PLEASE HELP ME WITH THIS I DONT KNOW WHERE TO START
1. Calculate the temperature if 5 moles of a gas is compressed into a volume of 50L at a Pressure of 2000 mmHg. R= 0.08206 L•atm/ mole•K and (0°C+273)=K

A solution with a pH of 9.7 contains the hydronium ion. [tex]1x10^-9.7[/tex]M, which is equivalent to approximately [tex]2.01x10^-10 M.[/tex]

You must be aware of the hydronium ion concentration expressed in moles per litre (molarity) in order to calculate the pH of an aqueous solution. The pH is then calculated using the equation pH = - log [H3O+].

At the far end, there are no more than 1M hydrogen ions, which leads to a pH of no more than 0. The pH value is limited to 14, whereas the other end contains no more than 1M of hydroxide ions.

Question:

[tex]The [H3O+] of a solution with pH = 9.7 is 9.7 M O 1x 109.7M O2 x 10-10 M O 5 x 10-5M 09.7 x 10-1 M The [H3O+] of a solution with pH = 9.7 is 09.7 M O 1x 109.7 M 2 x 10-10 M. 0 5x 10-5m 09.7 10-1 M.[/tex]

To know more about Hydronium ion visit:-

https://brainly.com/question/14619642

#SPJ1

The volume of O₂ produced when 8.52 g of Na₂O₂ is added to excess water is approximately 1.17 liters at STP.

When it comes to the ideal gas law, the underlying assumption is that the gas is in a state of thermodynamic equilibrium. This means that its molecules are not interacting with each other except through perfectly elastic collisions.

Equation:

We can use stoichiometry to determine the volume of oxygen gas produced from the reaction of 8.52 g of Na₂O₂.

First, we need to convert the mass of Na₂O₂ to moles using its molar mass:

8.52 g Na₂O₂ × (1 mol Na₂O₂ / 77.98 g Na₂O₂) = 0.1093 mol Na₂O₂

According to the balanced chemical equation, 1 mole of Na₂O₂ produces 1/2 mole of O₂:

2 Na₂O₂ + 2 H₂O → 4 NaOH + O₂

1 mol Na₂O₂ produces 1/2 mol O₂

So, the number of moles of O₂ produced is:

0.1093 mol Na₂O₂ × (1/2 mol O₂ / 1 mol Na₂O₂) = 0.05465 mol O₂

Finally, we can use the ideal gas law to determine the volume of O₂ produced at standard temperature and pressure (STP), which is defined as 0°C (273 K) and 1 atmosphere (1 atm) of pressure:

PV = nRT

At STP, the pressure and temperature are known, so we can rearrange the equation to solve for V:

V = nRT / P

Plugging the values, we get:

V = (0.05465 mol) × (0.08206 L atm mol⁻¹ K⁻¹) × (273 K) / (1 atm)

V ≈ 1.17 L

To know more about ideal gas law, click here

https://brainly.com/question/28257995

#SPJ1

Answer: A terrestrial phenomenon commonly referred to as lunar eclipse transpires during an astronomical event wherein the Earth traverses its orbit between the Sun and the Moon, resulting in an obstruction and projection of its shade onto the lunar surface. During a lunar eclipse, the moon may exhibit a crimson tint owing to the Earth's atmosphere refracting sunlight towards the moon. This phenomenon is commonly referred to as a "blood moon" in academic discourse. The acquisition of photographic images of lunar eclipses necessitates the utilization of a camera and a tripod. However, it is imperative to exercise care with respect to exposure duration and ISO settings to facilitate the capture of the subdued illumination emitted by the eclipsed moon. An upcoming celestial phenomenon, which is anticipated to be observable from Earth, is the occurrence of a lunar eclipse on May 16, 2022.

Explanation:

The four types of physical weathering are:

1.) Frost action or freeze-thaw weathering

2.) Exfoliation or unloading

3.) Thermal expansion and contraction

4.) Abrasion

These types of weathering are similar in that they all involve physical processes that break down rocks and other geological materials without the involvement of chemical reactions.

Frost action occurs when water seeps into cracks in rocks and freezes, causing the water to expand and exert pressure on the surrounding rock. This process repeats over time and can cause the rock to fracture and break apart.

Exfoliation occurs when rocks that were once buried deep beneath the earth's surface are exposed to lower pressures as overlying rocks erode away. As the pressure decreases, the rocks expand and crack, causing outer layers of rock to peel away like layers of an onion.

