Answer:
6.65dm³
Explanation:
Equation of reaction,
4C3H5(NO3)3(s) → 12CO2(g) + 10H2O(g) + 6N2(g) + O2(g)
From the equation of reaction, 4 moles of Nitroglycerin gave 29 moles of various gases.
Molar mass of nitroglycerin C₃H₅(NO₃)₃ = 908g
Since all the product of the reaction are in gaseous phase, let's assume that law of conservation of matter is held hence there's no loss in mass.
908g of C₃H₅(NO₃)₃ = 908g of products
2.70×10²g of C₃H₅(NO₃)₃ = 2.70×10²g of products
Number of moles = mass / molar mass
Molar mass of C₃H₅(NO₃)₃ = 908g/mol
Number of moles = 2.70×10² / 908
Number of moles = 0.297 moles
But 1 mole = 22.4dm³
0.297mole = x dm³
x = (0.297 × 22.4) / 1
x = 6.65dm³
The volume of gas that'll be produced when 2.70×10²g of C₃H₅(NO₃)₃ would be 6.65dm³
3.01 × 1023 molecules H2O
Answer:
0.5 mole
Explanation:
The question isn't even clear
But I'm guessing you want to ask the number of moles
n= Number of molecules/ Avogadros number
n= 1/2
A laser is used in eye surgery to weld a detached retina back into place. The wavelength of the laser beam is 503 nm, while the power is 1.4 W. During surgery, the laser beam is turned on for 0.070 s. During this time, how many photons are emitted by the laser?
Answer:
Number of proton emmitted by laser=[tex]2.48*10^17proton[/tex]
Explanation:
Energy is the ability to cause change; power is directly proportional to energy and its the rate energy is utilized.
Power=energy/time.
First we need to calculate the total energy used which is equal to the total power utilized.
E(total)= P( total) = 1.4W × 0.070 s =[tex]0.098J[/tex]
CHECK THE ATTACHMENT FOR THE REMAINING DETAILED CALCULATION
A chemistry student is given of a clear aqueous solution at . He is told an unknown amount of a certain compound is dissolved in the solution. The student allows the solution to cool to . At that point, the student sees that a precipitate has formed. He pours off the remaining liquid solution, throws away the precipitates, and evaporates the water from the remaining liquid solution under vacuum. More precipitate forms. The student washes, dries and weighs the additional precipitate. It weighs 50,0 g.
Using only the information above, can you calculate the solubility of X in water at 16. C. If you said yes, calculate it.
Answer:
Solubility cannot be calculated.
Explanation:
To calculate the solubility of X it is necessary to know the value of the mass of the solute (X) that can be dissolved in 100 g of water.
[tex]Solubility = \frac{Solute mass}{100 grams of water}[/tex]
Taking into account that we do not know the value of the mass of the solution, therefore the value of the solubility of the compound cannot be determined.
.Draw the born-Haber lattice energy cycle for sodium chloride. Explain the concept of resonance using the nitrate ion structure.
Answer:
Born-Haber cycle is consist on four to five steps. 1: ionization energy 2: electron affinity 3: dissociation energy 4: sublimation energy and last is Hess law.Nitrate ion have 3 localized sigma bonds and 1 delocalized pie bond according to the resonance structure.Explanation:
Step 1: NaCl(s) → Na(s) + 1/2 Cl2(g) ΔHf (ionization energy) in this step energy is required to change the phase of the compound
Step 2: Na(s) + 1/2 Cl2(g) → Na(g) + 1/2 Cl2(g) ΔHa (elements needed to be in gaseous state for born-haber cycle so metal changes from solid to gas state by changing the enthalpy.
Step 3: Na(g) + 1/2 Cl2(g) → Na(g) + Cl (g) 1/2ΔHd
Step 4: Na(g) + Cl(g) → Na⁺(g) + Cl⁻(g) IE+EA ( in this step both ionization energy and electron affinity was involved because in metal (Na) electron is added which needs the energy and this energy draw from the step 3 and Chlorine require releasing electron to be in ionic state so when electron leaves the orbit energy releases.
Step 5: final step is Hess Law which is the combination of all the steps which step 4 again go back to step 5 and this cycle continues by repeating same steps Na⁺(g) + Cl⁻(g)→NaCl(s)
at this step heat of formation is calculated
Heat of formation= atomization energy+ dissociation energy+ sum of ionization energies + sum of electron affinity + lattice energy.
