Below are the number of siblings that each of Sarah's six friends has.
4,1,0,3,2, 2
Using this data, create a dot plot where each dot represents a friend.
Number of siblings 4,1,0,3,2,2

PLEASE HELP ME IM SO CONFUSED!!! Please help right away!

Answers

Answer 1

The dot plot where each dot represents a friend is given below

We are given that;

Number of siblings= 4,1,0,3,2, 2

Now,

To create a dot plot using this data, we need to follow these steps:

Draw a horizontal number line with the values from 0 to 4, which are the possible numbers of siblings that Sarah’s friends have. Label the number line as “Number of siblings”.

For each value in the data set, place a dot above the corresponding number on the number line. If there are more than one friend with the same number of siblings, stack the dots vertically.

Give the dot plot a title, such as “Number of Siblings of Sarah’s Friends”.

The dot plot should look something like this:

Therefore, by the dot plot is shown above.

Learn more about dot plot here:

https://brainly.com/question/22746300

#SPJ1

Below Are The Number Of Siblings That Each Of Sarah's Six Friends Has.4,1,0,3,2, 2Using This Data, Create

Related Questions

At a large high school, 20% of the students prefer to have a salad for lunch. What is the average number of people you must ask before you find someone would prefer a salad for lunch?

Answers

We can expect to ask about 2-3 students before finding someone who prefers a salad for lunch, on average.

What is probability?

Calculating the possibility or probability that a specific event will occur uses the concept of probability.

It is a number between 0 and 1, with 0 denoting impossibility and 1 denoting certainty of the event.

Fractions, decimals, and percentages can all be used to express probabilities.

Assuming that each student's preference for lunch is independent of the others, the probability of any given student preferring a salad is 20% or 0.2.

The probability of the first student you ask preferring a salad is 0.2. If they don't prefer a salad, you move on to the next student.

The probability of the second student preferring a salad, given that the first student didn't, is also 0.2. The probability of neither of the first two students preferring a salad is (1-0.2) × (1-0.2) = 0.64.

In general, the probability of the nth student preferring a salad, given that none of the previous n-1 students did, is also 0.2. The probability of none of the first n-1 students preferring a salad is (1-0.2)ⁿ-¹.

So the expected number of students you must ask before finding someone who prefers a salad is:

E(x) = 1×(0.2) + 2×(1-0.2)(0.2) + 3(1-0.2)²×(0.2) + ...

This is an infinite series, but we can approximate it by truncating it after a certain number of terms. Let's say we stop after 10 terms:

E(x) ≈ 1×(0.2) + 2×(1-0.2)(0.2) + 3(1-0.2)²×(0.2) + ... + 10×(1-0.2)⁹ × (0.2)

E(x) ≈ 2.48

To know more about possibility visit:

https://brainly.com/question/29583507

#SPJ1

Please answer my stats question

Answers

Answer:

2.44

Step-by-step explanation:

Surface area leave in pie

Answers

The total surface area of the given figure is 320 units² respectively.

What is the Surface area?

The quantity of space enclosing a three-dimensional shape's exterior is its surface area.

The area is a two-dimensional measurement of the size of a flat surface, whereas surface area is a three-dimensional measurement of the exposed surface of a solid object.

The main distinction between area and surface area is this.

So, the surface area of the cylinder: r = 3

[tex]A=\pi rh+2\pi r^{2}[/tex]

Now, calculate:

[tex]A=2\pi 3*10+2\pi 3^{2} \\A=245 units^{2}[/tex]

The surface area of the cone:

[tex]A = \pi r(r=h^{2} +r^{2} )[/tex]

Insert values as follows:

[tex]A=\pi r(3+\sqrt{4^{2} +3^{2} } )\\A=75.39822[/tex]

Rounding off: 75 units²

The total surface area of the given figure: [tex]75+245=320 units^{2}[/tex]

Therefore, the total surface area of the given figure is 320 units² respectively.

