What value of b will cause the system to have an infinite number of solutions?

A system of equations. y equals 6 x plus b. negative 3 x plus StartFraction one-half EndFraction y equals negative 3.

A coordinate grid with a line labeled negative 3 x plus StartFraction one-half EndFraction y equals negative 3 and passes through the points (1, 0) and (0, negative 6).

-6
-3
3
6

Answers

Answer 1

Answer:

-6 on edge

Step-by-step explanation:

Answer 2

The value of b that causes the system of equations to have infinite solutions will be: b = -6

System with infinite solutions:

A system of linear equations will have infinite solutions only when both equations represent the same line.

In this case our equations are:

y = 6x + b

-3x + (1/2)*y = -3

So the value of b needs to be such that these two equations are equal

Let's isolate y in the second equation:

(1/2)*y = -3 + 3x

y = -3*2 + 3x*2 = -6 + 6x

Then we must have:

6x - 6 = 6x + b

-6 = b

Thus, the value of b that causes the system to have infinite solutions is b = -6.

If you want to learn more about systems of equations, you can read:

https://brainly.com/question/13729904


Related Questions

To solve a polynomial inequality, we factor the polynomial
into irreducible factors and find all the real_______polynomial. Then we find the intervals determined by the real__________sign of the polynomial on that interval. Let
$$P(x)=x(x+2)(x-1)$$
Fill in the diagram to find the intervals on which
$P(x) \geq 0$
we see that $P(x) \geq 0$ on the
intervals_______and________.

Answers

Answer:

To solve a polynomial inequality, we factor the polynomial into irreducible factors and find all the real _zeros_ polynomial. Then we find the intervals determined by the real _zeros and use test points in each interval to find the_ sign of the polynomial on that interval.

If P(x) = x(x+2)(x-1)

And P(x) ≥ 0

We see that P(x) ≥ 0 on the intervals (-2, 0) and (1, ∞).

Step-by-step explanation:

The complete question is attached to this solution

To solve inequality of a polynomial, we first obtain the solutions of the polynomial. The solutions of the polynomial are called the zeros of the polynomial.

If P(x) = x(x+2)(x-1)

The solutions of this polynomial, that is the zeros of this polynomial are 0, -2 and 1.

To now solve the inequality that arises when

P(x) ≥ 0

We redraw the table and examine the intervals

The intervals to be examined as obtained from the zeros include (-∞, -2), (-2, 0), (0, 1) and (1, ∞)

Sign of | x<-2 | -2<x<0 | 0<x<1 | x>1

x               | -ve | -ve | +ve | +ve

(x + 2)       | -ve | +ve | +ve | +ve

(x - 1)         | -ve | -ve | -ve | +ve

x(x+2)(x-1) | -ve | +ve | -ve | +ve

The intervals that satisfy the polynomial inequality P(x) = x(x+2)(x-1) ≥ 0 include

(-2, 0) and (1, ∞)

Hope this Helps!!!

Im stuck who can help me

Answers

Answer:

Option D

Step-by-step explanation:

This question is based on the " Partition Postulate. " You might be familiar with it, it states that a whole is composed of several parts. In this case you could say that this " whole " is ∠ ABC, and the " parts " are ∠1 and ∠2. By this Theorem you could also state the following;

[tex]m< ABC = m< 1 + m< 2,\\\\Substitute,\\110 = 4x + ( 5x + 10 ),\\110 = 4x + 5x + 10,\\4x + 5x + 10 = 110 - Option D\\\\Solution - Option D[/tex]

Hope that helps!

Draw a model of square root of 12 using perfect squares

Answers

Answer:

The answer is "[tex]\sqrt{12}[/tex] is not a perfect square".

Step-by-step explanation:

12 is not a perfect square because it is the natural number, and no other natural number would square the number 12, that's why it is not a perfect square.

If we calculate the square root of [tex]\sqrt{12}[/tex]. so, it is will give [tex]2\sqrt{3}[/tex] that is not a perfect square root which can be described as follows:

[tex]\Rightarrow \sqrt{12}= \sqrt{2\times 2\times 3}[/tex]

            [tex]= \sqrt{2^2\times 3}\\\\= 2\sqrt{3}\\\\[/tex]

[tex]\bold{\sqrt{12}}[/tex] is not a perfect square root.

