You have quarters. You find ​% more quarters in your room. Then you go shopping and spend ​% of the total number of quarters. Write an expression to represent the total number of quarters you take with you shopping.​ Calculate, in​ dollars, the amount of money you have left.

Answers

Answer 1

Complete question :

You have 20 quarters. You find 40% more quarters in your room. Then you go shopping and spend 50% of the total number of quarters.

A. Write an expression that represents the total number of quarters you take with you when you go shopping.

B. How much money do you have left?

Answer:

[20 + (0.4*20)] = 28 quarters

$3.5

Step-by-step explanation:

Given that:

Initial number of quarters = 20

Quarters in room = 40%

Hence, Numbe of quarters in room = 0.4 * 20 = 8

Total number of quarters taken for shopping :

(Initial amount + Numbe of quarters in room)

(20 + 8) = 28 quarters

50% of quarters was spent on shopping :

0.5 * 28 = 14 quarters

Total left :

28 - 14 = 14

Quarters left in dollars :

1 quarter = 25 cent = 0.25 dollars

14 * $0.25 = $3.5


Related Questions

for a soccer game Mr Morant prepared 32 hot dogs he sol1/2 to the fans

Answers

That’s a lot of hot dogs. Where’s the rest of the problem?

X
GEOMETRY The sum of the measures of
the angles of a triangle is 180°.
Find the missing measure.
35°
45

Answers

Answer:

Step-by-step explanation:

Sum of all three angle in a triangle=180

Given angles are 35°,45°

Let the remaining angle =x

So 35 +45+X=180

X=180-80

X=100°

Remaining angle =X=100° is the answer

(1,-19),(-2 -7) finnd the slope to this equation

Answers

Answer:

slope is 4

Step-by-step explanation:

Write the equation for a parabola with the focus at
(-1, 4) and the equation of the directrix x = 5.
(x + 1)2 = 3(y-4)
(y-4)2 = 12(x + 1)
(y-2)2 = -3(x – 4)
(y-4)2 = –12(x - 2)

Answers

The answer is (y - 4)2 = -12(x - 2)
Since the graph is facing the left, the starting equation would be (y - k)2 = -4p(x - h).
(h, k) is the vertex of the graph. If you plot the focus and the directrix, you can see that the distance is 6. Divide 6 by 2, thus the vertex should be 3 squares away from the focus and 3 squares away from the directrix. The vertex is (2, 4). And since the distance from the focus to the vertex and the distance from the directrix to the vertex is 3, P = 3.
Insert the numbers in and you should get the last choice.

URGENT MCQ Name the base of the triangle below.

Answers

Answer:

base of the triangle is answer c) bc

PLEASE HELP ME!! THANK YOU!!

Answers

9514 1404 393

Answer:

  [-4,3]

Step-by-step explanation:

The domain is the left-right (horizontal) extent of the function. The dots at the end of the continuous line are solid, so the brackets on the interval are square brackets.

The left dot is at x=-4; the right dot is at x=3, so the domain is ...

  [-4,3]

please help! no rush though :)

1.6 x 10^5kg and 8 x 10^3kg

(i need it with too but if you can’t it’s all good!)

Answers

Answer:

160000 kg and 8000

Step-by-step explanation:

move decimal to the right five times

move decimals to right 3 times  

C=5(f-32)/9
Make f the subject of the formula
Give answer in the form of aC+b/c

Answers

Answer:

F = [tex]\frac{9C+160}{5}[/tex]

Step-by-step explanation:

Given

C = [tex]\frac{5(F-32)}{9}[/tex] ( multiply both sides by 9 to clear the fraction )

9C = 5(F - 32) ← distribute

9C = 5F - 160 ( add 160 to both sides )

9C + 160 = 5F ( divide both sides by 5 )

[tex]\frac{9C+160}{5}[/tex] = F

(first question btw)

please help i will mark brainliest if correct!

Answers

Answer:

(3,9)

Step-by-step explanation:

Because the translation moves 1 in the x direction and 4 in the y direction, you just add those to the starting x and y coordinates.