2: if we look at the electron configuration of the nitrogen it has 5 electrons in its outermost shell which indicates it can make 5 bonds 4 bonds and 1 lone pair usually and Oxygen has 6 electrons in its outermost shell. So nitrate ion have the total number of 24 electrons including the 1 electron which shows on the compound.
So when they make nitrate ion NO₃⁻¹ it shows that nitrate has 3 resonance structures. Nitrogen's three sigma bonds are attached to oxygen and fourth one make 1 pie bond which can rotate, delocalized and change its position anytime from one Oxygen atom to other oxygen atom.
In the compound Fe2O3, iron's oxidation number is +3, and oxygen's oxidation
number is
Answer here
Answer: The oxygen's oxidation number is -2.
Explanation:
For formation of a neutral ionic compound, the charges on cation and anion must be balanced. The cation is formed by loss of electrons by metals and anions are formed by gain of electrons by non metals.
In [tex]Fe_2O_3[/tex], Fe is having an oxidation state of +3 called as cation and oxygen is an anion with oxidation state of -2. Thus they combine and their oxidation states are exchanged and written in simplest whole number ratios to give neutral [tex]Fe_2O_3[/tex]
The cations and anions being oppositely charged attract each other through strong coloumbic forces and form an ionic bond.
What is the balanced form of the chemical equation shown below?
Na2SO4(aq) + Sr(NO3)2(aq) → SrSO4(s) + NaNO3(aq)
A. Na2SO4(aq) + Sr(NO3)2(aq)
SISO4(s) + NaNO3(aq)
B. NaSO4(aq) + SINO3(aq) → SSO4(s) + NaNO3(aq)
C. Na2SO4(aq) → SrSO4(s) + 2NaNO3(aq)
Ο Ο
D. Na2SO4(aq) + 2Sr(NO3)2(aq) → 2SSO4(s) + 2NaNO3(aq)
Answer:
C. Na₂SO₄(aq) + Sr(NO₃)₂(aq) → SrSO₄(s) + 2 NaNO₃(aq)
Explanation:
Based on the equation:
Na₂SO₄(aq) + Sr(NO₃)₂(aq) → SrSO₄(s) + NaNO₃(aq)
As you can see, sulfate ions (SO₄) are been replaced for nitrate ions (NO₃). That is a double replacement reaction and is a very important information because 2 NO₃ ions in Sr(NO₃)₂ are producing 1 NO₃ ion. To balance NO₃:
Na₂SO₄(aq) + Sr(NO₃)₂(aq) → SrSO₄(s) + 2 NaNO₃(aq)
1 SO₄ ion in Na₂SO₄ produce 1 SO₄ ion in SrSO₄. And Na and Sr metals are balanced yet. Thus, the balanced form of this chemical equation is:
Na₂SO₄(aq) + Sr(NO₃)₂(aq) → SrSO₄(s) + 2 NaNO₃(aq)what is the correct ionic equation, including all coefficients, charges, and phases for the following sets of reactants? Assume that the contribution of protons from H2SO4 is near 100%.
Ba(OH)2(aq)+H2SO4(aq) —>
help, I have no clue
Answer:
Ba(OH)2(aq)+H2SO4(aq) gives us 2BaH+H2O
Explanation:
A student states that the graduated cylinder contains 150 mL of water his statement is
A. A prediction
B. An observation
C. A theory
D. A hypothesis
The correct answer is B. An observation
Explanation:
An observation is defined as a statement or conclusion you made after observing or measuring a phenomenon, this includes statements based on precise instruments. For example, if you conclude a plant grows 2 inches every month by measuring the plant during this time, this is classified as an observation. The conclusion of the student is also an observation because he concludes this after analyzing the volume of the water in the cylinder through the lines in the graduated cylinder, considering the water is just in the middle of 100 mL and 200 mL which indicates there are 150 mL of water.
Answer:
B. An observation
Explanation:
Hello,
Given the illustration, such statements is considered as an observation, since it came up from something the student realized with his/her own eyes, as in the volumetric cylinder the level of the liquid reached 150 mL of water. Predictions are not observed but assumed, theories are stated when experimentation is already deeply studied and hypothesis are assumptions before experimenting.