Answer:

Here's a picture

Step-by-step explanation:

The point A (-7,5) is reflected over the line x = -5, and then is reflected over the line x= 2. What are the coordinates of
A?
o (7, 19)
O (10,5)
(7,5)
(10, 19)

Answers

Answer:

(7, 5) is the final reflection of the point.

Step-by-step explanation:

We are given point A(-7, 5) which is first reflected over the line [tex]x= -5[/tex].

The minimum distance of the point A(-7, 5) from the line [tex]x= -5[/tex] is 2 units across the horizontal path (No change in y coordinate).

Point A lies 2 units on the left side of the line [tex]x= -5[/tex].

So, its reflection will be 2 units on the right side of [tex]x= -5[/tex].

Let its reflection be A' which has coordinates as (-5+2,5) i.e. (-3, 5).

Now A'(-3, 5) is reflected on the line [tex]x=2[/tex].

The minimum distance of the point A'(-3, 5)  from the line [tex]x=2[/tex] is 5 units across the horizontal path (No change in y coordinate).

Point A' lies 5 units on the left side of the line [tex]x=2[/tex].

So, its reflection will be 5 units on the right side of [tex]x=2[/tex].

Let its reflection be A'' which has coordinates as (2+5, 5) i.e (7, 5) is the final reflection of the point..

Please find attached image.

(7, 5) is the final reflection of the point.

Solve for n.

11(n – 1) + 35 = 3n

n = –6
n = –3
n = 3
n = 6

Answers

11n-11+35=3n
11n+24=3n
11n-3n=-24
8n=-24
n=-24/8
n=-3

Answer:

[tex]n = - 3[/tex]

Second answer is correct

Step-by-step explanation:

[tex]11(n - 1) + 35 = 3n \\ 11n - 11 + 35 = 3n \\ 11n - 3n = 11 - 35 \\ 8n = - 24 \\ \frac{8n}{8} = \frac{ - 24}{8} \\ n = - 3[/tex]

hope this helps

brainliest appreciated

good luck! have a nice day!

The mean weight of frozen yogurt cups in an ice cream parlor is 8 oz.Suppose the weight of each cup served is normally distributed withstandard deviation 0.5 oz, independently of others.(a) What is the probability of getting a cup weighing more than 8.64oz

Answers

Answer:

10.03% probability of getting a cup weighing more than 8.64oz

Step-by-step explanation:

Problems of normally distributed samples are solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the zscore of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the pvalue, we get the probability that the value of the measure is greater than X.

In this question, we have that:

[tex]\mu = 8, \sigma = 0.5[/tex]

What is the probability of getting a cup weighing more than 8.64oz

This is the 1 subtracted by the pvalue of Z when X = 8.64. So

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]Z = \frac{8.64 - 8}{0.5}[/tex]

[tex]Z = 1.28[/tex]

[tex]Z = 1.28[/tex] has a pvalue of 0.8997

1 - 0.8997 = 0.1003

10.03% probability of getting a cup weighing more than 8.64oz

Simplify -2(-5) - 7 + 1(-3)

Answers

Answer:

Step-by-step explanation:

BRUH YOU STUPID

Answer:

0

[tex] \\ solution \\ - 2( -5) - 7 + 1( - 3) \\ = 10 - 7 + ( - 3) \\ = 10 - 7 - 3 \\ = 3 - 3 \\ = 0 \\ hop \: it \: helps...[/tex]

In a survey, participants were asked how much confidence they had in the economy.
The results were as follows:



Response Number

A great 3,187
deal

Some
9,120

Hardly 5,149
any



What is the probability that a sampled person has either some confidence or a great
deal of confidence in the economy? Write only a number as your answer. Round to
two decimal places (for example: 0.43). Do not write as a percentage.

Answers

Answer:

0.71

Step-by-step explanation:

Great Deal or Some = 12,307

Total Participants = 17,456

Probability = 12,307/17,456 = 0.71

Giving a test to a group of students, the grades and gender are summarized below

A B C Total
Male 7 20 14 41
Female 3 4 19 26
Total 10 24 33 67


If one student is chosen at random,

Find the probability that the student was male OR got an "A".

Answers

Answer:

46/ 67

Step-by-step explanation:

The numbers of students irrespective of grades is;

The sum of the last roll of numbers:

10+24+ 33+ 67 = 134

The number of males irrespective of grades is the sum of the numbers in the male row ;

7 +20+ 14 +41= 82

The numbers of students with grade A is the first column at the last row and is 10;

Hence;

the probability that the student was male OR got an 'A' is

the probability that the student was male plus the probability that he/she got an 'A'.