(2+1, 5+4)

(3, 9)

What's the opposite of -1.5 and 3/4?

Answers

Answer:

1.5

- 3/4

Step-by-step explanation:

To find the opposite of a number, you just have to either add or remove a negative sign.

- 1.5 is negative, so the opposite of negative 1.5 is positive 1.5 or 1.5

3/4 is positive, so the opposite of positive 3/4 is negative 3/4 or - 3/4

I Hope That This Helps! :)

Answer:

1.5

- 3/4

Step-by-step explanation: CREDIT TO GUY ABOVE!

A pilot can travel 450 miles with the wind in the same amount of time as 360 miles against the wind. Find the speed of the wind if the​ pilot's speed in still air is 315 miles per hour.

Answers

Given:

A pilot can travel 450 miles with the wind in the same amount of time as 360 miles against the wind.

Pilot's speed in still air is 315 miles per hour.

To find:

The speed of the wind.

Solution:

Let the speed of wind be x miles per hour.

Speed with wind = 315+x miles per hour

Speed against wind = 315-x miles per hour

We know that,

[tex]Time=\dfrac{Distance}{Speed}[/tex]

According to the question,

[tex]\dfrac{450}{315+x}=\dfrac{360}{315-x}[/tex]

Divide both sides by 90.

[tex]\dfrac{5}{315+x}=\dfrac{4}{315-x}[/tex]

By cross multiplication, we get

[tex]5(315-x)=4(315+x)[/tex]

[tex]5(315)-5x=4(315)+4x[/tex]

[tex]5(315)-4(315)=4x+5x[/tex]

[tex](5-4)315=9x[/tex]

Divide both sides by 9.

[tex]\dfrac{(1)315}{9}=x[/tex]

[tex]35=x[/tex]

Therefore, the speed of wind is 35 miles per hour.

Jaidee invests $2,628 in a retirement account with a fixed annual interest rate of 2.33% compounded 12 times per year. How long will it take for the account balance to reach $3,726.18?

Answers

Answer:

The time it will take for the account balance to reach $3,726.18 is 15 months.

Step-by-step explanation:

The information provided is:

Jaidee invests $2,628 in a retirement account With a fixed annual interest rate of 2.33% Compounded 12 times per year, i.e. compounded monthly.Final account balance: $3,726.18

The formula of compound interest (compounded monthly) is:

[tex]A=P(1+\frac{r}{12})^{12t}[/tex]

Compute the value of t as follows:

[tex]3726.18=2628\times (1+\frac{0.0233}{12})^{12t}\\\\\frac{3726.18}{2628}= (1.00194167)^{12t}\\\\1.41787671= (1.00194167)^{12t}\\\\\log(1.41787671)= 12t\times \log(1.00194167)\\\\12t=\frac{\log(1.41787671)}{\log(1.00194167)}\\\\t=14.99995\\\\t\approx 15[/tex]

Thus, the time it will take for the account balance to reach $3,726.18 is 15 months.

Positive negative or no correlation?

Answers

Answer:

positive correlation

Answer:

animal

Step-by-step explanation:

What is the answer to 3z−6/7−2z = 1.2/3.2 ? Please help

Answers

Answer:

= 1.23214285

Step-by-step explanation:

Answer:z=69/56
Explanation:
Step 1:collect like terms
Step 2:convert the decimals into fraction
Step 3:reduce the fraction with 5
Step 4:reduce the fraction with 2
Step 5:move the constant to the right hand side and change its sign
Step 6:add the fractions

Dave wants to put a row of tiles in his kitchen. The row has to be 3 meter long. Each tiles is a square, with 25 cm sides. How many tiles does he need?

Answers

Answer:the answer is b or c

Step-by-step explanation:

Determine the value of x.

