A sports shop sells tennis rackets in 4 different weights, 2 types of string, and 3 grip sizes. How many different rackets

could they sell?

O 32

O 18

0 24

0 9

Answers

Answer 1

Answer: C) 24

Step-by-step explanation:

first we take down the information given to us

sports shop sells rackets in

4 different weights

2 types of strings

3 grip sizes

Now to get the number of different rackets they could sell, you simply take the  multiplication of the number of racket gripe sizes, the types of strings and different weights they sell

so

4 * 2 * 3 = 24

therefore the sport shop could sell up to 24 different rackets .

Answer 2

Answer:

24

Step-by-step explanation: got it right on my test


Related Questions

It is believed that approximately 12% of the population of the United States is lefthanded. Suppose researchers suspect that the proportion of left-handed people is higher in certain states than the national average. The researchers conduct a sample of 200 randomly selected people in the state of Maine and find that 29 people in the sample are left-handed.
a. Write the null hypothesis and alternative hypothesis and define your parameter.
b. Show that the necessary conditions (Randomization Condition, 10% Condition, Sample Size Condition) are satisfied to perform a hypothesis test. Briefly explain how each condition is satisfied.
c. Perform the hypothesis test and find the P-value. (To show your work: Write down what values you are entering into the hypothesis testing calculator.)
d. Is there strong evidence that the left-handed rate in the state of Maine is higher than the national average? Briefly explain how you know.

Answers

Answer:

Step-by-step explanation:

a. Null hypothesis: P = p

Alternatives hypothesis: P =/ p

Where P is the hypothesized population proportion and p is the sample proportion

b. Performing a test of proportions

Randomization: the sample was randomly selected in the study

The population size is at least 20 times as big as the sample size.

The sample includes both successes and failures with 29 success and 171 failures.

c. To perform the hypothesis test: we have to find the standard deviation first

Sd = sqrt[ P * ( 1 - P ) / n ]

where P is the hypothesized value of population proportion, n is the sample size.

Sd = √[0.12*(1-0.12)/200]

Sd = √[0.12*(0.88/200]

Sd = √[0.12*(0.0044)]

Sd = √0.000528

Sd = 0.023

Then we can find the z score

z = (p - P) / σ where p = 29/200 = 0.145

z = (0.145-0.12)/ 0.023

z = 0.025/0.023

z = 1.09

Calculation the p value using 0.05 level of significance and a two waited test (p value calculator),

A p-value of 0.2757 which is greater than 0.05, thus we will fail to reject the null stating that there is not enough strong evidence that the left-handed rate in the state of Maine is higher than the national average.

one car takes half a minute to complete a circuit.
the other car takes 1 minute and 10 seconds to complete a circuit.
if they start side by side, how long will it be before they are next side by side on the start line? state the units in your answer!
please help me I just need the answer

Answers

Answer:

7 laps

Step-by-step explanation:

Find the third-degree polynomial function that has zeros −2 and −15i, and a value of 1,170 when x=3.

Answers

Answer:

The third degree polynomial function = x³ + 27x² + 200x + 300

Step-by-step explanation:

The third-degree polynomial function has zeros −2 and −15.

From the above, we have been given two factors of the polynomial function. Let's derive the factors from the two zeros of the polynomial given.

The two given zeros of the polynomial can be written as:

x= -2

x+2 = 0

(x+2) is a factor of the polynomial

x= -15

x+15 = 0

(x+15) is a factor of the polynomial

So we have two factors of the polynomial (x+2) and (x+15). But since it is a third degree polynomial, we have to find the third factor.

Let (x-b) be the third factor and f(x) represent the third degree polynomial

f(x) = (x-b) (x+2) (x+15)

Expanding (x+2) (x+15) = x² + 2x + 15x + 30

(x+2) (x+15) = x² + 17x + 30

f(x) = (x-b) (x² + 17x + 30)

From the given information, a value of 1,170 is obtained when x=3

f(3) = 1170

Insert 3 for x in f(x)

f(3) = (3-b) (3² + 17(3) + 30)

1170 = (3-b) (9 + 51 + 30)

1170 = (3-b) (90)