The probability that it's a male is ;

Number of males/ total number of students

=82/134

The probability that he got an A is;

The number of students that got A/ the total number of students;

10/134

Hence

the probability that the student was male OR got an 'A' is;

82/ 134 + 10/134 = 92/134 = 46/ 67

This table gives a few (x,y) pairs of a line in the coordinate plane. What is the y-intercept of the line?

Answers

Answer:

(0,34)

Step-by-step explanation:

I graphed the coordinates of the table on the graph below to find the y-intercept.

What is the approximate value for the modal daily sales?

Answers

Answer:

Step-by-step explanation:

Hello!

The table shows the daily sales (in $1000) of shopping mall for some randomly selected  days

Sales 1.1-1.5 1.6-2.0 2.1-2.5 2.6-3.0 3.1-3.5 3.6-4.0 4.1-4.5

Days 18 27 31 40 56 55 23

Use it to answer questions 13 and 14.

13. What is the approximate value for the modal daily sales?

To determine the Mode of a data set arranged in a frequency table you have to identify the modal interval first, this is, the class interval in which the Mode is included. Remember, the Mode is the value with most observed frequency, so logically, the modal interval will be the one that has more absolute frequency. (in this example it will be the sales values that were observed for most days)

The modal interval is [3.1-3.5]

Now using the following formula you can calculate the Mode:

[tex]Md= Li + c[\frac{(f_{max}-f_{prev})}{(f_{max}-f_{prev})(f_{max}-f_{post})} ][/tex]

Li= Lower limit of the modal interval.

c= amplitude of modal interval.

fmax: absolute frequency of modal interval.

fprev: absolute frequency of the previous interval to the modal interval.

fpost: absolute frequency of the posterior interval to the modal interval.

[tex]Md= 3,100 + 400[\frac{(56-40)}{(56-40)+(56-55)} ]= 3,476.47[/tex]

A. $3,129.41 B. $2,629.41 C. $3,079.41 D. $3,123.53

Of all options the closest one to the estimated mode is A.

14. The approximate median daily sales is …

To calculate the median you have to identify its position first:

For even samples: PosMe= n/2= 250/2= 125

Now, by looking at the cumulative absolute frequencies of the intervals you identify which one contains the observation 125.

F(1)= 18

F(2)= 18+27= 45

F(3)= 45 + 31= 76

F(4)= 76 + 40= 116

F(5)= 116 + 56= 172 ⇒ The 125th observation is in the fifth interval [3.1-3.5]

[tex]Me= Li + c[\frac{PosMe-F_{i-1}}{f_i} ][/tex]

Li: Lower limit of the median interval.

c: Amplitude of the interval

PosMe: position of the median

F(i-1)= accumulated absolute frequency until the previous interval

fi= simple absolute frequency of the median interval.

[tex]Me= 3,100+400[\frac{125-116}{56} ]= 3164.29[/tex]

A. $3,130.36 B. $2,680.36 C. $3,180.36 D. $2,664

Of all options the closest one to the estimated mode is C.

Find the third-degree polynomial function that has zeros −2 and −15i, and a value of 1,170 when x=3.

Answers

Answer:

The third degree polynomial function = x³ + 27x² + 200x + 300

Step-by-step explanation:

The third-degree polynomial function has zeros −2 and −15.

From the above, we have been given two factors of the polynomial function. Let's derive the factors from the two zeros of the polynomial given.

The two given zeros of the polynomial can be written as:

x= -2

x+2 = 0

(x+2) is a factor of the polynomial

x= -15

x+15 = 0

(x+15) is a factor of the polynomial

So we have two factors of the polynomial (x+2) and (x+15). But since it is a third degree polynomial, we have to find the third factor.

Let (x-b) be the third factor and f(x) represent the third degree polynomial

f(x) = (x-b) (x+2) (x+15)

Expanding (x+2) (x+15) = x² + 2x + 15x + 30

(x+2) (x+15) = x² + 17x + 30

f(x) = (x-b) (x² + 17x + 30)

From the given information, a value of 1,170 is obtained when x=3

f(3) = 1170

Insert 3 for x in f(x)

f(3) = (3-b) (3² + 17(3) + 30)

1170 = (3-b) (9 + 51 + 30)

1170 = (3-b) (90)

1170/90 = 3-b

3-b = 13

b = 3-13 = -10

Insert value of b in f(x)

f(x) = [x-(-10)] (x² + 17x + 30)

f(x) = (x+10) (x² + 17x + 30)

f(x) = x³ + 17x² + 30x + 10x² + 170x + 200x + 300

f(x) = x³ + 27x² + 200x + 300

The third degree polynomial function = x³ + 27x² + 200x + 300

A state end-of-grade exam in American History is a multiple-choice test that has 50 questions with 4 answer choices for each question. A student must get at least 25 correct to pass the test, and the questions are very difficult. Question 1. If a student guesses on every question, what is the probability the student will pass

Answers

Answer:

0.004% probability the student will pass

Step-by-step explanation:

I am going to use the normal approximation to the binomial to solve this question.

