Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please

The approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.

This distance measures the outer space between the edges of the two lobes in a given time.

The approximate distance from the far edge of one lobe to the far edge of the other in a solar system is about 2,100,000 light-years.

Thus, the approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.

Learn more about distance here: https://brainly.com/question/2854969

#SPJ11

Hydrometeorological hazards are caused by extreme meteorological and climate events, similar as cataracts, famines, hurricanes, tornadoes, or landslides.

Therefore these are the hydro-meteorological hazards.

learn more about hydro-meteorological hazards here:

https://brainly.in/question/1347588

#SPJ10

Answer:

Centimeters

Centimeter

⇒ metric unit of length equal to 0.01 (1/100) of a meter

2.60 moles.

Zn (s) + 2 Ag+ (aq) --> 2 Ag (s) + Zn2+ (aq), each mole of zinc gives out two moles of silver. Therefore, 1.30 moles of zinc will displace 2.60 moles of silver. ( 1.30 × 2)

More about silver nitrate:

An inorganic substance with the chemical formula AgNO3 is silver nitrate. This salt serves as a flexible base for numerous different silver compounds, including those employed in photography. Compared to halides, it is far less light-sensitive. Lunar caustic was previously the name given to it since early alchemists referred to silver as luna and connected it to the moon.

Learn more about silver here:

https://brainly.com/question/8071605

#SPJ4

MM Zn(NO₃)₂ = 189.36 g/mol

mass 1 mol Zn(NO₃)₂ = 189.36 g

mass hydrate = 100 / 63.67 x 189.36 = 297.409 g

mass 1 mol hydrate = 297.409 g

MM hydrate = 297.409 g/mol

MM hydrate = MM Zn(NO₃)₂ + MM xH₂O

297.409 = 189.36 + x(18)

x = 6

Red algae and euglena evolved from a symbiotic relationship of organisms, which resulted in eukaryotic organisms containing chloroplasts

Theory of endosymbiosis:

Early eukaryotes developed by the symbiotic connection of prokaryotes, in accordance with the endosymbiosis idea. Which two protists underwent symbiotic evolution, leading to the development of eukaryotic creatures with chloroplasts.

-Symbiotic relationships between two or more prokaryotic cells led to the evolution of the first eukaryotic cells. Greater prokaryotic cells invaded or devoured smaller prokaryotic cells. The connection provided a secure home and nourishment for the tiny cells. By absorbing part of the organic molecules or energy generated by the endosymbionts, the bigger cells (now referred to as hosts) profited.

To learn more about endosymbiosis refer : https://brainly.com/question/1698852

#SPJ4

Answer:

a.  P=188mmHg

Explanation:

A gas undergoing a change of volume and pressure at constant temperature (and not changing the number of molecules), follows Boyle's Law:  [tex]P_1V_1=P_2V_2[/tex]

The units of these quantities can be any measure of pressure and volume, so long as long as the units are the same between beginning and ending conditions.

Substitute and solve:

[tex]P_1V_1=P_2V_2[/tex]

[tex](685[mmHg])(131[mL])=P_2(478[mL])[/tex]

[tex]\dfrac{(685[mmHg])(131[mL\!\!\!\!\!\!\!\!\!{--}])}{478[mL\!\!\!\!\!\!\!\!\!{--}]}=\dfrac{P_2(478[mL]\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!{----})}{478[mL] \!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!{----}}[/tex]

[tex]187.730125523[mmHg]=P_2[/tex]

Accounting for significant figures, [tex]P_2=188[mmHg][/tex]

Answer: a. The particles in the gas are moving faster than the particles in the liquid

Answer

I think there should be two poles, a north pole and a south pole. so this statement is wrong

Answer: 324 g (to 3 sf)

Explanation:

Based on the coefficients of the equation, we know that when 3.00 mol of water is consumed, 3.00 mol of carbon dioxide is also consumed.

Thus, the formula mass of carbon dioxide is:

[tex]6(15.9994)+12.011=108.0074[/tex] g/mol.

Thus, 3.00 mol has a mass of (108.0074)(3.00)=324 g (to 3 sf)

The mass of Xe present in the syringe given the data is 0.183 g

Using the ideal gas equation, we can obtain the mole of Xe as follow:

n = PV / RT

n = (0.98 × 0.035) / (0.0821 × 298)

n = 0.0014 mole

Mass = mole × molar mass

Mass of Xe = 0.0014 × 131

Mass of Xe = 0.183 g

Learn more about ideal gas equation:

https://brainly.com/question/4147359

#SPJ1

Answer:

A. All the molecules or atoms in motion have kinetic energy.

B. All the molecules or atoms in motion have thermal energy.

C. Each molecule or atom in motion has thermal energy.

D. Each molecule or atom in motion has kinetic energy.

Explanation:

Answer:

Ni atoms are contained in 1.25gram is 1.28e22 atoms.