Know more about the Surface area here:

https://brainly.com/question/16519513

#SPJ1

What is the period of the parent cosine function, y = cos(x)?

degrees
What is the period of the cosine function shown in the graph?

degrees
On a coordinate plane, a cosine curve is shown. The period of the cosine function is 1080 degrees.

Answers

The period of the parent cosine function, y = cos(x) is 1

Calculating the period of the parent cosine function, y = cos(x)?

From the question, we have the following parameters that can be used in our computation:

The parent cosine function, y = cos(x)

For a parent cosine function, y = cos(x), the period is always 1

This is the general rule of the cosine sinusoidal function

Hence, the period of the parent cosine function, y = cos(x) is 1

The graph of the cosine function is added as an attachment

Read more about sinusoidal function at

https://brainly.com/question/3842330

#SPJ1

Suppose you went to Vegas and you will bet until you are broke. You start with $ 18 and bet $1 each time for the slot machine. The probability of winning is 0.0028 . Once you win, you earn $20 (net earnings are $10 in total considering $1 you paid to bet). Write a loop to simulate this and report the total number of bets you did until you are broke. Before running the loop, set the seed number equals to 77 .

Answers

If the random number is less than the winning probability of 0.0028, the player wins $20 and we add that to the amount variable.

Otherwise, the player loses $1 and we subtract that from the amount variable.

To simulate this scenario in Python.

Here's a possible implementation:

import random

# Set the seed number

random.seed(77)

# Initialize the starting amount and the number of bets

amount = 18

num_bets = 0

# Loop until the player runs out of money

while amount >= 1:

   # Increment the number of bets

   num_bets += 1

   # Check if the player wins

   if random.random() < 0.0028:

       amount += 20 - 1  # The net earnings are $10

          # Otherwise, the player loses $1

   else:

       amount -= 1

# Report the total number of bets

print(f"Total number of bets: {num_bets}")

In this implementation, we use the random module in Python to simulate the outcome of each bet.

We set the seed number to 77 to ensure that the results are reproducible.

We initialize the starting amount to $18 and the number of bets to 0. We then loop until the player runs out of money (i.e., the amount variable is less than $1).

Inside the loop, we increment the number of bets by 1 and simulate the outcome of the bet using random.

random() which returns a random float between 0 and 1.

If the random number is less than the winning probability of 0.0028, the player wins $20 and we add that to the amount variable.

Otherwise, the player loses $1 and we subtract that from the amount variable.

After the loop ends, we print the total number of bets.

For similar question on probability.

https://brainly.com/question/29280399

#SPJ11

find the area of each parallelogram or rhombus​

Answers

Answer: 36 m²

Step-by-step explanation:

A = bh

b=4

h=9

A=(4)(9) =36 m²

? what is the answer

Answers

The answer to this question is 1!

PLS HELP WITH THIS MATH PROBLEM! Attached is the math problem.

Answers

The expression (x³y⁴)⁻²/(x⁻²y) is the same as x⁻⁴y⁻⁹

What are Exponents:

Exponents are a way of expressing the repeated multiplication of a number by itself.

Here are the rules of exponents:

Product Rule: aᵇ × aⁿ = a⁽ᵇ⁺ⁿ⁾Quotient Rule:  aᵇ / aⁿ = a⁽ᵇ⁻ⁿ⁾Power Rule: (aᵇ)ⁿ = aᵇⁿNegative Exponent Rule: a⁻ⁿ = 1/aⁿ

Here we have

The expression (x³y⁴)⁻²/(x⁻²y)  

The above expression can be simplified as follows

Using the above exponent rules

=>  (x³y⁴)⁻²/(x⁻²y)                  

=>  (x³⁽⁻²⁾y⁴⁽⁻²⁾) /(x⁻²y)                 [ By the Power Rule: (aᵇ)ⁿ = aᵇⁿ ]

=>  (x⁻⁶y⁻⁸) /(x⁻²y)              

