What types of energy do lamps give off?
Include how was your day in you answer.
Explain why/if the lamp gives off heat energy.

Answers

Answer 1

Answer:

When a lamp is turned on, it gives off light energy and heat energy.

My day was fantastic.

Explanation:

The lamp gives off heat energy because anything that gives off light energy gives off heat energy.


Related Questions

anyone wanna do my chem test for 500 points? my insta is niqsariot_1 hmu if your interested and for everyone else FREE 100 POINTS

Answers

Answer:

I would be if I do it your no learning anything but I would but I don't have insta yet

Explanation:

sorry

Answer:

k

Explanation:

The hydrolysis of adenosine triphosphate (ATP) is represented by the equation below. This reaction is critically important in cellular biology, but the reaction itself proceeds at a very slow rate. Based on the information given, which of the following best explains why an enzyme (biological catalyst) is required for the reaction to occur at a faster rate?

ATP+ H2O ADP+ Pi
ΔG= -30.5Kj/mol

a. Because ΔG < 0, the hydrolysis of ATP is not thermodynamically favorable. In cells, ΔS is increased by increasing the amount of H2O consumed, resulting in ΔG >0 and an increase in the reaction rate.
b. Because ΔG < 0, the hydrolysis of ATP is not thermodynamically favorable. In cells, enzymes act as catalysts that decrease ΔH for the reaction, resulting in ΔG >0 and an increase in the reaction rate.
c. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a small activation energy.
d. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a large activation energy.

Answers

Answer:

d. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a large activation energy.

Explanation:

Hello!

In this case, since negative Gibbs free energies of reaction stand for thermodynamically favored processes, we can immediately rule out choices a. and b.

Moreover, since the reaction is slow without the presence of a catalyst, which the context of biochemistry is an enzyme, we infer that correct choice is d. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a large activation energy because the higher the activation energy the slower the reaction according to the Arrhenius equation.

Best regards!

PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP

DUE IN 5 MINUTES CHEMISTRY DIMENSIONAL ANALYSIS

In 2009, Usain Bolt ran 100 meters in 9.58 seconds. What is this speed in km/hr? (!! DIMENSIONAL ANALYSIS!! NOT A REGULAR PROBLEM)

Answers

100 m = 0.1 km
9.58 sec = 9.58/3600 = 0.00266 hr
Speed = 0.1/0.00266= 37.6 km/hr
Can you mark it brainliest?

Order the sequence of steps that occur when you add heat to a chemical reaction. Place these steps in a logical order keeping in mind how adding temperature affects the rate of reaction.

The reaction rate of the experiment is recorded and found to have occurred at a faster rate than it did without the addition of heat.

Temperature increases due to the higher ketic energy of particles.

Two chemicals are mixed together and slowly some bubbles appeanr

Heat is added to the experiment with a Bunsen burner.

More collisions of particles occurs due to the increased kinetic energy.​

Answers

Answer:

C,A,B,D

Explanation:

That's the correct order, hope this helps

The PH of a solution of Hcl is 2.find out the amount of acid present in a litre of the solution ​

Answers

Answer:

The solution is 10^-2 or 0.01M in HCl.

Explanation:

meaning of pH is "power of hydrogen".

what is the molar concentration of a HCl solution with pH=2?

Let say pH=2

[H+]=10^-2M

HCL is a strong acid that dissociates completely:

[H+]=[HCL]

Therefore solution is 10^-2 or 0.01M in HCL.

If someone is building a scale model of our solar system which characteristic would be the most difficult to build into the model?
1#The relative sizes of the objects
2#The colors of the objects
3#The distances between objects
4#The composition of the objects

Answers

Answer:

The composition of the objects because not all the planets have been explored

Help please !!!!!!! 10 points for this

Answers

i think it’s increase, then decrease- sorry if i’m wrong

2NH3+2O2- N2o+3H2O

If 80.0 grams of O2 are reacted in the above reaction,how many grams of N2O will be produced?

Answers

Answer:

55.025g of N2O

Explanation:

2 NH3 + 2 O2 → N2O + 3 H2O

moles of O2 = 80.0/32 = 2.5 moles O2

moles of N2O = 2.5 moles O2 * 1 mole N2O

= 1.25 moles N2O

moles = mass/Molar mass

mass = moles * Molar mass = 1.25 x 44.02 = 55.025 g

can you help me with my science

Answers

1-4
2-2
3-3
4-1
Hope you are m right

A normal adult jawbone contains 200 mg of Carbon-14 in a living person. If scientists found a jawbone that only had 50mg of Carbon-14, how old is the bone? (The half-life of C-14 is 5730 years).