Regards.
What is the oxidation number of nitrogen in N20?
00
O+1
O +2
O +4
Predict the order of elution if you were to attempt to separate using column chromatography on silica gel and with a gradient eluent system starting with petroleum ether and slowly increasing MTBE % over time.
Answer:
Follows this order: B=> A => C.
Explanation:
NB: kindly check the attachment for the diagram of compounds A, B and C.
Elution is a very important concept in chromatography separation techniques. It deals with the use of eluent in the removal of an adsobate from an adsorbent. The principle behind Elution is just about how polar the solvent is.
So, in this question Compound B will go with the Elution first because of its polarity. Compound B has lesser polarity as compared to Compounds A and B.
Compound A will then elutes second because of its polarity too as resonance increases its polarity.
Last, compound C elutes because it has the highest polarity which is caused by electronegative atoms.
Indicate whether each of the following indicates that a physical or chemical change has taken place when a piece of magnesium metal is studied: (a) Can be cut into tiny pieces (b) Fizzling occurs when placed water (c) Light is emitted when burned (d) Turns to ash
Answer:
a) Can be cut into tiny pieces - Physical Change
b) Fizzling occurs when placed water -Chemical Change
c) Light is emitted when burned -Chemical Change
d) Turns to ash -Chemical Change
Explanation:
A semipermeable sac containing 4% NaCl, 9% glucose, and 10% albumin is suspended in a solution with the following composition: 10% NaCl, 10% glucose, and 40% albumin. Assume that the sac is permeable to all substances except albumin. State whether each of the following will (a) move into the sac, (b) move out of the sac, or (c) not move.
glucose: a. moves into sac
water: b. moves out of sac
albumin: c; does not move
NaCl: a; moves into sac
Answer:
Glucose: (a) moves into sac
Water: (b) moves out of sac
Albumin: (c) does not move
NaCl: (a) moves into sac
Explanation:
A semi-permeable membrane is a membrane that allow certain molecules or ions to pass through by diffusion.
Diffusion is the movement of molecules from a region of higher concentration to a region of lower concentration until equilibrium is attained. A special form of diffusion known as osmosis transports water molecules across a semi-permeable membrane.
Osmosis is the movement of water molecules from a region lower solute concentration (high water molecules concentration) to a region of higher solute concentration (low water molecules concentration) until equilibrium is attained.
From the above definitions and the given data;
Glucose concentration is higher in solution outside the sac, thus, glucose molecules will move into the sac.
Water molecules are higher in the sac as a result of the lower concentration of solutes, therefore, water molecules will move out of the sac into the solution outside.
Since the sac is impermeable to albumin, it does not move.
NaCl concentration is lower in the sac, therefore, it will move ro the solution outside into the sac.
Glucose will move into the sac, water will move out of the sac, albumin will neither move in nor out, and NaCl will move into the sac.
The molecules of each of the substances will move by diffusion from the region of higher concentration to the region of lower concentration of each substance as long as there is a permeable membrane. Water, on the other hand, will move by osmosis from the region of high to low water potential through a permeable membrane. Regions with higher concentrations of substances usually have low water potentials and vice versa.Thus, both glucose and NaCl molecules will diffuse from the solution into the sac, and water molecules will move from the sac into the surrounding solution. Since the sac is not permeable to albumin, then the movement in or out is inhibited.
More on osmosis and diffusion can be found here: https://brainly.com/question/19867503?referrer=searchResults
4-Nitrophenol, NO2C6H4OH (pKa 7.15), is only slightly soluble in water, but its sodium salt, NO2C6H4O-Na+, is quite soluble in water. Describe the solubility of 4-nitrophenol in solutions of sodium hydroxide, sodium bicarbonate (NaHCO3), and sodium carbonate (Na2CO3). The pKa values for the conjugate acids of sodium hydroxide, sodium bicarbonate (NaHCO3), and sodium carbonate (Na2CO3) are 15.7, 6.36, and 10.33, respectively. Aqueous NaOH: _________ Aqueous NaHCO3: _________ Aqueous Na2CO3: _________
Answer:
Aqueous NaOH: soluble
Aqueous NaHCO₃: insoluble
Aqueous Na₂CO₃: soluble
Explanation:
The organic acid is insoluble. Its salt (ionic) is soluble.