=>  (x⁻⁶ · x² · y⁻⁸ · y⁻¹)                 [ By the Quotient Rule:  aᵇ / aⁿ = a⁽ᵇ⁻ⁿ⁾ ]

=>  (x⁻⁶⁺² y⁻⁸⁻¹)                           [ By the Product Rule: aᵇ × aⁿ = a⁽ᵇ⁺ⁿ⁾ ]

=>  (x⁻⁴y⁻⁹)  

Therefore,

The expression (x³y⁴)⁻²/(x⁻²y) is the same as x⁻⁴y⁻⁹

Learn more about Exponents at

https://brainly.com/question/29125740

#SPJ1

Consider a political discussion group consisting of 10 democrats, 9 republicans, and 3 independents. Suppose that two group members are randomly selected, in succession, to attend a political convention. Find the probability of selecting no republicans

Answers

The probability of selecting no Republicans is approximately 0.2102, or about 21.02%.

What is probability?

Probability is a measure of the likelihood of an event occurring.

There are a total of 22 members in the group, consisting of 10 Democrats, 9 Republicans, and 3 Independents.

To find the probability of selecting no Republicans, we need to consider the possible ways in which two members can be selected without any Republicans being chosen.

There are two cases to consider:

The first person selected is not a Republican, and the second person selected is also not a Republican.

The first person selected is a Republican, and the second person selected is not a Republican.

Case 1: The probability of selecting a non-Republican member on the first draw is (10 + 3)/22, since there are 10 Democrats and 3 Independents out of 22 members. After the first member is selected, there are 21 members left, including 9 Republicans. The probability of selecting another non-Republican member on the second draw is (10 + 3 - 1)/(22 - 1), since there is one fewer member in the group after the first draw. Therefore, the probability of selecting no Republicans in this case is:

(10 + 3)/22 * (10 + 3 - 1)/(22 - 1) = 13/77

Case 2: The probability of selecting a Republican member on the first draw is 9/22, since there are 9 Republicans out of 22 members. After the first member is selected, there are 21 members left, including 10 Democrats and 3 Independents. The probability of selecting a non-Republican member on the second draw is (10 + 3)/(22 - 1), since there is one fewer member in the group after the first draw and we cannot select the Republican member again. Therefore, the probability of selecting no Republicans in this case is:

9/22 * (10 + 3)/(22 - 1) = 27/418

The total probability of selecting no Republicans is the sum of the probabilities in the two cases:

13/77 + 27/418 = 0.2102 (rounded to four decimal places)

Therefore, the probability of selecting no Republicans is approximately 0.2102, or about 21.02%.

To learn more about probability from the given link:

https://brainly.com/question/30034780

#SPJ1

Square a has side lenghs of 16 in. And square b has side lengths of 4. Sf=

Answers

Answer:

4

Step-by-step explanation:

you have to multiply 4 times 4 to get 16.

A group of students interning at WDHS are wanting to reward their loyal listeners with free ice cream. To make it easier on their listeners they rent 6 ice cream trucks to space evenly throughout their coverage area.

Answers

Answer:Whats the question like what am I solving I will answer if i have a problem to solve

Step-by-step explanation:

Which of the following three dimensional solids would NOT contain a circle?
cylinder
cone
sphere
cube

Answers

Answer:

cube.................

HELP

A family is building a firepit for their yard that is shaped like a rectangular prism. They would like for the firepit to have a volume of 134.4 ft3. If they already have the length measured at 6.4 feet and the height at 3 feet, what is the width needed to reach the desired volume? 4 feet 7 feet 67.2 feet 115.2 feet

Answers

Answer:

  (b)  7 feet

Step-by-step explanation:

You want the width of a fire pit with a volume of 134.4 ft³ if it is 6.4 feet long and 3 feet high.

Volume

The volume of the pit is given by ...

  V = LWH

Solving for W, we have ...

  W = V/(LH) . . . . . . . . . divide by the coefficient of W

Then the width needed to give the desired volume is ...