Answers

Carbon-14 is a radioisotope of carbon that decays following first-order kinetics. There are four values of interest in this problem: the "normal" (or original) amount of carbon-14 for a jawbone ([tex]\mathrm{N_0}[/tex]), the actual amount of carbon-14 in a jawbone ([tex]\mathrm{N}[/tex]), the half-life of carbon-14 ([tex]\mathrm{t_{1/2}}[/tex]), and the actual time elapsed ([tex]\mathrm{t}[/tex]) from the original time. There is an equation that ties all these values in together,

[tex]N= N_0 e^{-kt}[/tex]

where k is the rate constant, which, for first-order decay, is related to the half-life by

[tex]k = \dfrac{\ln 2}{ t_{1/2} }.[/tex]

What you want to find here is the time elapsed (t). So, you can substitute the latter equation for k into the k in the former equation to get

[tex]N= N_0 e^{\frac{-\ln 2 \;t}{t_{1/2}}.[/tex]

Rearranging to solve for t, the equation becomes

[tex]t = \left(\dfrac{\ln \dfrac{N_0}{N}}{\ln 2} \right) t_{1/2}.[/tex]

You are given all three of the values necessary to solve for t: The normal amount of carbon-14 is 200 mg; the actual amount of carbon-14 in the sample is 50 mg; and the half-life of carbon-14 is 5730 years. Plugging them into the above equation, we get

[tex]t = \left(\dfrac{\ln \dfrac{200 \text{ mg}}{50 \text{ mg}}}{\ln 2} \right) \left(5730 \text{ years} \right) = 11460 \text{ years}.[/tex]

So the jawbone found is 11460 years old (or 11000 if accounting for sig figs).

what is used to create motion

Answers

Answer:

These forces make objects change their motion or movement , the act of going from one place to another.

Explanation:

Put these elements in order of decreasing electronegativity, with the highest electronegative element as number 1.
a. tin (Sn, Group 14, Period 5)
b. rubidium (Rb, Group 1, Period 5)
c. bromine (Br, Group 17, Period 4)
d. lithium (Li, Group 1, Period 2)
e. cadmium (Cd, Group 12, Period 5)

Answers

Answer:the answer is a c and e

Explanation:

Which statement describes the movement of the medium by a transverse wave?


A. at an obtuse angle to the wave

B. parallel to the wave

C. at a right angle to the wave

D. at an acute angle to the wave

Answers

Answer:

A

Explanation:

But I'm not sure just my instinct

The statement that described the movement of the medium via the transverse wave should be that it should be parallel to the wave.

What is a transverse wave?

It is the waves in which the motion considered all the points that should be on the wave oscillate along the paths at the right angles with respect to the wave of the direction. An example of this kind of wave should be electromagnetic, etc. Here, the movement should be parallel to the wave.

Hence, the correct option is b.

Learn more about transverse wave here: https://brainly.com/question/21890036

515282 quarts into milliliters. I

Answers

Answer:

487638640,7819

dndndnndndbxbdbdbdbdb

A combustion reaction involves the reaction of a substance with oxygen gas. The complete combustion of any hydrocarbon (binary compound of carbon and hydrogen) produces carbon dioxide and water as the only products. Heptane is a hydrocarbon that is found in gasoline. Complete combustion of heptane produces 7 liters of carbon dioxide for every 8 liters of water vapor (both measured at the same temperature and pressure). What is the ratio of carbon atoms to hydrogen atoms in a molecule of heptane

Answers

Answer:

7/16

Explanation:

The general formula for the combustion of alkanes is;

CnH2n+2 + 3n+1/2 O2  -------> nCO2 + (n+1)H2O

So, we have;

CnHn + nO2 ------> 7CO2 + 8H2O

So there are 7 carbon atoms and 16 hydrogen atoms in heptane according to the law of conservation of mass.

Therefore, heptane is; C7H16

The ratio of carbon to hydrogen is now; 7/16

A balloon full of air has a volume of 1.00L at a temperature of 23 °C. What is the balloon's volume at 33°C?
Answer:1.03L
How do I solve this?

Answers

Answer:

V2= 1.03L

Explanation:

Start off with what you are given.

V^1: 1.00L

T^1: 23°C

V^2?

T^2: 33°C

If you know your gas laws, you have to utilise a certain gas law called Charles' Law:

V^1/T^1 = V^2/T^2

Remember to convert Celsius values to Kelvin whenever you are dealing with gas problems. This can be done by adding 273 to whatever value in Celsius you have.