The important principle is:
If you have two acids in a flask, the stronger acid (smaller pKₐ) will protonate the weaker one. The stronger acid will become ionic and therefore more soluble.
1. In NaOH
Let's write the formula for 4-nitrobenzoic acid as HA.
The equation for the reaction is
HA + OH⁻ ⇌ A⁻ + H₂O
pKₐ: 7.15 15.7
HA is the stronger acid. It will protonate the hydroxide ion and be converted to the soluble 4-nitrobenzoate ion.
4-Nitrophenol is soluble in NaOH.
2. In NaHCO₃
HA + HCO₃⁻ ⇌ A⁻ + H₂CO₃
pKₐ: 7.15 6.36
HCO₃⁻ is the stronger acid. It will protonate 4-nitrophenol.
4-Nitrobenzoic acid is insoluble in NaHCO₃.
3. In Na₂CO₃
HA + CO₃²⁻ ⇌ A⁻ + H₂CO₃
pKₐ: 7.15 10.33
HA is the stronger acid. It will protonate the carbonate ion.
4-Nitrophenol is soluble in Na₂CO₃.
what would happen if you place two positive charges next to each other and let go. would they attract, stay still, or they would repel
Answer:
they would repel
Explanation:
unlike charges attract while like ones repel.
A balanced equation has
Answer:
A balanced equation is an equation for a chemical reaction in which the number of atoms for each element in the reaction and the total charge is the same for both the reactants and the products.In other words, the mass and the charge are balanced on both sides of the reaction.
Explanation:
Explain why both square planar and tetrahedral complexes have coordination number=4, and yet square planar complexes can never be chiral while tetrahedral complexes can.
Answer:
The coordination number is 4.
Explanation:
Square planar clusters can be either cis or trans, as they form 180 and 90-degree bond angles. Therefore, a pair of ions may be adjacent (cis) to one another and immediately across (trans) from one another. A square planar molecule could never be simultaneously cis and trans, so because several coordinators are 4. Since linear complexes have only an angle of a bond of 180 degrees, they can not have cis or trans-isomers. In the coordination complex, there is only yet another way possible of bonding the two binding sites to the steel.ch3-ch2-ch-ch(cl)-ch=o IUPAC name
Answer:
2-chloropentanal
Answer:
2-chloropentanal
Explanation:
ch3-ch2-ch-ch(cl)-ch=o IUPAC name
H H H H
H - C - C - C - C - C = O
H H H Cl
So as can be seen 2 as the Chlorine is on the second carbon.
Chloro because of the chlorine.
Pent because there's 5 carbon
al because there's an aldehydes
Aldehyde = −CHO
2-chloropentanal
Ni
Express your answer in condensed form in the order of orbital filling as a string without blank space between orbitals. For example, [He]2s22p2 should be entered as [He]2s^22p^2.
Answer:
[Ar]3d^84s^2
Explanation:
From the question given, we are asked to write the condensed form of electronic configuration of nickel, Ni.
To do this, we simply write the symbol of the noble gas element before Ni in a squared bracket followed by the remaining electrons to make up the atomic number of Ni.
This is illustrated below:
The atomic number of Ni is 28.
The noble gas before Ni is Argon, Ar.
Therefore, the condensed electronic configuration of Ni is written as:
Ni(28) => [Ar]3d^84s^2
Answer:
[Ar] 4s^23d^8
Explanation:
8) What is the molarity (M) of an aqueous solution containing 22.5 g of sucrose (C12H22011) in 35.5 mL of solution?