Binomial probability distribution

Probability of exactly x sucesses on n repeated trials, with p probability.

Can be approximated to a normal distribution, using the expected value and the standard deviation.

The expected value of the binomial distribution is:

[tex]E(X) = np[/tex]

The standard deviation of the binomial distribution is:

[tex]\sqrt{V(X)} = \sqrt{np(1-p)}[/tex]

Normal probability distribution

Problems of normally distributed samples can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the zscore of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the pvalue, we get the probability that the value of the measure is greater than X.

When we are approximating a binomial distribution to a normal one, we have that [tex]\mu = E(X)[/tex], [tex]\sigma = \sqrt{V(X)}[/tex].

In this problem, we have that:

[tex]n = 50, p = \frac{1}{4} = 0.25[/tex]

So

[tex]\mu = E(X) = np = 50*0.25 = 12.5[/tex]

[tex]\sigma = \sqrt{V(X)} = \sqrt{np(1-p)} = \sqrt{50*0.25*0.75} = 3.06[/tex]

If a student guesses on every question, what is the probability the student will pass

Using continuity correction, this is [tex]P(X \geq 25 - 0.5) = P(X \geq 24.5)[/tex], which is 1 subtracted by the pvalue of Z when X = 24.5. So

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]Z = \frac{24.5 - 12.5}{3.06}[/tex]

[tex]Z = 3.92[/tex]

[tex]Z = 3.92[/tex] has a pvalue of 0.99996

1 - 0.99996 = 0.00004

0.004% probability the student will pass

What is the length of AC

Answers

Answer:

  5.8

Step-by-step explanation:

The angle bisector makes the triangle sides on either side of it proportional.

  AC/CD = AB/BD

  AC = CD·AB/BD

  AC = 2(8.1/2.8) = 8.1/1.4 ≈ 5.7857 . . . . substitute shown values, evaluate

  AC ≈ 5.8

Please answer this correctly

Answers

Answer:

A = 1/2 b*h

A = 24

b = 8

h = ?

24 = 1/2 * 8 * h

24 = 4h

h = 6

The height is 6 cm.

Hope this helps.

The most common form of color blindness is an inability to distinguish red from green. However, this particular form of color blindness is much more common in men than in women (this is because the genes corresponding to the red and green receptors are located on the X-chromosome). Approximately 79% of American men and 0.4% of American women are red-green color-blind.1 Let CBM and CBW denote the events that a man or a woman is color-blind, respectively.
(a) If an Americal male is selected at random, what is the probability that he is red-green color-blind? P(CBM) =
(b) If an American female is selected at random, what is the probability that she is NOT red-green color-blind? P (not CBW) =
(c) If one man and one woman are selected at random, what is the probability that neither are red-green color-blind? P=(neither is color-blind) =
(d) If one man and one woman are selected at random, what is the probability that at least one of them is red-green color-blind? P=(at least one is color-blind)

Answers

Answer:

(a) P(CBM) = 0.07

(b) P(not CBW) = 0.996

(c ) P(neither is color-blind) = 0.926

(d) P=(at least one is color-blind) = 0.074

Step-by-step explanation:

The correct data is  that Approximately 7% of American men and 0.4% of American women are red-green color-blind.

(a) Probability that he is red-green color-blind:

[tex]P(CBM) = 0.07[/tex]

(b) Probability that she is NOT red-green color-blind:

[tex]P(not\ CBW) =1- P(CBW)\\P(not\ CBW) = 1 -0.004\\P(not\ CBW) =0.996[/tex]

(c) Probability that neither are red-green color-blind

[tex]P(neither) = P(not\ CBW)*P(not\ CBM) \\P(neither) = 0.996 *(1-0.07)\\P(neither)=0.926[/tex]

(d) Probability that at least one of them is red-green color-blind

[tex]P(at\ least\ one) = 1- P(neither) \\P(at\ least\ one) = 1-0.926\\P(at\ least\ one) = 0.074[/tex]

In the circle below, CD is a diameter. If AE=10, CE=4, and AB=16, what is
the length of the radius of the circle?
Please Help ASAP

Answers

Answer:

(D)9.5 Units

Step-by-step explanation:

We have two chords CD and AB intersecting at E.