1170/90 = 3-b

3-b = 13

b = 3-13 = -10

Insert value of b in f(x)

f(x) = [x-(-10)] (x² + 17x + 30)

f(x) = (x+10) (x² + 17x + 30)

f(x) = x³ + 17x² + 30x + 10x² + 170x + 200x + 300

f(x) = x³ + 27x² + 200x + 300

The third degree polynomial function = x³ + 27x² + 200x + 300

The most common form of color blindness is an inability to distinguish red from green. However, this particular form of color blindness is much more common in men than in women (this is because the genes corresponding to the red and green receptors are located on the X-chromosome). Approximately 79% of American men and 0.4% of American women are red-green color-blind.1 Let CBM and CBW denote the events that a man or a woman is color-blind, respectively.
(a) If an Americal male is selected at random, what is the probability that he is red-green color-blind? P(CBM) =
(b) If an American female is selected at random, what is the probability that she is NOT red-green color-blind? P (not CBW) =
(c) If one man and one woman are selected at random, what is the probability that neither are red-green color-blind? P=(neither is color-blind) =
(d) If one man and one woman are selected at random, what is the probability that at least one of them is red-green color-blind? P=(at least one is color-blind)

Answers

Answer:

(a) P(CBM) = 0.07

(b) P(not CBW) = 0.996

(c ) P(neither is color-blind) = 0.926

(d) P=(at least one is color-blind) = 0.074

Step-by-step explanation:

The correct data is  that Approximately 7% of American men and 0.4% of American women are red-green color-blind.

(a) Probability that he is red-green color-blind:

[tex]P(CBM) = 0.07[/tex]

(b) Probability that she is NOT red-green color-blind:

[tex]P(not\ CBW) =1- P(CBW)\\P(not\ CBW) = 1 -0.004\\P(not\ CBW) =0.996[/tex]

(c) Probability that neither are red-green color-blind

[tex]P(neither) = P(not\ CBW)*P(not\ CBM) \\P(neither) = 0.996 *(1-0.07)\\P(neither)=0.926[/tex]

(d) Probability that at least one of them is red-green color-blind

[tex]P(at\ least\ one) = 1- P(neither) \\P(at\ least\ one) = 1-0.926\\P(at\ least\ one) = 0.074[/tex]

find the quotient of 25.5÷0.5​

Answers

Answer:

[tex]51[/tex]

Step-by-step explanation:

[tex]\frac{25.5}{0.5}[/tex]

[tex]\frac{255}{5}[/tex]

[tex]=51[/tex]

Show the frequency distribution for the Gross Profit Margin using the five intervals below:, , , , and Gross Profit MarginFrequencyA. B. C. D. Choose the correct histogram from the above diagrams.e. What is the average price/earnings ratio (to 1 decimal)

Answers

Answer:

Step-by-step explanation:

a) Number of variables in the data set : 5

b) A quantitative variable is the one which can be quantitatively measured. i.e. it is a numerical value.

A categorical variable is the one that can take one value from a limited number of fixed values.

Exchange is a Categorical Variable. Price/Earnings Ratio is a Quantitative Variable. Gross Profit Margin (%) is a Quantitative Variable.

c. Out of the 25 stocks, AMEX is the exchange for 5 stocks. So percent frequency is 5/25 = 0.2 = 20%.

NYSE is the exchange for 3 stocks. So percent frequency is 3/25 = 0.12 = 12%.

OTC is the exchange for 17 stocks. So percent frequency is 17/25 = 0.68 = 68%.

These percentages are correctly shown in graph a. So the answer is a.

d) The frequency distribution is

Gross Profit Margin                Frequency

0-14.9                                        2

15-29.9                                      6

30-44.9                                     8

45.59.9                                    6

60.74.9                                    3

As we come across the Gross Profit Margin values in the table, we add a | next to its respective interval and build the above table. E.g. the first value in the table under Gross Profit Margin is 36.7 which lies in the interval 30–44.9. So we add one | in fromt of that interval and so on until we cover the entire table. The number of | shows the frequency distribution of the values.

The correct histogram is A.

e. The average price/earnings ratio is found by adding all the 25 values in the table and dividing the answer by 25.

= 505.40/25

= 20.2

Im stuck who can help me

Answers

Answer:

Option D

Step-by-step explanation:

This question is based on the " Partition Postulate. " You might be familiar with it, it states that a whole is composed of several parts. In this case you could say that this " whole " is ∠ ABC, and the " parts " are ∠1 and ∠2. By this Theorem you could also state the following;

[tex]m< ABC = m< 1 + m< 2,\\\\Substitute,\\110 = 4x + ( 5x + 10 ),\\110 = 4x + 5x + 10,\\4x + 5x + 10 = 110 - Option D\\\\Solution - Option D[/tex]

Hope that helps!