Thermal expansion and contraction occurs when rocks are repeatedly subjected to heating and cooling cycles. This can cause the rock to expand and contract, leading to the development of cracks and fractures.

Abrasion occurs when rocks and other geological materials are subjected to repeated rubbing or grinding by other materials, such as wind-blown sand, water, or other rocks. This process can cause rocks to wear down and break apart over time.

In summary, these four types of physical weathering are similar in that they all involve physical processes that break down rocks and other geological materials, but each type operates under different conditions and results in different forms of weathering.

Answer:

below

Explanation:

The four types of physical weathering are:

1. Freeze-thaw weathering

2. Exfoliation

3. Abrasion

4. Thermal expansion and contraction

These types of physical weathering are similar in that they all involve the breakdown of rocks and other geological features due to physical forces rather than chemical reactions. In each case, the physical stress causes the rock to crack or break apart. Additionally, they all can occur in various types of climates and environmental conditions.

The same components always present the same ratios in a compound. Water always has two hydrogen atoms for oxygen, and carbon dioxide always contains two oxygen atoms for every one of carbon.

Considering that each of them is composed of two similar atoms, elements include hydrogen, oxygen, and nitrogen. Water is not an element since it only contains two hydrogen atoms and one oxygen atom.

Pure substances include both elements and compounds. Substances made up of many atom types are known as compounds. The simplest compounds are called elements because they only contain one kind of atom.

to know more about elements here;

brainly.com/question/13025901

#SPJ1

Answer:

Explanation:

The equilibrium constant expression for the given reaction is:

K = ([C6H5COO-][C6H5NH3+])/([C6H5COOH][C6H5NH2])

We can use the acid dissociation constant (Ka) for benzoic acid and the base dissociation constant (Kb) for aniline to solve for the equilibrium constant (K) of the reaction.

Ka = [C6H5COO-][H3O+]/[C6H5COOH]

[H3O+] = Ka*[C6H5COOH]/[C6H5COO-]

Kb = [C6H5NH3+][OH-]/[C6H5NH2]

[OH-] = Kb*[C6H5NH2]/[C6H5NH3+]

Substituting [H3O+] and [OH-] into the equilibrium constant expression and simplifying, we get:

K = (Ka*Kb)/([H3O+][OH-])

K = (6.3×10^(-5))(4.3×10^(-10))/((KaC6H5NH2)(KbC6H5COOH))

K = (6.3×10^(-5))*(4.3×10^(-10))/(1.00×10^(-14))

K = 2.73×10^(-2)

Therefore, the equilibrium constant for the given reaction is 2.73×10^(-2).

20.0 moles of oxygen react with Antimony to form 13.3 moles of Antimony (III) Oxide. We want to calculate how many moles of Antimony (III) Oxide will be formed from 20.0 moles of oxygen. This is a stoichiometry problem.

The link between the proportional amounts of components participating in a reaction or generating a compound is known as stoichiometry, and it is often expressed as a ratio of whole integers.

Assuming a balanced chemical equation, the stoichiometric ratio between Antimony (III) Oxide  and oxygen can be used to determine the number of moles of Antimony (III) Oxide  formed.

For example, the balanced equation for the reaction of Antimony with O2 to form Antimony (III) Oxide  is:

4 Antimony + 3 O2 → 2 Antimony (III) Oxide

From this equation, it can be seen that 3 moles of oxygen react with 2 moles of Antimony (III) Oxide . Therefore, if there are 20.0 moles of O2, then the number of moles of Antimony (III) Oxide  formed would be:

20.0 moles oxygen × (2 moles Antimony (III) Oxide  / 3 moles oxygen) = 13.3 moles Antimony (III) Oxide.

To know more about moles visit:-

https://brainly.com/question/26416088

#SPJ1

The vapor pressure of methanol at 40°C is 0.234 atm.

Only two types of alcohol are methanol and ethanol. Ethanol, sometimes referred to as ethyl alcohol, has a chemical composition of two carbon atoms. Methanol, sometimes referred to as methyl alcohol, is made up of just one carbon atom.

ln(P2/P1) = (ΔHvap/R) x (1/T1 - 1/T2)

ΔGvap = -RTln(Pvap/P) = ΔHvap - TΔSvap

ΔGvap = -RTln(Pvap/P) = -166.6 kJ/mol

ΔSvap = S(g) - S(l) = 239.9 J/mol-K - 126.8 J/mol-K = 113.1 J/mol-K

ΔHvap = ΔGvap + TΔSvap = -166.6 kJ/mol + (298.15 K)(113.1 J/mol-K) = -134.6 kJ/mol

Now we can use the Clausius-Clapeyron equation to find the vapor pressure of methanol at -30°C and 40°C.