Using the theorem of intersecting chords

AE X EB =CE X ED

AE=10CE=4AB=16

AB=AE+EB

16=10+EB

EB=16-10=6

Therefore:

AE X EB =CE X ED

10 X 6 = 4 X ED

ED =60/4 =15

Therefore:

CD=CE+ED

=4+15

CD=19

Recall that CD is a diameter of the circle and;

Radius =Diameter/2

Therefore, radius of the circle =19/2 =9.5 Units

what is the radius of the circle that has an area of [tex]81*x*pi[/tex] degrees

Answers

Answer:

R=9

Step-by-step explanation:

the formula for area of a circle is pi r squared

where r denotes the radius of the circle

equating the formula for area with the area of the circle provided

p\i r squared = 81 p\i

r squared = 81

r = radical 81

r =9 inches

find an angle x where sin x = cos x (I know this has been answered but I rlly don't get it..)​

Answers

Answer:

45 degrees

Step-by-step explanation:

sin x=cos(90-x)

sin(45)=cos(90-45)=cos(45)

Answer:

The answer is 45.

sin45=cos45= 1/√2.

hope it helps u ...

find the quotient of 25.5÷0.5​

Answers

Answer:

[tex]51[/tex]

Step-by-step explanation:

[tex]\frac{25.5}{0.5}[/tex]

[tex]\frac{255}{5}[/tex]

[tex]=51[/tex]

find the area enclosed by the curve y^2=x^2-x^4

Answers

Answer: 4/3

Step-by-step explanation:

As you know this graph is a lemniscate

[tex]4\int\limits^1_0 {x\sqrt{1-x^{2} } \, dx =\frac{4}{3} =1.33$[/tex]

If 9: x= x-4, then x=
0 36
18
0 24
6

Answers

Answer:

2±√13

Step-by-step explanation:

9/x=x-4

x² -4x - 9=0

x² -4x +4- 13=0

(x -2)²=13

x-2= ±√13

x= 2±√13

Please help. I keep getting this problem wrong . I need help please . I’ll mark you as brainliest if correct . Only answer if you know. Thank you

Answers

Answer:

The real number 'a' = 32

The real number 'b' = 0

Step-by-step explanation:

Product of a number of a number and its conjugate = a + bi

The number is = -4 + 4i

Conjugate of this number is = -4 - 4i

Product of the number and it's conjugate

= (-4 + 4i)(-4 - 4i)

= -4(-4 - 4i) + 4i(-4 - 4i) [By distributive property]

= 16 + 16i - 16i - 16i²

= 16 - 16(-1)

= 16 + 16

= 32

a + bi = 32 + (0)i

By comparing both the sides,

a = 32

b = 0

Alguien me puede ayudar con esto por favor!!!!

Answers

Answer:

8 + 15i

Step-by-step explanation:

(-2 + 3i) + 2(5 + 6i) =

= -2 + 3i + 10 + 12i

= 8 + 15i

What is the MEDIAN of this data?

Answers

Answer:

I think the median is 7

if it is not im so sorry

The median of the data is 7.

please see the attached picture for full solution

Hope it helps

Good luck on your assignment

one car takes half a minute to complete a circuit.
the other car takes 1 minute and 10 seconds to complete a circuit.
if they start side by side, how long will it be before they are next side by side on the start line? state the units in your answer!
please help me I just need the answer

Answers

Answer:

7 laps

Step-by-step explanation:

someone plz help asap plz

Answers

Answer:

a) 6

b) 10

Step-by-step explanation:

a) The area of a rhombus is half the product of the diagonals, meaning that the area of the shaded part is 4*3/2=6 square meters.

b) To find the area of the white background, you need to find the area of the full rectangle, and then to find the area of both rhombii. The area of the black rhombus is 2*4/2=4 square meters. The area of the full rectangle is 4*5=20 units. Subtracting the areas of the two rhombii, you get an area for the white background of 20-6-4=10 square meters. Hope this helps!