  W = (134.4 ft³)/((6.4 ft)·(3 ft)) = 7 ft

The width needed is 7 feet, choice B.

<95141404393>

Write a quadratic equation for the following graph (i’ll give brainliest)

Answers

The quadratic equation which is as represented in the graph and required to be determined is; y = -(x - 1) (x - 5).

Which quadratic equation represents the graph?

It follows from the task content that the quadratic equation which correctly represents the given graph is to be determined.

Recall from the graph that the zeroes are at; x = 1 and x = 5.

Therefore, the equation will take the form;

y = a (x - 1) (x - 5)

To determine the value of a, the pair of coordinates; (2, 3) is used, where, x = 2 and y = 3.

Therefore, 3 = a (2-1) (2 - 5)

a = 3 / -3; a = -1.

Ultimately, the quadratic equation as required to be determined is; y = -(x - 1) (x - 5).

Read more on quadratic equations;

https://brainly.com/question/30863974

#SPJ1

We saw that about 34% of
all students received at least one referral. Suppose we have concerns about the number of
disciplines in one particular school - it seems very high, and we've had concerns from parents at the school. In one particular year, 162 out of the 340 students at that school had a referral.
a. If we selected a random sample of 340 students, would the sample proportion that are
disciplined be approximately normally distributed? Why or why not?
b.
Use the normal distribution to find the probability of randomly selecting a sample of 340
students and finding that 162 of them or more have received a referral during that
particular year.
C. Would we think that is unusual? Explain your reasoning.

Answers

The likelihood of discovering a z-score of 4.39 or higher with a regular normal distribution table or calculator is extremely low, roughly 0.00001.

what is probability ?

It is a scale among 0 and 1 that represents the probability or likelihood of an event happening. In many disciplines, including statistics, physics, economics, law, and computer science, probability theory is extensively used. Many situations, such as games of chance, weather predictions, medical diagnoses, and more, can be explained using the concept of probability. The mathematical computation of probabilities, the analysis for random variables, and the conclusion-making process are all included in the study of probability.

given

The likelihood that 162 or more kids in a randomly chosen sample of 340 pupils will have received a referral in that particular year can be calculated using the normal distribution.

Calculating the sample proportion is necessary:

The predicted value of p is equal to the 0.34 underlying proportion of referred pupils. It is possible to compute the sample proportion's standard deviation as follows:

P equals sqrt[p(1-p)/n] = sqrt[0.34(1-0.34)/340] = 0.031

Calculate the z-score to determine the likelihood of locating 162 or more kids with referrals:

[tex]z = (0.476 - 0.34) / 0.031 = 4.39[/tex]

The likelihood of discovering a z-score of 4.39 or higher with a regular normal distribution table or calculator is extremely low, roughly 0.00001.

To know more about probability visit:

https://brainly.com/question/11234923

#SPJ1

3 x 3/8 simplify the expression

Answers

Answer:9/8

Step-by-step explanation:

Answer:

Step-by-step explanation:

3 x 3/8 = 1 1/8

What is the common base between 2 and 8?

Answers

It’s is 4 because
4x2=8
8divided by 2 is 4

8 and 4 is a half
And 2 and 4

PLEASE SOMEONE HELP.

Functions are in the world all around us. You have used functions to model phenomena and to
make predictions. Mathematically, you can add, subtract, multiply, and divide functions, and you
can also create a composition of functions.

A composition of functions occurs when you evaluate one function using another function, or
even with the same function. A composition of functions is useful when a change in one function
will create a change in another function, which, in turn, affects a third function. For example,
suppose that humans build a housing development on land that was previously used as a corn
field. This change in land usage causes the number of birds in the area to decrease, which causes
the number of mosquitos to increase. You could model the increase in the number of mosquitoes
as a function of the number of birds in the area, which is a function of the number of humans that
live on that land.