At -30°C, we have:

T1 = 25°C + 273.15 = 298.15 K

T2 = -30°C + 273.15 = 243.15 K

ΔHvap = -134.6 kJ/mol

R = 8.314 J/mol-K

ln(P2/5 atm) = (-134.6 kJ/mol / 8.314 J/mol-K) x (1/298.15 K - 1/243.15 K)

P2 = 0.0038 atm

Therefore, the vapor pressure of methanol at -30°C is 0.0038 atm.

At 40°C, we have:

T1 = 25°C + 273.15 = 298.15 K

T2 = 40°C + 273.15 = 313.15 K

ΔHvap = -134.6 kJ/mol

R = 8.314 J/mol-K

ln(P2/5 atm) = (-134.6 kJ/mol / 8.314 J/mol-K) x (1/298.15 K - 1/313.15 K)

P2 = 0.234 atm

To know more about vapor pressure visit:-

https://brainly.com/question/11864750

#SPJ1

The solution of KCl in water will undergo precipitation of KCl crystals as the temperature decreases from 50 °C to 20 °C and then to 34 °C due to the decreasing solubility of KCl in water.

What happens to a solution of KCl in water when cooled from 50 °C to 20 °C and then to 34 °C?

When the solution of KCl in water is cooled from 50 °C to 20 °C, the solubility of KCl in water decreases. As a result, some of the KCl will start to come out of the solution and form solid crystals.

Then, when the temperature of the solution is further decreased from 20 °C to 34 °C, the solubility of KCl in water decreases even further, causing more KCl to come out of the solution and form solid crystals. This is known as precipitation.

The amount of KCl that will come out of the solution depends on the solubility of KCl at the respective temperatures. The solubility of KCl in water is about 34 g/100 mL at 20 °C and about 42 g/100 mL at 34 °C. Therefore, when the solution is cooled from 50 °C to 20 °C, some KCl will come out of solution until the concentration in solution reaches about 34 g/100 mL. Further cooling to 34 °C will cause more KCl to come out of solution until the concentration in solution reaches about 42 g/100 mL.

The exact amount of KCl that will come out of solution can be calculated using thermodynamic models and experimental data on the solubility of KCl in water at different temperatures.

To learn more about precipitation, visit: https://brainly.com/question/14160641

#SPJ1

The subshell with quantum numbers n=2 and l=2 is the 2D subshell.

The set of numbers used to describe the position and energy of the electron in an atom are called quantum numbers.

There are four known quantum numbers, and they include:

The  principal quantum number (n) indicates the energy level or shell of an electron, while the azimuthal quantum number (l) indicates the shape of the electron cloud or subshell.

Learn more about quantum number at: https://brainly.com/question/2292596

#SPJ1

Filtration is the process of passing a liquid containing contaminants through a filter to get a cleaner liquid.

After filtration impurities are left on the filter when the liquid goes through it, resulting in a cleaner combination. The procedure of separating one ingredient from another in a compound is used in the purification of chemical compounds or any materials. A mixed sample is turned into fresh samples, each of which contains a single ingredient.Separation procedures are then utilised to separate these compounds. These techniques alter the relative proportions of components in a combination.The type of the compounds and the impurities in them influence the purification of organic chemicals and compounds.

Purification of compounds can be done in other methods as well such as distillation, chromatography, sublimation and crystallisation.

Learn more about filtration here:

https://brainly.com/question/31504556

#SPJ1

Full question:

What can you conclude after learning about filtration of solutions of organic compounds? Name other methods of purification of compounds.

The value of (approximate) z-score for an area of 0.1500 to the left of the z-score in a standard normal distribution is approximately -1.04.

If the area to the left of a z-score is 0.15 this means that 15% of the area under the standard normal distribution curve is to the left of the z-score. To find the approximate z-score, we can use a table of standard normal probabilities or a calculator that has a normal distribution function.

Using a standard normal distribution table, we can look up the closest probability to 0.15 in the table, which is 0.1492. The corresponding z-score is approximately -1.04.

This is how you arrive at the approximate z-score for an area of 0.1500 to the left of the z-score in a standard normal distribution which is approximately -1.04.