-23d + 81 <-98d + 1
Solve for d

Answers

Step-by-step explanation:

-23d + 81 < - 98d + 1

81 - 1 < - 98d + 23d

80 < - 75d

80/ - 75 < d

10/ - 3 < d

The point A (-7,5) is reflected over the line x = -5, and then is reflected over the line x= 2. What are the coordinates of
A?
o (7, 19)
O (10,5)
(7,5)
(10, 19)

Answers

Answer:

(7, 5) is the final reflection of the point.

Step-by-step explanation:

We are given point A(-7, 5) which is first reflected over the line [tex]x= -5[/tex].

The minimum distance of the point A(-7, 5) from the line [tex]x= -5[/tex] is 2 units across the horizontal path (No change in y coordinate).

Point A lies 2 units on the left side of the line [tex]x= -5[/tex].

So, its reflection will be 2 units on the right side of [tex]x= -5[/tex].

Let its reflection be A' which has coordinates as (-5+2,5) i.e. (-3, 5).

Now A'(-3, 5) is reflected on the line [tex]x=2[/tex].

The minimum distance of the point A'(-3, 5)  from the line [tex]x=2[/tex] is 5 units across the horizontal path (No change in y coordinate).

Point A' lies 5 units on the left side of the line [tex]x=2[/tex].

So, its reflection will be 5 units on the right side of [tex]x=2[/tex].

Let its reflection be A'' which has coordinates as (2+5, 5) i.e (7, 5) is the final reflection of the point..

Please find attached image.

(7, 5) is the final reflection of the point.

If 9: x= x-4, then x=
0 36
18
0 24
6

Answers

Answer:

2±√13

Step-by-step explanation:

9/x=x-4

x² -4x - 9=0

x² -4x +4- 13=0

(x -2)²=13

x-2= ±√13

x= 2±√13

Can anyone help me with the answer please

Answers

Answer:

Graph D

Step-by-step explanation:

First, look at the x-intercepts (where the graph touches the x-axis): x= -1 and x= 3

This rules out Graph B and C which have x-intercepts at x= -3 and x= -1

Next, look at the y-intercept (where the graph touches the y-axis): y= -3

This rules out Graph A which has a y-intercept at y= 3

What is the MEDIAN of this data?

Answers

Answer:

I think the median is 7

if it is not im so sorry

The median of the data is 7.

please see the attached picture for full solution

Hope it helps

Good luck on your assignment

What is the length of AC

Answers

Answer:

  5.8

Step-by-step explanation:

The angle bisector makes the triangle sides on either side of it proportional.

  AC/CD = AB/BD

  AC = CD·AB/BD

  AC = 2(8.1/2.8) = 8.1/1.4 ≈ 5.7857 . . . . substitute shown values, evaluate

  AC ≈ 5.8

Graph the equation below by plotting the
y-intercept and a second point on the
line.

Answers

Answer:

Step-by-step explanation:

On the y-axis, graph the point on (0,4). Then from there, go up one, and to the right 4.

A train is traveling at a constant speed and has traveled 67.5 miles in the last 11 hours.

Which equation shows the proportional relationship between the distance, d, and the time, t,

that the train has traveled?

A.d=45t

B.d=50t

C.d = 690

D.d=67.5t

Answers

Answer:

A. d= 45t

Step-by-step explanation:

(assuming that you meant 67.5 in the last 1.5 hours)

67.5 miles = distance

1.5 hours = time

therefore:

[tex]\frac{d}{t\\}[/tex] = 67.5/1.5

making your answer 45

leaving a as your correct answer:

d= 45t

The proportion relationship between the distance d, and the time t, that the train has travelled is, d = 45t. So the correct option is A).

What is a proportion relationship?

Proportional relationships are relationships between two variables where their ratios are equivalent. Another way to think about them is that, in a proportional relationship, one variable is always a constant value times the other.

Given that, A train travels at a constant speed and has travelled 67.5 miles in the last 1.5 hours. (assuming that you meant 67.5 in the last 1.5 hours)

67.5 miles = distance

1.5 hours = time

We know that, speed = distance / time

s = 67.5/1.5

s = 45 mph

Now, distance = speed × time

d = 45t

Hence, the proportion relationship between the distance d, and the time t, that the train has travelled is, d = 45t. So the correct option is A).