You can also use the composition of functions to show that one function is the inverse of another
function. Recall that the graphs of inverse functions are reflections of each other over the line .
Think about these ideas as you read through the scenario below.
Last night it started raining as Hibah was closing up the store where she works. By 3 am, the roof
of the store developed a small hole and water began to leak onto the sales floor. The water
created a circular puddle on the floor. At any time, t,
in minutes, the radius of the puddle increases by 0.1
cm. The rain continued through the night, but stopped
by the time the morning shift arrived at the store at 7
am.

When the employees arrived at work, the leak and
water puddle were discovered. The employees
cleaned up the water puddle and placed a tall circular
bucket underneath the leak, which was still slowly
dripping. The capacity of the bucket can be expressed
as () = 83 + 42 − 6 + 5. By 10 am, the
amount of water in the bucket is () = 23 + 2 − 4 + 7.
Use the information given to explore some of the mathematical concepts you have practiced so
far by answering the questions below.

Answers

Answer:

Hibah's store developed a leak in the roof during a rainstorm, causing a circular puddle to form on the sales floor. The radius of the puddle increased by 0.1 cm per minute. The rain stopped by 7 am, when the morning shift arrived and discovered the puddle. The employees cleaned up the puddle and placed a bucket under the leak.

I hope that's what your looking for :)

PLEASE HELP!
A wool tapestry is 32 years older than a linen tapestry. Twenty years ago, the wool tapestry was twice as old as the linen tapestry. Find the present age of each.

Answer choices:
a. 83, 51
b. 84, 52
c. 85, 53
d. 86, 54
e. 87, 55

Explain in detail how you got to the answer.

Answers

Let's use the variables w and l to represent the current ages of the wool and linen tapestries, respectively.

From the problem, we know that:

w = l + 32 (the wool tapestry is 32 years older than the linen tapestry)

w - 20 = 2(l - 20) (twenty years ago, the wool tapestry was twice as old as the linen tapestry)

We can simplify the second equation by distributing the 2:

w - 20 = 2l - 40

Now we can substitute the first equation into the second equation to eliminate w:

(l + 32) - 20 = 2l - 40

Simplifying this equation, we get:

l + 12 = 2l - 40

Adding 40 to both sides:

l + 52 = 2l

Subtracting l from both sides:

l = 52

Now we can use the first equation to find w:

w = l + 32 = 52 + 32 = 84

Therefore, the present age of the wool tapestry is 84 years old, and the present age of the linen tapestry is 52 years old.

So the answer is option (b) 84, 52.

The function f(x) = 2.75x2 models the packaging costs, in cents, for shipping a book with the side lengths, in inches, shown in the diagram. What are reasonable domain and range values for this function?

A cuboid with base or length x, height 1.5x and width 0.5x.

A. domain: 4 ≤ x ≤ 12; range: 6 ≤ f(x) ≤ 18
B. domain: x ≥ 4; range: f(x) ≥ 44
C. domain: 4 ≤ x ≤ 12; range: 44 ≤ f(x) ≤ 396
D. domain: x ≥ 0; range: f(x) > 0

Answers

On solving the provided question ,we can say that As a result, option C—domain: 4 x 12; range: 44 f(x) 396—is the proper response.

what is a sequence?

A sequence is a grouping of "terms," or integers. Term examples are 2, 5, and 8. Some sequences can be extended indefinitely by taking advantage of a specific pattern that they exhibit. Use the sequence 2, 5, 8, and then add 3 to make it longer. Formulas exist that show where to seek for words in a sequence. A sequence (or event) in mathematics is a group of things that are arranged in some way. In that it has components (also known as elements or words), it is similar to a set. The length of the sequence is the set of all, possibly infinite, ordered items. the action of arranging two or more things in a sensible sequence.

The packing expenses in cents for transporting a book with the specified dimensions are represented by the function f(x) = 2.75x2.

Option B is invalid because the minimal value of x is 0 and the base of the cuboid cannot be negative.