Learn more about standard normal distribution here:

https://brainly.com/question/29509087

#SPJ1

The temperature of the ideal gas sample is approximately 358.4 degrees Celsius

The ideal gas law is expressed as:

PV = nRT

Where P is pressure, V is volume, n is the amount of substance, T is temperature and R is the ideal gas constant ( 0.08206 Latm/molK )

Given that:

Amount of gas n = 3.24 mol

Pressure P = 2.19 atm

Volume of the gas V = 76.67 L

Temperature T = ?

To determine the temperature, substitute the values into the equation above.

PV = nRT

T = PV / nR

T = ( 2.19 atm × 76.67 L ) / ( 3.24 mol × 0.08206 Latm/molK )

T = 167.9073 / 0.2658744

T = 631.5286 K

Convert to degrees Celsius

T = ( 631.529 − 273.15 ) °C

T = 358.4°C

Therefore, the temperature is 358.4 degrees Celsius.

Learn more about Ideal Gas Law here: brainly.com/question/4147359

#SPJ1

James Ensor's Christ's Entry into Brussels (1889) was painted as a sarcastic response to Rodin's "Burghers of Calais." Therefore, the correct answer is Rodin's "Burghers of Calais."

"Burghers of Calais" is a sculpture by Auguste Rodin that depicts six burghers of Calais, a city in France, who offered their lives to save their fellow citizens during the Hundred Years' War.

The sculpture is a representation of heroism, sacrifice, and patriotism. James Ensor, however, was critical of this type of heroic representation and sought to challenge it through his own art.

In "Christ's Entry into Brussels," Ensor depicts a grotesque and chaotic scene of Christ's triumphant entry into the city. The painting is a satirical commentary on the hypocrisy of organized religion and the political corruption in Brussels at the time. It can be seen as a direct response to the heroism and idealism of Rodin's "Burghers of Calais."

For more question on Brussels click on

https://brainly.com/question/17325795

#SPJ11

Answer:  the new volume of the gas is twice the initial volume when the pressure is reduced to half at constant temperature.

Explanation:

Sodium bicarbonate is the limiting reactant and just 0.65 moles of CO₂ can be produced.

Limiting reactant is the reactant that gets consumed completely in a chemical reaction, thereby limiting the amount of product that can be formed.

Acetic acid and sodium bicarbonate react, and the balanced chemical equation for this reaction is:

CH₃COOH + NaHCO₃ -> CH₃COONa + CO₂ + H₂O

Calculating the quantity of product that can be created from each reactant and comparing them to discover which one generates the least will help us identify the limiting reactant. The reactant that produces less product is the limiting reactant.

The provided amounts of each reactant must first be converted to moles:

0.80 moles of acetic acid

0.65 moles of sodium bicarbonate

Then, we may determine how much CO₂ can be created from each reactant using stoichiometry. The balanced equation reveals that 1 mole of acetic acid and 1 mole of sodium bicarbonate combine to create 1 mole of carbon dioxide.

Using acetic acid:

0.80 moles CH₃COOH x (1 mole CO₂ / 1 mole CH₃COOH) = 0.80 moles CO₂

About sodium bicarbonate:

0.65 moles NaHCO₃ x (1 mole CO₂ / 1 mole NaHCO₃) = 0.65 moles CO₂

As 0.65 moles of CO₂ are fewer than 0.80 moles of CO₂, sodium bicarbonate is the limiting reactant. Just 0.65 moles of CO₂ can be produced as a result.

Dimensional analysis:

0.80 moles CH₃COOH x (1 mole CO₂ / 1 mole CH₃COOH) x (44.01 g CO₂ / 1 mole CO₂) = 35.21 g CO₂

0.65 moles NaHCO₃ x (1 mole CO₂ / 1 mole NaHCO₃) x (44.01 g CO₂ / 1 mole CO₂) = 28.61 g CO₂

Learn more about moles here:

https://brainly.com/question/20486415

#SPJ1

[tex]16H_{1}[/tex]+ + [tex]2Cr_{2O_{72} }[/tex]- + [tex]3C_{2H_{60} }[/tex] →4 [tex]Cr_{3}[/tex]+ + 3 [tex]CO_{2}[/tex] + 11 [tex]H_{2} O[/tex] is balanced equation. 3 is the coefficient in front of carbon dioxide in the balanced chemical equation

Define an equation with a balanced formula.

A balanced chemical equation, in which the masses of the reactants and products are equal, contains the same amount of atoms of each element on both sides of the equation.