A) 3.52 M
B) 1.85 x 10-2M
C) 0.104 M
D) 0.0657 M
E) 1.85 M
Answer:
E) 1.85 M
Explanation:
M(C12H22O11) = 342.3 g/mol
22.5 g * 1mol/342.3 g = 0.0657 mol
35.5 mL = 0.0355 L
Molarity = mol solute/L solution = 0.0657 mol/0.0355L =1.85 mol/L = 1.85 M
The molarity of the aqueous solution is 1.85 M. The correct option is E) 1.85 M
From the question,
We are to determine the molarity (that is, concentration) of the given sucrose solution
First, we will determine the number of moles present in the given mass of sucrose
Mass of sucrose = 22.5 g
Using the formula
[tex]Number\ of\ moles = \frac{Mass}{Molar\ mass}[/tex]
Molar mass of sucrose = 342.2965 g/mol
∴ Number of moles of sucrose present = [tex]\frac{22.5}{342.2965}[/tex]
Number of moles of sucrose present = 0.0657325 moles
Now, for the molarity (concentration) of the sucrose solution
From the formula
Number of moles = Concentration × Volume
Then,
[tex]Concentration = \frac{Number\ of\ moles}{Volume}[/tex]
From the question,
Volume = 35.5 mL = 0.0355 L
∴ [tex]Concentration = \frac{0.0657325}{0.0355}[/tex]
Concentration = 1.85 M
Hence, the molarity of the aqueous solution is 1.85 M. The correct option is E) 1.85 M
Learn more here: https://brainly.com/question/23861180
You add 5.7 g of iron to 25.20ml of water and observe that the volume of the iron and water together is 25.92ml calculate thw density of the iron
Answer:
7.92gml-1
Explanation:
water=25.20ml
water+iron=25.92ml
iron=5.7g
P=mass/volume (formula of density)
mass=5.7g
volume=25.92-25.20
=0.72ml
p=5.7/0.72
=7.92gml-1
Given:
Initial volume of water = 25.20mL
Volume of water after iron is added = 25.92mL
Mass of iron = 5.7g
So, the volume of iron = 25.92mL - 25.20mL = 0.72mL
∴ Density of iron will be
Density = Mass/Volume
Density = 5.7g / 0.72mL
Density = 7.91 g/mL
What is density in short answer?
The density of a substance is the relationship between its mass and how much space it takes up. Density equals the mass of the substance divided by its volume, D = m/v.
What is the SI unit of density?Though SI unit of density is kg/m³ solids, g/ml for liquids and g/L for gases.
Learn more about Density here
https://brainly.com/question/6838128
#SPJ2
What is cell culturing?
a technique that uses specific antibodies to visualize features of cells
a technique that visualizes how specific genes are used within a cell
a technique in which cells are purposefully grown under specific conditions
an imaging technology used to study features smaller than the human eye can see
Answer:
a technique in which cells are purposefully grown under specific conditions
Explanation:
Answer:
its c
Explanation:
correct edge2020
Which of the compounds below are amines?
1. H4C-NH-CH3
2. H3C-NH-C-CH3
H2C-CH3
1 +
H3C-CH2-N-CH3
CH3
N
3. H
4.
Answer:
1. H4C-NH-CH3
2. H3C-NH-C-CH3
H2C-CH3
1 +
H3C-CH2-N-CH3
CH3
N
3. H
4.
.
.
.
.
.
.
tertbutylamine and ammonia. Which is more basic
Answer:
ammonia
Explanation:
Given the equation 2KCIO3(s)=2KCI(s) + 3O2(g). A 3.00-g sample of KCIO3 is decomposed and the oxygen at 24 degrees C and 0.982 atm is collected. What volume of oxygen gas will be collected assuming 100% yield?
Answer:
0.912 L or 912 mL
Explanation:
M(KClO3) = 122.55 g/mol
3.00 g KClO3 * 1 mol/122.55 g = 3.00/122.55 mol =0.02449 mol
2KCIO3(s)=2KCI(s) + 3O2(g)
from reaction 2 mol 3 mol
given 0.02449 mol x
x = 0.02449*3/2 =0.03673 mol O2
T = 24 + 273.15 = 297.15 K
PV = nRT
V= nRT/P = (0.03673 mol*0.082057 L*atm/K*mol*297.15 K)/0.982 atm =
= 0.912 L or 912 mL
Hydrogen bonds can be found between molecules of which substance? NH3 H2 HI CH4
Answer:
All except ch4
Explanation:
NH3 N H 3 and HF can form hydrogen bonds as they have a hydrogen atom bonded to fluorine and nitrogen atoms.
Hydrogen bonds are formed between hydrogen and a highly electronegative atom such as oxygen, halogens etc. Among the given compounds HI form hydrogen bond.
What is hydrogen bond?Hydrogen bond a strong bond type formed between hydrogen and an electronegative atom. Water, hydrogen halides, hydrogen sulphide etc are formed by hydrogen bonds.
Hydrogen is an electropositive atom and will easily lose an electron to a electronegative atom. Thus hydrogen bonds with atoms by sharing electrons each other where, the shared pair of electrons are attractively pulled to the electronegative atom.