The cuboid's measurements in the diagram also imply that its base length ranges from 4 to 12 inches, hence the function's domain is 4 x 12.

At x = 4, where f(4) = 2.75(4)2 = 44, and x = 12, where f(12) = 2.75(12)2 = 396, f(x) has its minimum and maximum values, respectively. As a result, the function's range is 44 f(x) 396.

As a result, option C—domain: 4 x 12; range: 44 f(x) 396—is the proper response.

To know more about sequence visit:

https://brainly.com/question/21961097

#SPJ1

Please help with this equation i’ll give brainliest!!

Answers

Answer:

The Correct answer is C

y>7

Please help me please l don’t understand

Answers

1. Add the numbers
2x + 4 + 3x + 2
2x + 6 + 3x
2. Combine like terms
Solution = 5x + 6

Enter three hundredths in decimal form.

Answers

Answer: 3/100 as a decimal is 0.03.

Step by step explanation: 3 hundredths means 3 out of 100, which can be represented as = 1003 = 0. 03.

The length of a rectangular frame is represented by the expression 3x + 8, and the width of the rectangular frame is represented by the expression 3x + 6. Write an equation to solve for the width of a rectangular frame that has a total area of 168 square inches.
9x2 + 42x − 120 = 0
9x2 + 42x + 48 = 0
3x2 + 42x − 120 = 0
x2 + 14x + 48 = 0

Answers

The equation we need to solve to find the width of the rectangular frame is 9x² + 42x - 120 = 0.

What is factoring in algebra?

Finding the factors of a polynomial statement is the process of factoring in algebra. A term or expression that, when multiplied by another term or expression, yields the original polynomial is referred to as a factor. In algebra, factoring is helpful because it makes equations simpler and easier to answer. For instance, if the equation x square - 4 = 0 is provided, it can be factored as (x + 2)(x - 2) = 0, and the zero product property can then be used to find x. Calculus uses factoring extensively to determine the roots of functions and to make complex equations simpler.

The area of the rectangle is given as:

A = lw

Now, for the given expression of length and breadth we have:

(3x + 8)(3x + 6) = 168

Thus,

9x² + 42x + 48 = 168

9x² + 42x - 120 = 0

Hence, the equation we need to solve to find the width of the rectangular frame is 9x² + 42x - 120 = 0.

Learn more about area here:

https://brainly.com/question/27683633

#SPJ1

An angle measure 57 degrees. Find the second angle that will make the 2 angles complementary and supplementary angles. (need answer ASAP)

Answers

i. The second angle that will make the 2 angles complementary is 33^o.

ii. The second angle that will make the 2 angles supplementary is 123^o.

What are complementary and supplementary angles?

Complementary angles are measure of given angles whose addition gives a right angle i.e 90^o. While two or more angles are supplementary when their addition produces 180^o.

a. To find the second angle that will make the 2 angles complementary, we have;

let the second angle be represented by x, then;

x + 57 = 90

x = 90 - 57

  = 33

x = 33^o

b. To find the second angle that will make the 2 angles supplementary, we have;

let the second angle  be represented by y; so that;

y + 57 = 180

y = 180 - 57

  = 123

y = 123^o

Learn more about complementary and supplementary angles at https://brainly.com/question/30772974

#SPJ1

Your friend is considering how much he should invest in his new IRA. He is debating if he should invest the full $800 he was planning to or just $400 and use the extra money to buy a couple of pairs of sneakers he had been eyeing. What advice would you give? Use math to justify your answer

Answers

Answer:

invest full 800$

Step-by-step explanation:

I would advise my friend to invest the full $800 in his new IRA. While buying a couple of pairs of sneakers may provide immediate satisfaction, investing in an IRA can have long-term financial benefits.

If we assume an average annual return of 8% for his IRA, then the $800 investment would grow to approximately $4,536 after 30 years. On the other hand, if he only invests $400 and spends the remaining $400 on sneakers, then the investment would only grow to approximately $2,268 after 30 years.