Explanation:

Ni atoms are contained in 1.25gram is 1.28e22 atoms.

We have a Nickel(Ni)  atom . The atomic number of Ni is 28 .It is a silvery-white metal with a slight golden tinge. Ni belongs to the transitional metal series.

The electronic configuration of Ni = Ar4d⁸35²

Nickel is slowly oxidized by air at room temperature.

Nickel is a ferromagnetic element at approximately room temperature.

To answer the problem , we first need to divide by the molar mass of Ni to get the moles of Ni. And then we will multiply by Avogadro's number to find the number of Ni atoms.

Molar mass of Ni = 58.7gm

Given mass of Ni = 1.25gm

Avogadro’s No. = 6.022 × 10²³ atom/mole

                    Moles of Ni = Given mass/Molecular mass

                                          = 1.25/58.7 = 0.0213

                    Moles of Ni = 0.0213

Now ,

       Number of Ni atom = Avogadro’s number × Moles

So that,

                No. of Ni atom = 6.022 × 10²³× 0.0213

                                            = 0.128 ×10²³  atoms

                                           = 1.28 × 10²² atoms

                                           = 1.28e22

So there are 1.28 × 10²² individual Ni atoms are contained in 1.25 grams of Ni.

Learn more about the moles and molecular mass here:

https://brainly.com/question/27989722

#SPJ10

Answer:

An exergonic reaction releases free energy, and an endergonic reaction absorbs free energy.

Explanation:

hope it helps

Answer: bromine

Explanation:

There are a total of 2+2+6+2+6+2+10+5=35 electrons, meaning there are 35 protons. The element with atomic number 35 is bromine

The volume of 0.125 mole of the gas at the same temperature and pressure 0.30 L

The new volume can be obtained as illustrated below

PV = nRT

Divide both side by P

V = nRT / P

Divide both side by n

V / n = RT / P = Constant

Thus,

V₁ / n₁ = V₂ / n₂

2 / 0.82 = V₂ / 0.125

Cross multiply

0.82 × V₂ = 2 × 0.125

Divide both side by 0.82

V₂ = (2 × 0.125) / 0.82

V₂ = 0.30 L

Learn more about ideal gas equation:

https://brainly.com/question/4147359

#SPJ12

Answer:D

Explanation:

Answer:

25.55 g

Explanation:

To find the total mass of both objects, you need to add the masses together.

22.45 g + 3.1 g = 25.55 g

In correct significant figures (2 sig figs to match 3.1 g), the value would be 26 g.

Answer:

answer = 25.55

Explanation:

You just have to add the mass of the two objects

Answer:

Explanation:

#Let's Study

#I Hope It's Help

#Keep On Learning

#Carry On Learning

[tex]\\ \blue{MaggieEve}[/tex]

Answer:

'An ion has a non-zero electric charge. A radical has an atom with unfilled electron shells and so is very reactive, but is electrically neutral.'

'Atoms are single neutral particles. Molecules are neutral particles made of two or more atoms bonded together.'

'The primary difference that lies between these organic compounds and inorganic compounds is that organic compounds always have a carbon atom while most of the inorganic compounds do not contain the carbon atom in them.'

Organic and inorganic compounds:

Similarities:::---

1) In both organic and inorganic compound, the elements joining in making compound complete their octet.

2) Organic compound shows isomerism (R/S , E/Z , cis/trans, enantiomers, diastereomers, etc), just as inorganic compound do (Δ/Λ, enantiomers, R/S enantiomers, cis/trans, fac/mer isomers, etc).

3) Organic compound and inorganic compounds can be very active in chemical reactions, e.g. organolithium reagents could be flammable or even pyrophoric (generally stored under 10°C), while inorganic reagents like in this paper are quite rapid...

Differences:::---

1) Organic compound are very long in size so they can make polymer but inorganic compound are not very long but its structure might me complex.

2) The boiling,melting point of organic compound is lass than inorganic compound.

3) Organic compound always contains carbon but inorganic compounds might not.

4) Organic compound

_____________________________

Ion and Radical Atoms:

In some sense they are a bit similar. The main difference is that a neutral radical has no charge imbalance between the protons and electrons, but the cation or anion does.

Ions are written with an explicit charge because of that charge imbalance, but radicals may or may not have an imbalance of charge. Just because a molecule is a radical doesn't mean it's neutral.

