The solution of KCl in water will undergo precipitation of KCl crystals as the temperature decreases from 50 °C to 20 °C and then to 34 °C due to the decreasing solubility of KCl in water.
What happens to a solution of KCl in water when cooled from 50 °C to 20 °C and then to 34 °C?
When the solution of KCl in water is cooled from 50 °C to 20 °C, the solubility of KCl in water decreases. As a result, some of the KCl will start to come out of the solution and form solid crystals.
Then, when the temperature of the solution is further decreased from 20 °C to 34 °C, the solubility of KCl in water decreases even further, causing more KCl to come out of the solution and form solid crystals. This is known as precipitation.
The amount of KCl that will come out of the solution depends on the solubility of KCl at the respective temperatures. The solubility of KCl in water is about 34 g/100 mL at 20 °C and about 42 g/100 mL at 34 °C. Therefore, when the solution is cooled from 50 °C to 20 °C, some KCl will come out of solution until the concentration in solution reaches about 34 g/100 mL. Further cooling to 34 °C will cause more KCl to come out of solution until the concentration in solution reaches about 42 g/100 mL.
The exact amount of KCl that will come out of solution can be calculated using thermodynamic models and experimental data on the solubility of KCl in water at different temperatures.
To learn more about precipitation, visit: https://brainly.com/question/14160641
#SPJ1
A student calculates the density of five different pieces of aluminum, each having a different volume.
Which graph best represents this relationship?
AN
KLEO
Volume
(A)
Volume
(B)
Volume
(C)
Volume
(D)
A student calculates the density of five different pieces of aluminum, each having a different volume Volume vs Density graph best represents this relationship.
What is Volume?Volume is the measure of an object's three-dimensional space. It is often referred to as the capacity of a container, or the amount of space an object occupies. Volume is measured in cubic units such as cubic centimeters (cm3), cubic meters (m3), or cubic feet (ft3). Volume is an important concept in mathematics and is used to calculate the amount of material an object is made from, the capacity of a container, and the amount of space a figure occupies. Volume is also used to calculate the amount of liquid, gas, or other material that can fit into a container.
To learn more about Volume
https://brainly.com/question/27100414
#SPJ1
Benzoic acid (C6H5COOH) and aniline (C6H5NH2) are both derivatives of benzene. Benzoic acid is an acid with Ka=6.3×10^(−5) and aniline is a base with Kb=4.3×10^(−10) .What is the value of the equilibrium constant for the following equilibrium? C6H5COOH(aq)+C6H5NH2(aq)⇌C6H5COO− (aq) +C6H5NH3(aq)
i want an accurate answer
Answer:
Explanation:
The equilibrium constant expression for the given reaction is:
K = ([C6H5COO-][C6H5NH3+])/([C6H5COOH][C6H5NH2])
We can use the acid dissociation constant (Ka) for benzoic acid and the base dissociation constant (Kb) for aniline to solve for the equilibrium constant (K) of the reaction.
Ka = [C6H5COO-][H3O+]/[C6H5COOH]
[H3O+] = Ka*[C6H5COOH]/[C6H5COO-]
Kb = [C6H5NH3+][OH-]/[C6H5NH2]
[OH-] = Kb*[C6H5NH2]/[C6H5NH3+]
Substituting [H3O+] and [OH-] into the equilibrium constant expression and simplifying, we get:
K = (Ka*Kb)/([H3O+][OH-])
K = (6.3×10^(-5))(4.3×10^(-10))/((KaC6H5NH2)(KbC6H5COOH))
K = (6.3×10^(-5))*(4.3×10^(-10))/(1.00×10^(-14))
K = 2.73×10^(-2)
Therefore, the equilibrium constant for the given reaction is 2.73×10^(-2).