For more references on proportion relationship, click;

https://brainly.com/question/29765554

#SPJ5

someone plz help asap plz

Answers

Answer:

a) 6

b) 10

Step-by-step explanation:

a) The area of a rhombus is half the product of the diagonals, meaning that the area of the shaded part is 4*3/2=6 square meters.

b) To find the area of the white background, you need to find the area of the full rectangle, and then to find the area of both rhombii. The area of the black rhombus is 2*4/2=4 square meters. The area of the full rectangle is 4*5=20 units. Subtracting the areas of the two rhombii, you get an area for the white background of 20-6-4=10 square meters. Hope this helps!

In a survey, participants were asked how much confidence they had in the economy.
The results were as follows:



Response Number

A great 3,187
deal

Some
9,120

Hardly 5,149
any



What is the probability that a sampled person has either some confidence or a great
deal of confidence in the economy? Write only a number as your answer. Round to
two decimal places (for example: 0.43). Do not write as a percentage.

Answers

Answer:

0.71

Step-by-step explanation:

Great Deal or Some = 12,307

Total Participants = 17,456

Probability = 12,307/17,456 = 0.71

4. In the Department of Natural Sciences, 14 faculty members have a PhD, and 30 faculty
members do not have a PhD. In the Department, the number of female faculty who do not
have a PhD is 10 more than the number of females who have a PhD. If a third of the male
faculty in the Department have a PhD, then what is the number of female faculty in the

Answers

Answer:

  8

Step-by-step explanation:

We can start by making the table below to show the given numbers (red) and to assign a variable (x) to the number we want to find: female PhDs.

By subtracting the female numbers from the totals, we can find the corresponding numbers of male PhDs and non-PhDs.

The number of male non-PhDs is twice the number of male PhDs, so we have ...

  2(14 -x) = 20 -x

  28 -2x = 20 -x . . . . eliminate parentheses

  8 = x . . . . . . . . . . . .add 2x-20

The number of female faculty with PhDs is 8.

find the area enclosed by the curve y^2=x^2-x^4

Answers

Answer: 4/3

Step-by-step explanation:

As you know this graph is a lemniscate

[tex]4\int\limits^1_0 {x\sqrt{1-x^{2} } \, dx =\frac{4}{3} =1.33$[/tex]

What is the approximate value for the modal daily sales?

Answers

Answer:

Step-by-step explanation:

Hello!

The table shows the daily sales (in $1000) of shopping mall for some randomly selected  days

Sales 1.1-1.5 1.6-2.0 2.1-2.5 2.6-3.0 3.1-3.5 3.6-4.0 4.1-4.5

Days 18 27 31 40 56 55 23

Use it to answer questions 13 and 14.

13. What is the approximate value for the modal daily sales?

To determine the Mode of a data set arranged in a frequency table you have to identify the modal interval first, this is, the class interval in which the Mode is included. Remember, the Mode is the value with most observed frequency, so logically, the modal interval will be the one that has more absolute frequency. (in this example it will be the sales values that were observed for most days)

The modal interval is [3.1-3.5]

Now using the following formula you can calculate the Mode:

[tex]Md= Li + c[\frac{(f_{max}-f_{prev})}{(f_{max}-f_{prev})(f_{max}-f_{post})} ][/tex]

Li= Lower limit of the modal interval.

c= amplitude of modal interval.

fmax: absolute frequency of modal interval.

fprev: absolute frequency of the previous interval to the modal interval.

fpost: absolute frequency of the posterior interval to the modal interval.

[tex]Md= 3,100 + 400[\frac{(56-40)}{(56-40)+(56-55)} ]= 3,476.47[/tex]

A. $3,129.41 B. $2,629.41 C. $3,079.41 D. $3,123.53

Of all options the closest one to the estimated mode is A.

14. The approximate median daily sales is …

To calculate the median you have to identify its position first:

For even samples: PosMe= n/2= 250/2= 125

Now, by looking at the cumulative absolute frequencies of the intervals you identify which one contains the observation 125.

F(1)= 18

F(2)= 18+27= 45

F(3)= 45 + 31= 76

F(4)= 76 + 40= 116

F(5)= 116 + 56= 172 ⇒ The 125th observation is in the fifth interval [3.1-3.5]

[tex]Me= Li + c[\frac{PosMe-F_{i-1}}{f_i} ][/tex]

Li: Lower limit of the median interval.

c: Amplitude of the interval

PosMe: position of the median

F(i-1)= accumulated absolute frequency until the previous interval

fi= simple absolute frequency of the median interval.