Thus, by investing the full $800, my friend would have a potential gain of over $2,268 compared to if he only invested $400. Furthermore, investing in an IRA can provide tax benefits and potentially reduce his taxable income, providing additional financial benefits.In summary, while it may be tempting to use some of the money for immediate gratification, investing the full $800 in an IRA can provide long-term financial benefits that outweigh the short-term satisfaction of purchasing a couple of pairs of sneakers.

QUESTION 3

3.1

3.1.1 How many items did Thato buy ?

3.1.2 Calculate the total discount paid on the items that she bought

3.1.3 Calculate the total including VAT paid on this transaction

3.2 Thato is a resident in the Phakisa municipality and below is a tariff on a

sliding scale that the municipality uses to charge her for water usage.

 Fixed charge if > 6 kl = R80,70

 Free for infrastructure if > = R7,15

3.2.1. Calculate the cost if Thato uses 35 kl of water charge

3.2.2 Calculate the new fixed charge if it is increased by 15%

Answers

New fixed charge: R80.70 * 1.15 = R92.805

How to solve

Thato bought 5 items with the following prices and discounts:

Item 1: R100 with a 10% discount

Item 2: R200 with a 5% discount

Item 3: R300 with a 20% discount

Item 4: R400 with no discount

Item 5: R500 with a 15% discount

VAT rate: 15%

3.1.1 Thato bought 5 items.

3.1.2 Calculate the total discount paid on the items that she bought:

Item 1: R100 * 10% = R10

Item 2: R200 * 5% = R10

Item 3: R300 * 20% = R60

Item 4: R400 * 0% = R0

Item 5: R500 * 15% = R75

Total discount: R10 + R10 + R60 + R0 + R75 = R155

3.1.3 Calculate the total including VAT paid on this transaction:

Total price before discount: R100 + R200 + R300 + R400 + R500 = R1500

Total price after discount: R1500 - R155 = R1345

Total VAT: R1345 * 15% = R201.75

Total including VAT: R1345 + R201.75 = R1546.75

Sliding scale for water consumption:

0 - 6 kl: R0/kl

7 - 12 kl: R12/kl

13 - 35 kl: R15/kl

Above 35 kl: R20/kl

Now we can answer the questions:

3.2.1. Calculate the cost if Thato uses 35 kl of water:

7 - 12 kl: 6 kl * R12/kl = R72

13 - 35 kl: 23 kl * R15/kl = R345

Total water consumption cost: R72 + R345 = R417

Total cost including fixed charge: R417 + R80.70 = R497.70

3.2.2 Calculate the new fixed charge if it is increased by 15%:

New fixed charge: R80.70 * 1.15 = R92.805

Read more about tariff here:

https://brainly.com/question/1172085

#SPJ1

Please help with this

Answers

Answer:1/10

Step-by-step explanation:

In order to solve this, you need to read the question carefully. If you have 1 whole divided into 10 equal parts you need to divide 1 by 10.

The visualization for this is 1 ÷ 10, which translates to 1/10

A tip to remember is that ÷ looks a bit like a fraction with the numbers replaced with dots!

Determine the scale factor. Give your answer as a fully simplified improper fraction.

Answers

Answer: 21/12 =7/4

Step-by-step explanation:

The scale factor is the ratio of the lengths of corresponding sides in the preimage and the image. For example, the length of A'B' is 21 units, and the length of AB is 12 units. Therefore, the scale factor is 21/12 =7/4

The vertices of a rectangle are plotted in the image shown. A graph with the x-axis and y-axis labeled and starting at negative 8, with tick marks every one unit up to positive 8. There are four points plotted at negative 1, 3, then 3, 3, then negative 1, negative 3, and at 3, negative 3. What is the perimeter of the rectangle created? 20 units 24 units 10 units 16 units

Answers

Answer:

To find the perimeter of the rectangle, we need to add up the lengths of all four sides.