Therefore, all the hydrogen bonded compounds are polar in nature. Hydrogen bonds are strong bonds and it can be seen in proteins, DNA, and in other biomolecules.
HI or hydrogen iodide forms hydrogen bond because iodine is comparatively electronegative.
To find more on hydrogen bonds, refer here:
https://brainly.com/question/15099999
#SPJ2
The wolf gets enegry from____
The rabbit gets energy from____
The plant gets energy from___
The mushoom gets energy from___
Answer:
The wolf gets energy from other Animals through Cellular respiration. it's a carnivore
The rabbit gets energy from Carbohydrates,Fats.... obtained through different sources. A common example is the grass. It's an herbivore
The plant gets energy from the sun during photosynthesis. It's Autotrophic.
The mushroom gets energy from the decomposition of other organic matter. It's heterotrophic.
Explanation:
In a food chain; The Wolf eats the rabbit, when the Wolf dies, decomposers such as mushrooms breaks down its body returning it to the soil, where it provides nutrients for plants
1- A volumen constante un gas ejerce una presión de 880 mmHg a 20º Celsius dentro de una olla a presión ¿Qué temperatura habrá si el marcador de presión muestra un valor de 1050 mmHg?
Answer:
In this problem the correct thing would be to use the ideal gas equation.
Explanation:
Well in this exercise we will use the following equation:
(P x V) / T = (p x v) / t
On the right side of the equation we will find the initial values, that is, the values with which the reaction begins and in general they are always the first to write in the problems.
Instead on the left side of the equation, the letters that are in lowercase are the final values, that is to say at the end of the reaction that the values of pressure, temperature and volume are reached.
P is pressing, just like p, T and t are temperature, and V and v are volume.
We use this equation so we consider the behavior of said gas to be an IDEAL gas, a constant volume.
That is why the given pressures require an atmosphere to pass, which is another unit used to press the pressure ... Much needed in this equation! An atmosphere is equivalent to 760 millimeters of mercury ...
Then the final and initial pressures would be:
initial pressure: 1.15 atm
final pressure: 1.38 atm
In this way you already have the values to be able to solve in the equation your unknown that would be the final temperature:
Considering that the volume is constant, we cancel it from the equation, 1.15 atm would be in the value of P and 1.38 in the value of p ... In this way it considers that 20 degrees Celsius is the initial temperature or ses T, we would only have to clear the t.
One of the many remarkable enzymes in the human body is carbonic anhydrase, which catalyzes the interconversion of carbon dioxide and water with bicarbonate ion and protons. If it were not for this enzyme, the body could not rid itself rapidly enough of the CO2 accumulated by cell metabolism. The enzyme catalyzes the dehydration (release to air) of up to 107 CO2 molecules per second. Which components of this description correspond to the terms enzyme, substrate, and turnover number?
Answer:
Enzyme is carbonic anhydrase
Substrate is [tex]CO_2[/tex]
Turnover number is [tex]10^{7}[/tex]
Explanation:
An enzyme is used by a living organism as a catalyst to perform a specific biochemical reaction.
A substrate is a molecule upon which an enzyme acts.
Turnover number refers to the number of substrate molecules transformed by a single enzyme molecule per minute. Here, the enzyme is the rate-limiting factor.
Here,
Enzyme is carbonic anhydrase
Substrate is [tex]CO_2[/tex]
Turnover number is [tex]10^{7}[/tex]
What is the conjugate acid in the following equation hbr + H2O yields h30 positive + BR negative
Answer:
HBr + H2O = H3O+ + Br-
So our conjugate acid is the H3O+ to H2O
Explanation:
A conjugate acid of a base results when the base accepts a proton.
Consider ammonia reacting with water to form an equilibrium with ammonium ions and hydroxide ions:
NH3 (aq) + H2O (l) ⇌ NH4+ (aq) + OH- (aq)
Ammonium, NH4+, acts as a conjugate acid to ammonia, NH3.
Which activities can help conserve water when taking showers
Answer:
If you're ever shaving in the bathroom, turn the water off.
Explanation:
If you do this, you can save at least 3-4 pounds of water.
Answer:
The following activities can help conserve water while taking showers:
1) Lower shower time
2) Don't leave shower running.
3) Check for leaks