(23+273 = 296)     (33+273 = 306)

Multiply crisscross

1.00/296= V^2/306

296V^2 = 306

Dividing both sides by 296 to isolate V2, we get

306/296 = 1.0337837837837837837837837837838

V2= 1.03L


When a substance breaks up into two simpler substances, the reaction
is an)
reaction.

Answers

Answer:

Decomposition.

Explanation:

Decomposition Reactions T hose reactions in which a single substance (reactant) splits up into two or more simpler substances (products) are known as decomposition reactions. These reactions are carried out by supplying energy in form of heat, electricity or light which breaks that substance into simpler substances

Decide whether a chemical reaction happens in either of the following situations. If a reaction does happen, write the chemical equation for it. Be sure your chemical equation is balanced and has physical state symbols. situation chemical reaction.

A strip of solid magnesium metal is put into a beaker of 0.042M SnCl3 solution.

Answers

Answer: [tex]3Mg(s)+2SnCl_3(aq)\rightarrow 3MgCl_2(aq)+2Sn(s)[/tex]

Explanation:

Single replacement reaction is a chemical reaction in which more reactive element displaces the less reactive element from its salt solution.

A more reactive element is one which can easily lose or gain electrons as compared to the other element.

As Magnesium is more reactive than tin, it can easily displace tin from its salt solution [tex](SnCl_3)[/tex] and form magnesium chloride and tin in elemental form.

The balanced chemical equation is:

[tex]3Mg(s)+2SnCl_3(aq)\rightarrow 3MgCl_2(aq)+2Sn(s)[/tex]

Gold is yellow, shiny, smooth, and is found in the ground. A geologist finds a material that she thinks may be gold. Which of the following tests would reveal that
the material is not gold and not an element?

A. Its density is different from that of gold.
B. Its melting point is different from that of gold.
C. The material is composed of two different substances.
D. Its boiling point differs from that of gold.

Answers

I think the answer is D

plzzzzzzz help asap its just one question plzzzzz its in the file <3

Answers

Answer:

There are 6 atoms of oxygen in 2Ca(NO3)2

A 1,900-m3 water tower has been cleaned with a chlorine solution. The vapors of chlorine in the tower exceed allowable concentrations for the work crew to enter and finish repairs. If the chlorine concentration is 15 mg/m3 and the allowable concentration is 0.0015 mg/L, how long must the workers vent the tank with clean air flowing at 2.35 m3/s

Answers

Answer:

t = 1862 s

Explanation:

To do this, we need first to determine the theorical detention time, which can be determined with the following expression:

t₀ = ∀/Q  (1)

Where:

t₀: detention time

∀: Volume of the fluid in the reactor

Q: Flow rate in the reactor

With this time, we must use the following expression to determine the time that the workers will take to vent the tank:

C = C₀ e^(-t/t₀)   (2)

From here, we must solve for time t, and the expression will be:

t = ln(C₀/C) * t₀   (3)

Now that we know the expression to use, let's solve for t. Using (1) to determine the detention time, ∀ is 1900 m³, and Q is 2.35 m³/s so:

t₀ = 1900 / 2.35 = 808.51 s

Now, let's solve for the time t. C will be 0.0015 mg/L (or 1.5 mg/m³ cause in 1 m³ we have 1000 L) and C₀ 15 mg/m³:

t = ln(15/1.5) * 808.51

t = 1861.66 s or simply 1862 s

Hope this helps

(feso4.(Nh4) So4. 6H2o) +Kmno4+H2So4_Fe2(So4)3+K2So4+mnSo4+(Nh4)2So4+H2o​

Answers

Answer:

balancing the equation?

Please help I’m so confused on this it’s stoichiometry

Answers

Answer:

48.27g Na

Explanation:

To start we need to balance the equation. The trick is to make sure both sides have equal amounts of each atom:

2Na + Cl2 --> 2NaCl

Now we can use sociometry

We have 75 g of Cl2, and for every 1 mole of Cl2, there are 70.9 grams:

[tex]75g Cl2 * \frac{1mole Cl2}{70.9g Cl2}= 1.05 mole Cl2[/tex]

Now we have moles of Cl2. To get to grams of Na, we need to first use mole to mole ratio:

[tex]1.05mole Cl2 *\frac{2 mole Na}{1 mole Cl2} =2.1 mole Na[/tex]

 From here we convert moles of Na into grams of Na

[tex]2.1mol Na*\frac{22.99g Na}{1 mole Na} = 48.27g Na[/tex]

It's usually easier to just make one singular equation with all of these smaller equations.