[tex]Me= 3,100+400[\frac{125-116}{56} ]= 3164.29[/tex]

A. $3,130.36 B. $2,680.36 C. $3,180.36 D. $2,664

Of all options the closest one to the estimated mode is C.

If f(x) = 4–1 and g(x) = 8x, which expression is equivalent to (g-1)(3)?
O 8-3-(4 + 3)
08-3-(4-32
813)-4432
O 6(3) 4-32

Answers

Answer:

Option (3)

Step-by-step explanation:

Given functions are f(x) = 4 - x² and g(x) = 6x

We gave to find the expression for (g - f)(3).

(g - f)(x) = g(x) - f(x)

            = 6x - (4 - x²)

            = 6x - 4 + x²

By substituting x = 3 in this expression,

(g - f)(x) = 6(3) - 4 + (3)²

Therefore, option (3) will be the answer.

find an angle x where sin x = cos x (I know this has been answered but I rlly don't get it..)​

Answers

Answer:

45 degrees

Step-by-step explanation:

sin x=cos(90-x)

sin(45)=cos(90-45)=cos(45)

Answer:

The answer is 45.

sin45=cos45= 1/√2.

hope it helps u ...

To test whether or not there is a difference between treatments A, B, and C, a sample of 12 observations has been randomly assigned to the three treatments. You are given the results below. Treatment Observation A 20 30 25 33 B 22 26 20 28 C 40 30 28 22 The test statistic to test the null hypothesis equals _____.

Answers

Answer:

The test statistic to test the null hypothesis equals 1.059

Step-by-step explanation:

From the given information; we have:

Treatment               Observations

A                                20        30         25       33

B                                22         26        20       28

C                               40         30         28       22

The objective is to find the  test statistic to test the null hypothesis; in order to do that;we must first run through a series of some activities.

Let first compute the sum of the square;

Total sum of squares (TSS) = Treatment sum of squares [tex](T_r SS)[/tex]  +    Error sum of squares   (ESS)

where:

(TSS) = [tex]\sum \limits ^v_{i=1} \sum \limits ^{n_i}_{j-1}(yij- \overline {y}oo)^2[/tex]  with (n-1)   df

[tex](T_r SS)[/tex]   [tex]= \sum \limits ^v_{i=1} n_i( \overline yio- \overline {y}oo)^2[/tex]   with (v-1)  df

[tex](ESS) = \sum \limits ^v_{i=1} \sum \limits ^{n_i}_{j-1}(yij- \overline {y}io)^2[/tex]   with (n-v) df

where;

v= 3

[tex]n_i=[/tex]4

i = 1,2,3

n =12

[tex]y_{ij}[/tex] is the [tex]j^{th[/tex] observation for the [tex]i^{th[/tex] treatment

[tex]\overline{y}io[/tex] is the mean of the  [tex]i^{th[/tex] treatment  i = 1,2,3 ;  j = 1,2,3,4

[tex]\overline y oo[/tex]   is the overall mean

From the given data

[tex]\overline y oo = \dfrac{1}{12} \sum \limits ^3_{i=1} \sum \limits ^{4}_{j=1}(yij)^2= 27[/tex]

[tex]TSS = \dfrac{1}{12} \sum \limits ^3_{i=1} \sum \limits ^{4}_{j=1}(yij- 27)^2 = 378[/tex]

[tex]T_r SS= \sum \limits^3_{i=1}4 (\overline y io - \overline yoo)^2[/tex]

[tex]=4(27-27)^2+4(24-27)^2+4(30-27)^2 = 72[/tex]

Total sum of squares (TSS) = Treatment sum of squares [tex](T_r SS)[/tex]  +    Error sum of squares   (ESS)

(TSS) =  378 - 72

(TSS) =  306

Now; to the mean square between treatments (MSTR); we use the formula:

MSTR = TrSS/df(TrSS)

MSTR = 72/(3 - 1)

MSTR = 72/2

MSTR = 36

The mean square within treatments  (MSE) is:

MSE = ESS/df(ESS)

MSE = 306/(12-3)

MSE = 306/(9)

MSE = 34

The test statistic to test the null hypothesis is :