-23d + 81 <-98d + 1
Solve for d

Answers

Step-by-step explanation:

-23d + 81 < - 98d + 1

81 - 1 < - 98d + 23d

80 < - 75d

80/ - 75 < d

10/ - 3 < d

Find the sample space for picking a number from 1 to 3 and choosing red or white

Answers

Answer:

The event of picking a number from 1 to 3 consists of:

Pick number 1

Pick number 2

Pick number 3

The event of choosing red or white card consists of:

Choose a red card

Choose a white card

=> The sample space for picking a number from 1 to 3 and choosing red or white card:

Pick number 1 and choose a red card

Pick number 1 and choose a white card

Pick number 2 and choose a red card

Pick number 2 and choose a white card

Pick number 3 and choose a red card

Pick number 3 and choose a white card

Hope this helps!

:)

find the slope of the line through points 8,2 and -1,-4

Answers

Answer:

2/3

Step-by-step explanation:

We can find the slope by using the slope formula

m= (y2-y1)/(x2-x1)

  = (-4-2)/(-1-8)

  = -6/ -9

  = 2/3

Other Questions
Which is a method that can help people manage weight in a healthy manner? Run two miles every day.Drink water instead of soda.Sleep eight hours every night.Spend time outdoors when possible. i need help pls, asap pls !! Which of the following reasons can be used to justify statement #4 in the proof?A SASB the transitive property C the reflexive property D CPCTC Correctly identify the first step in solving the system of equations by using the elimination method given the following equations:5x+y=510x+3y=20 What types of art are there in the world? Read the excerpt below from the play Antigone by Sophocles and answer the question that follows.CHORUS:O ray of sunlight,most beautiful that ever shoneTo which of the five senses does the imagery in this passage appeal?tastesoundtouchsight 1. Which statement describes the particles of an ideal gas, based on thekinetic molecular theory?*O There are attractive forces between the particles.O The particles move in circular paths.O The collisions between the particles reduce the total energy of the gas.The volume of the gas particles is negligible compared with the total volume of thegas. Which is a resource? There can be more than one answer by the way.I NEED THIS ASAP! WILL MARK THE BRAINLEST! (Easy to answer to!)Subsistence farming, Ranching, Commercial farming, Oil, Mining, Manufacturing A company's beginning Work in Process inventory consisted of 21,500 units that were 20% complete with respect to direct labor. These beginning units were completed and another 92,400 units were started during the current period. Of those started, 61,500 were finished and the remaining 30,900 were 40% complete at the end of the period. Using the weighted-average method, the equivalent units of production with regard to direct labor were: what is a geometric pattern What has coronavirus done to teens life (like they cant see theyre friends in stuff) write a paragraph Which value gives the number of particles in 1 mol of a substance?6.02 x 10216.02 x 10226.02 x 10236.02 x 1024 Faith borrowed $2250 for home repairs. She paid back 24 payments of $132 each. How much did she pay in interest on the loan?Explained answer please! The vertex of this parabola is at (-2,-3). When the x-value is -1, the y-value is -5. What is the coefficient of the squared expression in the parabolas equation? A. 8 B. -8 C. -2 D. 2 Kayak Co. budgeted the following cash receipts (excluding cash receipts from loans received) and cash disbursements (excluding cash disbursements for loan principal and interest payments) for the first three months of next year. Cash ReceiptsCash DisbursementsJanuary $525,000 $475,000 February 400,000 350,000 March 450,000 525,000 According to a credit agreement with the companys bank, Kayak promises to have a minimum cash balance of $30,000 at each month-end. In return, the bank has agreed that the company can borrow up to $150,000 at an annual interest rate of 12%, paid on the last day of each month. The interest is computed. based on the beginning balance of the loan for the month. The company repays loan principal with available cash on the last day of each month. The company has a cash balance of $30,000 and a loan balance of $60,000 at January 1. Prepare monthly cash budgets for each of the first three months of next year Can you guys plsssss help me with the questions plsss my assigment is already due plss help me guys!!!!! first law of equilibrium In TLC chromatography of plant pigments, why do different pigments travel up the plate at different rates The ancient Chinese made their instruments from many materials. Which ofthe materials listed below were used to construct ancient Chineseinstruments?O A. Satin and reedsO B. Silk and bambooD C. Bronze and stoneO D. Clay and bone If the outer conductor of a coaxial cable has radius 2.6 mm , what should be the radius of the inner conductor so that the inductance per unit length does not exceed 50 nH per meter? Express your answer using two significant figures.