[tex]75gNa*\frac{1molCl2}{70.9gCl2} *\frac{2mol Na}{1 mol Cl2} *\frac{22.99g Na}{1 mol Na}=48.27 gNa[/tex]

The trick to sociometry is making sure your units cancel out until you only have the unit you want. If there are moles of Na in the numerator, there needs to be moles of Na in the denominator. If there are grams of Cl2 in the numerator, there needs to be grams of Cl2 in the denominator and so one and so on

State the postulate of Bohr theory

Answers

Answer:

Bohr's model of the hydrogen atom is based on three postulates:

1) An electron moves around the nucleus in a circular orbit,

2) An electron's angular momentum in the orbit is quantised,

3) The change in an electron's energy as it makes a quantum jump from one orbit to another is always accompanied by the emission or absorption of a photon. Bohr's model is semi-classical because it combines the classical concept of electron orbit (postulate 1) with the new concept of quantisation ( postulates 2 and ).

How many moles in 6.57 x 10^24 formula units of NaCl?
0.092 moles
10.91 moles
3.96 X 10^49 moles
145 moles​

Answers

Answer:

3.955*10^48

Explanation:

1 mole of a substance gives 6.02*10^23/6.57*10^24 will give x then cross multiply the answer. is 3.955*10^48

What is the molecular formula for a compound that is 44.87% potassium, 36.7%
oxygen, 18.0% sulfur and a molecular mass of 696g.

Answers

Answer:

Molecular formula: S4K8O16  empirical formula: SK2O4

Explanation:

First we find the moles of each by first finding grams (using the percent) and then using stoichiometry to convert into moles:

Sulfur: 696 *.18 = 125.28grams S* [tex]\frac{1 mole S}{32.065 g S} = 3.907 moles S[/tex]

Potassium: 696 *.4487 = 312.2952 *[tex]\frac{1 mole K}{39.08 g K}[/tex]= 7.99117 mole K

Oxygen: 696 * .367 = 255.432 * [tex]\frac{1 mol O}{16g O}[/tex] = 15.9654 mole O

Then we divide each value by the atom with the smallest number of moles to find the mole ratio:

3.907/3.907= 1

7.99117 mole K/ 3.907= 2.043

15.9654 mole O/ 3.907= 4.08

The empirical formula is SK2O4

To find the molecular formula, we divide the mass given (696) by the mass of the empirical formula (174.22) to get 4. We then divide each atom by 4.

Molecular formula: S4K8O16


PLEASE HELP!!
15POINTS!!! And brainliest

Answers

Answer: a. 3.36 L

b. 33.2 g

Explanation:

According to avogadro's law, 1 mole of every substance occupies 22.4 L at STP and contains avogadro's number [tex]6.023\times 10^{23}[/tex] of particles.

Standard condition of temperature (STP)  is 273 K and atmospheric pressure is 1 atm respectively.

To calculate the number of moles, we use the equation:

[tex]\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}[/tex]

[tex]\text{Number of moles of} Fe_2O_3=\frac{16.0g}{159.69g/mol}=0.1mole[/tex]

[tex]3O_2(g)+4Fe(s)\rightarrow 2Fe_2O_3(s)[/tex]

a. 2 moles of [tex]Fe_2O_3[/tex] are produced by = [tex]3\times 22.4L=67.2L[/tex] of [tex]O_2[/tex]

Thus 0.1 moles of  [tex]Fe_2O_3[tex] are produced by =[tex]\frac{67.2}{2}\times 0.1=3.36L[/tex] of [tex]O_2[/tex]

b. [tex]3\times 22.4L=67.2L[/tex] of [tex]O_2[/tex] react with = [tex]4\times 55.8=223.2g[/tex] of iron

Thus 10.0 L of [tex]O_2[/tex] react with = [tex]\frac{223.2}{67.2}\times 10=33.2g[/tex] of iron

How many grams of sodium (Na) are in 6.2 mol of Na?

Answers

mass = mol no. x molar mass
         = 6.2 x 23
         = 142.6 g

An element X has a triiodide with the empirical formula XI3 and a trichloride with the empirical formula XCl3. The triiodide is converted to the trichloride according to the equation XI3 Cl2XCl3 I2 If the complete conversion of 1.196 g of XI3 results in the formation of 0.436 g of XCl3, what is the atomic mass of the element X

Answers

Answer:

51.03g/mol is the molar mass of X

Explanation:

Based on the reaction:

2XI₃ + 3Cl₂X → 2XCl₃ + 3I₂

Where 2 moles of XI₃ reacts to produce 2 moles of XCl₃ -The ratio of reaction is 1:1-

To solve this question we must find the mass of X per mole (This is the atomic mass of X).

