give you points For which length of wire are the reading of resistance most precise An investor has $ to invest in a cd and a mutual fund. The cd yields % and the mutual fund yields %. The mutual fund requires a minimum investment of $, and the investor requires that at least twice as much should be invested in cds as in the mutual fund. How much should be invested in cds and how much in the mutual fund to maximize the return? what is the maximum return?. The properties of an element depend on the electron structure within its atoms. The electrons are arranged in differentorbitals, at different energy levels and sublevels. Match each sublevel to the maximum number of electrons it canaccommodate? Which represents a negative impact of technology?A. Accessible technologyB. Production of wasteC. Improvement in climateD. Access to more resources Four seasons why the indigenous breed would be superior to exotic breed(imported breeds) tuli breed We can tell whether a person is having an eating disorder just by looking at the weight. If a persons weight is between a healthy range, he/she will never have an eating disorder. Are the above statements true or false? Sequence: 1,5,13,25Find nth term (Equation/formula thingy)Need answer ASAP What is the meaning of the word strike in this passage The iso 14001:2004 standards require documentation of a firm's environmental program. Which component requires a plan to improve performance in resource use and pollutant output? All of the following were reasons that encouraged European expansion in the New World except_a. Potential for wealthb. Spreading religious beliefsC. Rumors of gold and richesd. Discovery of new inventions Answer the following question in one to two well-written paragraphs. Which of the following have the greatest impact in determining and shaping public policy - political parties or interest groups? Be sure to explain your reasoning and support your answer with at least one example.