The horizontal sides of the rectangle have a length of 3 - (-1) = 4 units.

The vertical sides of the rectangle have a length of 3 - (-3) = 6 units.

Therefore, the perimeter of the rectangle is:

2(4 units) + 2(6 units) = 8 units + 12 units = 20 units.

Therefore, the perimeter of the rectangle is 20 units. Answer: 20 units.

The perimeter of the rectangle is 20 units.

What is a rectangle?

A rectangle is a 2-D shape with length and width.

The length and width are different.

If the length and width are not different then it is a square.

The area of a rectangle is given as:

Area = Length x width

We have,

Using the distance formula, the length of the side between (-1,3) and (3,3).

= √[(3 - (-1))² + (3 - 3)²]

= √16

= 4

Similarly, the length of the side between (3,3) and (3,-3).

= √[(3 - 3)² + (3 - (-3))²]

= √36

= 6

The length of the side between (3,-3) and (-1,-3) is also 4, and the length of the side between (-1,-3) and (-1,3) is 6.

Now,

The perimeter of the rectangle.

= 4 + 6 + 4 + 6

= 20

Thus,

The perimeter of the rectangle is 20 units.

Learn more about rectangles here:

https://brainly.com/question/15019502

#SPJ2

Other Questions
Explain why it would be better to do two, three, or even four small volume extractions rather than one large one. Simplify this answer please The langelier index is used to determine the point if stablity of What is the purpose of Ariel's speech after the banquet vanishes? What contribution does the speech make to the plot, or sequence of events? How does the speech make to the end of the act build on the speech? Of 900 randomly selected cases of lung cancer, 360 resulted in death within five years. Construct a 95% two-sided confidence interval on the death rate from lung cancer. What are the steps for applying an update set to an instance? Select 3 Answers from the below options.- Copy- Retrieve- Preview- Delete- Commit asymmetrical alkyne + H (1 mol equivalent) + lindlar catalyst Does a MAC scheme provide non-reputation? Explain your answer. what is extraversion vs intraversion according to Jung? How will the word of the wiser that the general gives to joby his role in the next day's battle most likely affect joby? Do you think most people understand the differencesbetween cultural competence versus cultural diversity .please answer this for thump up Vertebral Artery Insufficiency (VBI): Symptoms- 5 D's And 3 N's... what is the "And"? Use the method of Frobenius and the larger Indicial root to find the first four nonzero terms in the series expansion about x = 0 for a solution to the giver equation for x>0, 100x*y *20x+y +21=0 What are the first four terms for the series? Y-0. (Type an exprontion in terms of alo) Identify how the following innovations contributed to the market revolution. Espresso Yourself Coffee Shop hires workers in a competitive labor market to make coffee. The ingredients required to make each cup of coffee cost 50 cents. Thecoffee shop's hourly output of coffee varies with the number of workers hired, as shown in the accompanying table. Each cup of coffee sells for $2.Number of workers Coffee (cups/hour)0254560700123457578The value of marginal product of the first worker isO $37.50O $25.00O $2.00O $1.50per hour, a 32-year-old man complains of left eye pain and foreign body sensation. he reports associated tearing and photophobia. he was grinding metal without wearing protective eye gear. an eye exam with fluorescein is performed as shown above. what is the most likely diagnosis? Which group caused particular problems to the Tsars previous to Alexander III? 31) What is the theoretical yield of waffles if you have 6 cups of flour, 9 eggs and 2 tbs of oil? Given: 2 cups flour + 3 eggs + 1 tbs oil 4 wafflesA) 10B) 12C) 8D) 4E) not enough information The combustion of octane, C8H18, proceeds according to the reaction shown.2C8H18(l)+25O2(g)16CO2(g)+18H2O(l)If 538 mol of octane combusts, what volume of carbon dioxide is produced at 31.0 Cand 0.995 atm? According to the UDDA, death is determined by one of two criteria. What is included in these criteria?