As the moles of both compounds are the same:

1.196g / 0.436g = Molar mass XI₃ / molar mass XCl₃ (1)

Also:

Molar mass XI₃ = Molar mass X + 380.71g/mol

Molar mass XCl₃ = Molar mass X + 106.36g/mol

Replacing in (1):

2.7431 = (Molar mass X + 380.71g/mol) / (Molar mass X + 106.36g/mol)

2.7431 Molar mass X + 291.76g/mol = Molar mass X + 380.71g/mol

1.7431 Molar mass X = 88.95g/mol

Molar mass X = 51.03g/mol

51.03g/mol is the molar mass of X

Need help fast help help help. Help

Answers

Answer:

fjnjfzgnf

Explanation:

Answer:

it blank !

Explanation:

Other Questions
Which scientific activities will Juno conduct on its trip to Jupiter? Check all that apply.a. measuring the amount of water in Jupiters atmosphereb. landing on the planet surface to collect rock samplesc. taking images of the planet using infrared camerasd. taking chemical fingerprints of Jupiters gasese. mapping Jupiters gravitational and magnetic fieldf. transporting astronauts to the planet 1) Which of the following are considered POLYNOMIALS according to the rules of polynomials? Check all that apply Which of the following BEST characterizes a strict constructionist view of congressional power? On Monday ,bo saw 1/5 of birds listed in his guidebook. on Tuesday he saw 3/5 more of birds. what fraction of the birds in the guidebook did bo see in those two days ? "Folsom Prison Blues" by Johnny Cash"answer all down there pls----->>>> ( what line shows an example of metaphor,simile,imagery, and allusion, of "Folsom Prison Blues" by Johnny Cash and what is the song's central theme? ) Biologically important tautomers involve Biologically important tautomers involve blankfor thymine and guanine and blank for cytosine and adenine.a. Trueb. False (5x-8)+(2x+19)Find the value of x.OA.5B.7C.9D.11 SOMEONE HELP ME WITH THIS PROBLEM BRAINLIESET! 5 STARS & A THANKS!! PLS HELPHow did Mesoamerica civilizations use astronomy--the study of stars and planets, in their everyday lives?A. They used their beliefs about astronomy to predict the future.B. They developed calendars based on the movement of stars and planets.C. They used astronomy to determine and control the seasons of the year.D. They used the movement of stars and planets to track animal herds.In what way were Mesoamerican civilizations like the ancient Romans of Western Europe?A. They created governments based on city-states instead of one centralized government.B. They gradually built a government based on representative democracy.C. The Aztec and Maya placed famous warriors as the heads of state in their governments.D. The government of each Mesoamerica region was controlled by a dynasty, or ruling family. Which student correctly wrote the algebraic expression for the following statement?the quotient of a number and sevenAdrians workquotient represents divisionStartFraction 7 over n EndFractionHaileys workquotient represents divisionStartFraction n Over 7 EndFractionCamilas workquotient represents multiplication7 nJuans workquotient represents subtraction7 minus n pls say A, B, C , or D thanks and pls hurry What did Hitler secretly do after becoming Chancellor in 1933? javier walks from his home at point k to the internet cafe at point 0. if the school at point w is exactly halfway between javier's house and the internet cafe, how far does javier walk? Another name for a cube isA. dodecahedronB. hexahedronC. icosahedronD. tetrahedronplease help Does society has a responsibility to keep everyone safe from violence, regardless of whois causing the violence to happen? The civil rights movement contributed toA. suburbanizing the country's African American populationB. increasing African American graduation ratesC. weakening the Democratic Party in the SouthD. ending de facto segregatiion In U.S., children usually have to go to school when they areO three years oldfour years oldfive years oldsix years oldOOther: PLEASEEEEEEEEEEEEEEEEEEEEEEEEE HELP MEEEEEEEEEEEEEEEEEEEEEEEE1. Pia drew a circle with a circumference of C and a diameter of 14 in. Pia knows that , and she wrote the following equation to represent the value of .(a) There is an error in Pias equation. Write an equation to correctly represent the value of . Show your work.(b) Write an equation and find the circumference of the circle. Answer: The graph shows the number of each size T-shirt a store currently has in stock. Which statements are true?Choose exactly two answers that are correct.Question 3 options:The ratio of large to small T-shirts is about 4 to 1.There are more than 35 small and extra small T-shirts.There are about twice as many large T-shirts as small T-shirts.There are fewer than 100 T-shirts in all. What is the equation of this line? ILL MARK BRAINLISTA ~ y = -x + 2 b~ y = 2x -2C ~ cannot be determined D~ y = 2x + 2 how do the names of different Textiles tell us about their histories