Answers

Answer:

7x-12=9x-26
X=7

I am given that p || q. ∠1 and ∠4 are supplementary angles because they form a linear pair, so m∠1 + m∠4 = 180°. ∠4 and ∠8 are also supplementary because of the Same-Side Interior Angles Postulate, so m∠4 + m∠8 = 180°. You can substitute m∠4 + m∠8 for 180° in the first equation above. The result is m∠1 + m∠4 = m∠4 + m∠8. After subtracting m∠4 from each side, I see that m∠1 = m∠8.

Answers

Answer:

3

Step-by-step explanation:

Replace 8 with 3

Cz angle 4 is equal to 8

Angle 4+Angle 3 is 180⁰

And angle one is equal to angle three

a store sells jump ropes. each jump rope costs the same amount. during a sale, the store reduces the price of each jump rope by $1.25. jada spends $15.08 on 2 jump ropes at the sale price.

Answers

Answer:

she spent $7.45 on each rope at the sale price. The original price would have been $8.70

Step-by-step explanation:

A truck can be rented from Company A form ​$130 a day plus $0.30 per mile. Company B charges ​$50 a day plus $0.80 per mile to rent the same truck. Find the number of miles in a day at which the rental costs for Company A and Company B are the same.

Answers

Answer:

160 miles

Step-by-step explanation:

Company A form ​$130 a day plus $0.30 per mile

Company A = 130 + 0.30x

Company B charges ​$50 a day plus $0.80 per mile

Company B = 50 + 0.80x

Where,

x = number of miles

Equate the cost of company A and company B

130 + 0.30x = 50 + 0.80x

Collect like terms

130 - 50 = 0.80x - 0.30x

80 = 0.50x

Divide both sides by 0.50x

x = 80 / 0.50

= 160

x = 160 miles

The number of miles in a day at which the rental costs for Company A and Company B are the same is 160 miles

The office manager of First Tech Support borrowed $25,000 to purchase new computers for employees. The bank charges 6 percent interest for 4 years. How much interest will the company pay in all?
$1,200
$1,500
$4,800
$6,000

Answers

Answer:

it is 6,000$

Step-by-step explanation:

Answer:

6,000

Step-by-step explanation:

If two thirds of a number is 56, what is three- quarters of that number?

Answers

Answer:

63

Step-by-step explanation: Let n represent the number.  If two third of n = 56, n must be 56 times the reciprocal of 2/3 (3/2) 56 time 3/2 = 84.  three quarter of 84 is 84 times 3/4 = 63

can't figure this out​

Answers

Answer:

2.55%

Step-by-step explanation:

You have 11 years to make $500, To do this, take the 11 and multiply it by the percentage, after that, do $2000 divided by 11 x (percentage) answer. Then you will have the difference, which should roughly equal $556, which is slightly over $500 but you can't have it under so this is the best answer.

what are the properties of pollelogram?​

Answers

Answer:

any chooses

Step-by-step explanation:

Will give brainliest if correct

Answers

Answer:

y=4

x=2

Step-by-step explanation:

y=4

x=2

I think it's right..

Hope I helped!

Answer:

x - intercept = 2

y - intercept = 4

Which of the following points is a solution of y s-Ixl - 1?
O (-1,-3)
O (0,0)
O (1,-1)

Answers

Answer: The answer is (-1,-3) :)

Step-by-step explanation:

Mark me as brainlest please

6.
Simplify
4√8 + 3√18 √32​

Answers

Answer:

83.31370849

Step-by-step explanation:

I got you get the 100

The radius of a circle is 5 kilometers. What is the length of a 90° degree arc?

Answers

Answer:

s =5*π/2 km

Step-by-step explanation:

arc length s =  rθ

where θ =central angle in radians

r = 5km

θ = 90 degrees = 90 degrees/360degrees * 2π = [tex]\frac{1}{4}[/tex](2π) = π/2

s =5*π/2 km

Jacob ate 21 Chips Ahoy cookies in 1 hour and Bryant ate 25 Chips Ahoy cookies in the same time. At this rate, how many whole cookies could Bryant eat in 80 minutes?

help asp
explain please!! ​

Answers

Answer:

55 cookies in 80 mins

Step-by-step explanation:

1 hour has 60 mins

so 25/60=0.417

0.417/3=0.139

0.139x4=0.556

so he can eat 55 cookies in 80 mins

Put the equation 2x+3y=1470 in function notation

Answers

Answer:

y = -[tex]\frac{2}{3}[/tex]x + 9

Step-by-step explanation:

A train is traveling at a constant speed and goes 7.5 kilometers in 6 minutes. At that rate:




How far does the train go in 1 minute?
how far does the train go in 100 minutes?