[tex]T = \dfrac{ \dfrac{TrSS}{\sigma^2}/(v-1) }{ \dfrac{ESS}{\sigma^2}/(n-v) } = \dfrac{MSTR}{MSE} \ \ \ \approx \ \ T(\overline {v-1}, \overline {n-v})[/tex]

[tex]T = \dfrac{36}{34}[/tex]

T = 1.059

what is the radius of the circle that has an area of [tex]81*x*pi[/tex] degrees

Answers

Answer:

R=9

Step-by-step explanation:

the formula for area of a circle is pi r squared

where r denotes the radius of the circle

equating the formula for area with the area of the circle provided

p\i r squared = 81 p\i

r squared = 81

r = radical 81

r =9 inches

In a certain city district the need for money to buy drugs is stated as the reason for 70% of all thefts. Find the probability that among the next 7 theft cases reported in this district, exactly 3 of them resulted from the need to buy drugs.

Answers

Answer:

9.72% probability that among the next 7 theft cases reported in this district, exactly 3 of them resulted from the need to buy drugs.

Step-by-step explanation:

For each theft, there are only two possible outcomes. Either the need to buy drugs is the reason of the theft, or it is not. Each theft is independent of each other. So we use the binomial probability distribution to solve this question.

Binomial probability distribution

The binomial probability is the probability of exactly x successes on n repeated trials, and X can only have two outcomes.

[tex]P(X = x) = C_{n,x}.p^{x}.(1-p)^{n-x}[/tex]

In which [tex]C_{n,x}[/tex] is the number of different combinations of x objects from a set of n elements, given by the following formula.

[tex]C_{n,x} = \frac{n!}{x!(n-x)!}[/tex]

And p is the probability of X happening.

In a certain city district the need for money to buy drugs is stated as the reason for 70% of all thefts.

This means that [tex]p = 0.7[/tex]

Find the probability that among the next 7 theft cases reported in this district, exactly 3 of them resulted from the need to buy drugs.

This is P(X = 3) when n = 7. So

[tex]P(X = x) = C_{n,x}.p^{x}.(1-p)^{n-x}[/tex]

[tex]P(X = 3) = C_{7,3}.(0.7)^{3}.(0.3)^{4} = 0.0972[/tex]

9.72% probability that among the next 7 theft cases reported in this district, exactly 3 of them resulted from the need to buy drugs.

find the slope of the line through points 8,2 and -1,-4

Answers

Answer:

2/3

Step-by-step explanation:

We can find the slope by using the slope formula

m= (y2-y1)/(x2-x1)

  = (-4-2)/(-1-8)

  = -6/ -9

  = 2/3

Draw a model of square root of 12 using perfect squares

Answers

Answer:

The answer is "[tex]\sqrt{12}[/tex] is not a perfect square".

Step-by-step explanation:

12 is not a perfect square because it is the natural number, and no other natural number would square the number 12, that's why it is not a perfect square.

If we calculate the square root of [tex]\sqrt{12}[/tex]. so, it is will give [tex]2\sqrt{3}[/tex] that is not a perfect square root which can be described as follows:

[tex]\Rightarrow \sqrt{12}= \sqrt{2\times 2\times 3}[/tex]

            [tex]= \sqrt{2^2\times 3}\\\\= 2\sqrt{3}\\\\[/tex]

[tex]\bold{\sqrt{12}}[/tex] is not a perfect square root.

Answer:

Here's a picture

Step-by-step explanation:

3km 5hm multiplied by 15 equals what

Answers

Answer: 525

Step-by-step explanation:

3 km =30 hm

35hm*15=525

Triangle ABC is a right triangle whose right angle is ZABC.
Find the measure of ZEBF.
ZABC and DBF are vertical angles, so they have the same
measure. Because IZABC is 90°, the sum of m2. DBE and
m2 EBF must also be 90°
Solve for x in this equation.
x + (x - 12) = 90
2x - 12 = 90
2x = 102
X51
m2 EBF = 51°

1.What is m
2.What is m
3.Explain how to find m

Answers

Answer: m is 13

m is 6

you find m by calculating!

Step-by-step explanation:

Please answer this correctly

Answers

Answer:

A = 1/2 b*h

A = 24

b = 8

h = ?

24 = 1/2 * 8 * h

24 = 4h

h = 6

The height is 6 cm.

Hope this helps.