Varied elements' atom counts in the reactants and products of unbalanced chemical equations are varied. Because the coefficients become the powers of the concentrations of the products and reactants, a balanced equation is crucial when utilizing a constant. The constant is wrong if the equation is unbalanced.

To learn more about balanced chemical equation use:

brainly.com/question/11904811

#SPJ1

We can see here that matching the label to the correct description, we will have to have a complete part of the description and have a full understanding of what ball-and-stick model is all about.

A specific kind of molecular model called the ball-and-stick model uses balls to represent atoms and sticks to represent the connections connecting them to depict the three-dimensional structure of molecules.

It is a physical model that enables researchers to see the configuration of atoms within a molecule and comprehend their interrelationships.

Learn more about ball-and-stick model on https://brainly.com/question/10416015

#SPJ1

Answer:

The average would be found by:

(22.59 + 27.43 + 35.642) ÷ 3 = 28.554

Rounded to 4 significant figures:

28.55

The new volume of the helium gas is 0.39 L.

The new volume of the helium gas is calculated by applying the following formula as shown below:

n₁V₁ = n₂V₂

where;

the final number of moles is calculated as;

n₂ = 0.51 g/4 g/mol

n₂ = 0.1275 mol

The final volume of the gas;

V₂ =(n₁V₁)/n₂

V₂ = (0.1 x 0.5 L )/ (0.1275)

V₂ = 0.39 L

Learn more about final volume of gas here: https://brainly.com/question/25736513

#SPJ1

The answers to the given questions are; 58 Joules = 13.86 Calories, 230 Calories = 962.32 Joules, 230 Calories = 0.96 kJ, and 3.2 kJ = 0.7648 kCal.

(i) We know that, 4.184 Joules = 1 Calorie

                     ==> 1 Joule = 1 / 4.184 Calories

     Therefore, 58 Joules = [ (1 / 4.184) * 58 ] Calories

                                         = 13.86 Calories (Approx.)

(ii) We know, 1 Calorie = 4.184 Joules

   Then,  230 Calories = 4.184 * 230 Joules

                                     = 962.32 Joules

(iii) We know, 230 Calories = 962.32 kJ(from previous question)

                 and, 1000Joules = 1 kJ

                           ==> 1 Joule = (1 / 1000) kJ

Therefore, 230 Calories i.e., 962.32 Joules = [ (1 / 1000) * 962.32 ] kJ

                                                                        = 0.96kJ (Approx.)

(iii) We know, 4.184 Joules = 1 Calorie

                ==> 1 Joule = (1 / 4.184) Calorie

                ==> 1000Joules i.e, 1 kJ = (1 / 4.184) * 1000 Calories

                Therefore, 3.2 kJ = [ { ( 1 / 4.184 ) * 1000 } * 3.2 ] Calories

                                              = 764.82 Calories(Approx.)

             Since, 1000 Calories = 1 kCal

                      764.81 Calories = [(1 / 1000) * 764.82 ] kCal

                             i.e., 3.2 kJ  = 0.7648 KCal (Approx.)

To learn more about another unit of energy:

https://brainly.com/question/26066425

The entire spectrum of electromagnetic radiation emitted by celestial bodies, helps astronomers gain complete understanding of stars and planets.

The electromagnetic spectrum encompasses a vast array of electromagnetic radiation, spanning from the elongated wavelength of radio waves to the compact wavelength of gamma rays. This includes an assortment of radiation types, including radio waves, microwaves, infrared radiation, visible light, ultraviolet radiation, X-rays and gamma rays. With each variation possessing a unique wavelength and frequency, they all traverse at the speed of light.

Astronomers rely heavily on the electromagnetic spectrum to study celestial bodies like stars and planets. This spectrum enables them to detect and measure various forms of electromagnetic radiation emitted by these objects. The range of frequencies in this radiation spans from radio waves with longer wavelengths to gamma rays with shorter ones.

Different types of electromagnetic radiation provide distinct information about celestial objects, including their temperature, composition, and movement. For instance, visible light allows astronomers to observe the color and brightness of stars and planets, while radio waves can identify magnetic fields or map out gas and dust distribution in galaxies. This knowledge helps answer fundamental questions about the universe's nature such as how galaxies and stars form, evolve over time, and what causes the universe's expansion.

To know more about electromagnetic spectrum, click here

https://brainly.com/question/23727978

#SPJ1

As a result, the ideal gas law is applied, and the pressure of the gas in the container is 1.44 atm.