For example, if you shoot 2-pentanone with an electron beam for Electron "Impact" Mass Spectroscopy, where you essentially study molecules whose structures break into smaller pieces as a result of interacting with stray electrons to identify the molecules, you get a cationic radical (middle, or far right of the following diagram).

The work function of the metal is obtained as 5.1 eV

The cutoff frequency is the frequency below which photo electric effect can not occur as electrons are not removed from the metal surface.

Now;

fo = 1.22 x 10^15 Hz

Wo = hfo

Wo = 6.6 * 10^-34 * 1.22 x 10^15

Wo = 8.1 * 10^-19 J

If 1 eV = 1.60 x 10-19 J

x eV = 8.1 * 10^-19 J

x = 8.1 * 10^-19/ 1.60 x 10-19

x = 5.1 eV

Learn more about cutoff frequency:https://brainly.com/question/14378802

#SPJ1

Answer:

This answer assumes that the strated "16.0g of iron" was meant to be 16.0 grams of iron(III) oxide.

Explanation:

To start, the thermite equation must be balanced.

I find:

1Fe2O3 + 2Al = 1Al2O3 + 2Fe

This tells us we need 2 moles of Al for every 1 mole of Fe2O3.  

Now calculate the moles of each reactant:

Moles Fe2O3:  16.0 g/159.7 g/mole = 0.100 moles Fe2O3

Moles Al:  8.1 /26.98 g/mole = 0.300 moles Al

The balanced equation says that in order to react all of the Fe2O3 we'd need twice that amount (in moles) of the Al.  (0.100 moles Fe2O3)*(2) = 0.200 moles Al.

Which of the two reactants is the limiting reagent?

We have more than enough moles of Al to react with 0.10 moles of Fe2O3.  (We have 0.300 moles Al and all we need is 0.200 moles to react with the 0.10 moles of Fe2O3.  Fe2O3 is the limiting reagent.

Calculate the maximum mass of iron of iron that could be formed using these quantities of reactants.

The balanced equation tells us that we will obtain 2 moles of Fe for every 1 mole of Fe2O3 consumed.  Since Fe2O3 is the limiting reagent, we will assume that it completely reacts.  That means 0.1 moles of Fe2O3 is reacted.  Since we expect twice that many moles of Fe, we should obtain 0.200 moles of Fe.  At 55.85 g/mole, we should obtain:

(0.200 moles Fe)*(55.85 g Fe/mole Fe) = 11.2 grams Fe

Answer:

the asymmetrical arrangement of hydrogen atoms in a molecule of water causes the molecule to be polar, with the hydrogen atoms having a slightly positive charge, and the oxygen atom having a slightly negative charge.

Answer:

1.3 x 10²⁴ atoms Fe

Explanation:

To convert moles to atoms, you need to multiply your given value by Avogadro's Number. This causes the conversion to occur because Avogadro's Number exists as a ratio. It is the ratio that allows for the cancellation of units during multiplication. This is why atoms should be in the numerator of your conversion. The final answer should have 2 sig figs to reflect the given value.

Avogadro's Number:

1 mole = 6.022 x 10²³ atoms

2.1 moles Fe          6.022 x 10²³ atoms
---------------------  x  -------------------------------  =  1.3 x 10²⁴ atoms Fe
                                        1 mole

Answer:

23,31 atm

Explanation:

p1v1 = p2v2

2.3 * 300  = p2 *29.6

p2=23.31 atm

The identity of the noble gas is the sample is Krypton

From the question, we are to determine the identity of the noble gas in the sample

From the ideal gas equation, we have that

PV = nRT

∴ n = PV / RT

Where P is the pressure

V is the volume

n is the number of moles

R is the gas constant

and T is the temperature

From the given information,

P = 678 mmHg = 0.892105 atm

V = 363 mL = 0.363 L

R = 0.08206 L.atm/mol.K

T = 35 °C = 35 + 273.15 K = 308.15 K

Putting the parameters into the equation, we get

n = (0.892105 × 0.363)/ (0.08206 × 308.15)

n = 0.0128 moles

Now, we will determine the Atomic mass of the sample

Using the formula,

Atomic = Mass / Number of moles

Atomic mass of the substance = 1.07 / 0.0128

Atomic mass of the substance = 83.6 amu

The noble gas with the closest atomic mass to this value is Krypton.

Molar mass of Krypton = 83.798 amu

Hence, the identity of the noble gas is the sample is Krypton

Learn more on Ideal Gas law here: https://brainly.com/question/20212888

#SPJ12

did anyone able to look up this question

the ratio for the H is 3.9901