Answers

Answer:

1.25 km in 1 minute

125 km in 100 minutes

Step-by-step explanation:

Find its speed in km/min by dividing the km by number of minutes:

7.5/6

= 1.25

So, the train goes 1.25 km in 1 minute.

Using this speed, find how far it goes in 100 minutes, by multiplying the speed by 100:

1.25(100)

= 125

So, in 100 minutes, the train goes 125 km.

a. The distance travelled by the train in 1 minute, at a constant speed is 1.25 kilometers.

b. The distance travelled by the train in 100 minute, at a constant speed is 125 kilometers.

Given the following data:

Distance = 7.5 kilometersTime = 6 minutes

To find how far (distance) the train go in 1 minute, we would use direct proportion:

7.5 kilometers = 6 minutes

X kilometers = 1 minute

Cross-multiplying, we have:

[tex]6 \times X = 7.5\\\\X = \frac{7.5}{6}[/tex]

X = 1.25 kilometers.

b. To find how far (distance) the train go in 100 minute:

Since the train travels 1.25 kilometers in 1 minute, we would multiply that distance by 100.

[tex]D(100) = 1.25 \times 100\\D(100) = 125 \; kilometers[/tex]

Distance = 125 kilometers.

Read more: https://brainly.com/question/18676621

Other Questions
Who knows how to do this Can i get some help please what do you need to add to 2 4/7 to make 4 will mark brainliest pls help lol What would I write for the corresponding subject pronoun in Spanish? (you dont have to do all of them but the first two would be helpful) How can drivers share the road responsibly? Susan won $2000 and invested it into an account with an annual interest rate of 3.2%. If her investment were compounded monthly, which expression best represents the value of her investment after t years Theravada Buddhism teaches that the Buddha is a god. true or false which expression is equivalent to sin(pi/12)cos(7pi/12)-cos(pi/12)sin(7pi/12)? a) cos(-pi/2) b) sin(-pi/2) c) cos(2pi/3) d) sin(2pi/3) PLZ HELP I DONT UNDERSTAND (show steps) evaluate 68 x 71 mentally. A gas sample is made entirely of carbon dioxide and water, and there are 300 moles of CO2 and 500 moles of H2O. If the total pressure of the sample is 21 atm, what is the partial pressure of H2O ? Ptotal = Pa + Pb+ Pc....... Pa = Xa(Ptotal) Give two reasons why many people believe that artificial human cloning is not ethically acceptable. Your gym membership costs $30 to join and $25 per month. Which equation gives the total costs y, for a membership that lasts x months? Which expression is the same as 53 5 3 ? please help asap!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! will give brainliest Which pathway is responsible for returning deoxygenated blood from the body to the heart? O A. The arteries OB. Systemic circulation loop O c. The right lung O D. Pulmonary circulatory loop HOW DOES AN ENABLER AFFECT AN ALCOHOLIC Though the microbes described in the introductory chapter do not corrode the metal in the subway, many microbes influence corrosion and deterioration of metal and stone. Other microbes have other effects on their environment. During wastewater treatment, bacteria are used to reduce the amount of organic and inorganic materials so that the water no longer supports substantial microbial growth. During secondary wastewater treatment, bacteria within sludge digesters break down organic materials into fatty acids, H2, and CO2. These products are fermented to acetate, CO2, and H2. Finally, archaeans ferment acetate to form methane and carbon dioxide. Just by knowing this information, what is true of the bacteria used in sludge digesters?a. They are capable of anaerobic metabolism.b. They are sulfate-reducing bacteria.c. Some are methanogens.d. They are capable of forming slime layers. different between density and realative density