The Kelvin temperature and hence the volume are going to be in direct proportion when the pressure on a sample of a dry gas is held constant, according to the definition of the Charles Law Formula. PV = k is the law's equation, and k might be a constant.

This issue can be resolved by applying the ideal gas law:

PV = nR

T = -52 °C + 273.15 = 221.15 K

n = 0.642 mol

V = 8.6 L

T = 221.15 K

[tex]R = 0.0821 L·atm/mol·K (gas constant for ideal gases)[/tex]

PV = nRT

P = nRT/V

P = (0.642 mol)(0.0821 L·atm/mol·K)(221.15 K)/(8.6 L)

P = 1.44 atm

To know more about ideal gas visit:-

https://brainly.com/question/28257995

#SPJ1

The new pressure inside the balloon will be 1.91 atm after the gas is compressed to a volume of 4.6 L.

The scientist Robert Boyle discovered this empirical relationship in 1662, which asserts that under constant temperature, the pressure (p) of a given quantity of gas changes inversely with its volume (v). As a result, the equation pv = k, a constant, is produced.

P1 x V1 = P2 x V2

where the starting pressure and volume are P1 and V1, and the ultimate pressure and volume are P2 and V2.

Plugging in the given values, we get:

1.35 atm x 6.5 L = P2 x 4.6 L

Solving for P2, we get:

P2 = (1.35 atm x 6.5 L) / 4.6 L

P2 = 1.91 atm

To know more about volume visit:-

https://brainly.com/question/13986930

#SPJ1

5.82 x 10⁶ atoms of H₂O can produce 72800 L of NaOH.

An exothermic mist from the commencement of high temperatures and heat from the breakdown of incompatible combinations can emerge from the reaction of NaOH with H₂O₂, which creates a powerful oxidant known as Na₂O₂ and poses a serious thermal danger.

5.82 x 10⁶ atoms / 3 atoms per mole = 1.94 x 10⁶ moles of H₂O

1.94 x 10⁶ moles of H₂O x (4 moles of NaOH / 2 moles of H₂O) = 3.88 x 10⁶ moles of NaOH

To convert moles of NaOH to liters, we need to use the density of NaOH and its molar mass. The molar mass of NaOH is:

23 g/mol (for Na) + 16 g/mol (for O) + 1 g/mol (for H) = 40 g/mol

The density of NaOH is 2.13 g/mL. Using these values, we can calculate the volume of NaOH produced:

3.88 x 10⁶ moles of NaOH x 40 g/mol = 1.55 x 10⁸ g of NaOH

1.55 x 10⁸ g / 2.13 g/mL = 7.28 x 10⁷ mL

7.28 x 10⁷ mL / 1000 mL/L = 72800 L

To know more about atoms visit:-

https://brainly.com/question/30898688

#SPJ1

The total pressure in the container will become 4.02 atm when 0.240 mol of a third gas is added.

In accordance with Dalton's law of partial pressures:

P_total = P_A + P_B = 0.352 atm + 0.715 atm = 1.067 atm

When 0.240 mol of a third gas is further introduced, the overall number of moles of gas in the vessel jumps to:

n_total = n_A + n_B + n_3 = (P_A * V)/(R * T) + (P_B * V)/(R * T) + n_3

for no change in volume

n_total = (P_total * V)/(R * T) + n_3

P_total = (n_total - n_3) * (R * T)/V

Substituting the given value:

P_total = (0.352 + 0.715 + 0.240) * (0.0821 * (25 + 273.15))/7.95

P_total = 1.307 x 3.079

P_total =  4.024 atm

Learn more about partial pressures at

https://brainly.com/question/19813237

#SPJ1

Answer:Pb2O3

Explanation:

lead (III) has a +3 charge

Oxygen has a -2 charge

You need 2 Pb to balance with the 3

The percent composition of iron, carbon, and nitrogen in Prussian Blue is approximately 56.27%, 15.38%, and 28.35%, respectively. The exact percentage of hydrogen depends on the value of x in the formula.

When evaluating a chemical complex, knowing the percentage composition of a certain element inside it may be helpful. The formula for percent composition is 100 times the product of the element's mass and its molecular mass.

It is free of sulphur and phosphorus and contains 48% iron. Siderite-smithsonite, siderite-magnesite, and siderite-rhodochrosite are solid solutions formed when zinc, magnesium, and manganese are substituted for iron.

To know more about Prussian Blue visit:-

https://brainly.com/question/26728476

#SPJ1