Other Questions
quick reflection on the holocaust (min 5 sentences) asap If (x 13) is one factor of x^2 9x 52, the other factor is Which is a stretch of an exponential decay function?f(x) = Four-fifths (five-fourths) Superscript xf(x) = Four-fifths (four-fifths) Superscript xf(x) = Five-fourths (four-fifths) Superscript xf(x) = Five-fourths (five-fourths) Superscript x How is organizing the past by theme different from organizing the past byregion?A. historian who organizes the past by theme studies a big ideathat occurs across history, whereas a historian who organizes byregion focuses on specific start and end dates.B. A historian who organizes the past by theme studies a big ideathat occurs across human history, whereas a historian whoorganizes the past by region focuses on a specific area of theworld.C. A historian who organizes the past by theme focuses on a specificindividual, whereas a historian who organizes the past by regionfocuses on a big idea from history.D. A historian who organizes the past by theme studies a specifictime period, whereas a historian who organizes the past by regionstudies a specific individual from human history, What does the VSEPR theory predict?A. The chemical formula of a moleculeB. The size of a moleculeC. The shape of a moleculeD. The charge of a molecule Three dressers are placed side by side one dresser is 2 feet 9 inches wide , another is 2 feet 7 inches wide , and the third 3 feet 11 inches wide . How wide are they combined Read the following sentence:Consumers think of our products as pricey.Which word has the same general denotation as the underlined word, yetgives the sentence a more positive connotation?O A. LavishB. ExpensiveC. PracticalO D. Cheap The right trapezoid below has been decomposed into a rectangle and a right triangle.Find it's area two ways: By summing the areas of the rectangle and triangle. The way a text is built, arranged, and organized is referred to asStructure order patten arrangement Elasticity and Demand for Food A. Consider the information on real-world price elasticities for ten countries. Why do you think the price elasticity of demand for food is higher in Tanzania than in the U.S.? What does this imply about food purchases in the U.S. and Tanzania? B. The government wants to maximize its tax revenue. Revenue is equal to the amount of the tax times the quantity of goods sold (i.e., revenue Tax . Q). Which will provide more tax gasoline or a tax on restaurant meals? Why? how do you think period of harsh winters will affect the rabbit population Devin is working out on the elliptical and using the electronic heart rate monitor feature. His heart rate is at 178 beats per minute, and his target heart rate zone is 132 to 170 beats per minute. What should he do to get the best possible workout?What action can help keep you safe when active on a hot and sunny day? im a story who is the protagonist If you secure a refrigerator magnet about 2mmfrom the metallic surface of a refrigerator door and then move the magnet sideways, you can feel a resistive force, indicating the presence of eddy currents in the surface.A)Estimate the magnetic field strength Bof the magnet to be 5 mTand assume the magnet is rectangular with dimensions 4 cmwide by 2 cmhigh, so its area A is 8 cm2. Now estimate the magnetic flux B into the refrigerator door behind the magnet. Express your answer with the appropriate units.B)If you move the magnet sideways at a speed of 2 cm/s, what is a corresponding estimate of the time rate at which the magnetic flux through an area A fixed on the refrigerator is changing as the magnet passes over? Use this estimate to estimate the emf induced under the rectangle on the door's surface. Express your answer with the appropriate units. Which phrase describes the algebraic expression B2+7?the product of 8 and 7 more than a numberthe quotient of 8 and 78 times the sum of a number and 78 times a number plus 7 The dollar, or monetary unit and standard unit of currency in the U.S. monetary system, was modeled after 5. Which of the following linear functions has a graph which passes through points (5,2) and (3,0)? options: A. f(x) = x 3 B. f(x) = x + 3 C. f(x) = x + 3 D. f(x) = x 3 Water, in a 100-mm-diameter jet with speed of 30 m/s to the right, is deflected by a cone that moves to the left at 14 m/s. Determine (a) the thickness of the jet sheet at a radius of 230 mm. and (b) the external horizontal force needed to m A negative control is a sample that you know will give you a negative result. You are testing for the presence of proteins, reducing sugars, starch, and lipids in various foods. What would be the best negative control for this experiment The 1918 influenza epidemic killed between 50 million and 100 million people worldwide. This epidemic happened near the end of World War I. More people died from the influenza epidemic than were killed in the war. Which of the following explains why this virus was so deadly worldwide? Your answer: A.All of the answer choices B.Infected soldiers returning from the war spread the virus when they coughed. C.Medical personnel often became ill as a result of exposure to airborne virus particles.