How do you calculate the mass of an atom of silver? Need to have this answer in 7th grade terms,
Answer:
To calculate the mass of an atom of silver, we need to know the number of protons and neutrons in the nucleus of the atom. The atomic number of silver is 47, which means it has 47 protons in its nucleus. The mass number of silver is 108, which means that the total number of protons and neutrons in its nucleus is 108. Therefore, the mass of an atom of silver is approximately 108 times the mass of a single proton or neutron. This is because the mass of an electron is much smaller than the mass of a proton or neutron and can be neglected. The mass of a single proton or neutron is approximately 1 atomic mass unit (amu), so the mass of an atom of silver is approximately 108 amu.
what subshell has quantum numbers n =2 and l = 2?
The subshell with quantum numbers n=2 and l=2 is the 2D subshell.
What is quantum number?The set of numbers used to describe the position and energy of the electron in an atom are called quantum numbers.
There are four known quantum numbers, and they include:
principal, azimuthal, magnetic and spin quantum numbers.The principal quantum number (n) indicates the energy level or shell of an electron, while the azimuthal quantum number (l) indicates the shape of the electron cloud or subshell.
Learn more about quantum number at: https://brainly.com/question/2292596
#SPJ1
Whales have one of the longest gestation periods of any mammal. According to a website, the mean gestation period for a whale is 15 months. Assume the distribution of gestation periods is Normal with a standard deviation of 1.1
months
a. Find the standard score associated with a gestation period of 13.9 months.
b. Using the Empirical Rule and your answer to part a, what percentage of whale pregnancies will have a gestation period between 13.9 and 15 months?
c. Would it be unusual for a whale to have a gestation period of 19 months? Why or why not?
a. A gestation period of 13.9 months has a standard score of -1.36.
b. Approximately 99.7% will fall within three standard deviations of the mean.
c. A gestation period of 19 months is very unlikely to occur in a normal distribution, and it would be considered unusual.
What is standard score?
a. To find the standard score associated with a gestation period of 13.9 months, we use the formula:
z = (x - μ) / σ
where x is the gestation period, μ is the mean gestation period, and σ is the standard deviation. Plugging in the values given, we get:
z = (13.9 - 15) / 1.1 = -1.36
Therefore, a gestation period of 13.9 months has a standard score of -1.36.
Empirical Rule:
b. Using the Empirical Rule, we know that approximately 68% of the gestation periods will fall within one standard deviation of the mean, approximately 95% will fall within two standard deviations of the mean, and approximately 99.7% will fall within three standard deviations of the mean.
Since we found the standard score in part a, we can use it to calculate the percentage of whale pregnancies that will have a gestation period between 13.9 and 15 months. This gestation period range is within one standard deviation of the mean, so we can say that approximately 68% of whale pregnancies will fall within this range.
What is gestation period?
c. A gestation period of 19 months is more than three standard deviations away from the mean gestation period of 15 months. Using the Empirical Rule, we can say that approximately 99.7% of the gestation periods will fall within three standard deviations of the mean. Therefore, a gestation period of 19 months is very unlikely to occur in a normal distribution, and it would be considered unusual.
To know more about gestation period, visit:
https://brainly.com/question/22372745
#SPJ1
A mass of 1.71 g pure barium hydroxide is transferred quantitatively to a 250 cm3
volumetric flask and made up to the mark with distilled water. Using a pipette, 25.0 cm3
of the barium hydroxide solution are placed in a conical flask and a few drops of methyl
orange indicator are added. Hydrochloric acid is added slowly from a burette until the
endpoint is reached. The titre value is 12.6 cm3
What will the colour change of the indicator at the endpoint be?
The methyl orange indicator will change from red to yellow at the titration's endpoint.
How can the color of the indicator's change at the terminus be determined?An acid-base indicator called methyl orange changes color between the pH ranges of 3.1 and 4.4. In acidic and basic solutions it is red and yellow, respectively
In this instance, an acid, hydrochloric acid, is being used to titrate the barium hydroxide solution. The pH of the solution will fall as we add the acid since it will neutralize the base. The hue of the methyl orange indicator will vary when the pH ranges from 3.1 to 4.4
All of the barium hydroxide will have interacted with the hydrochloric acid by the time the titration is complete leaving a neutral solution. When the methyl orange indicator becomes yellow the solution's pH is in the basic range.
Therefore, the methyl orange indicator will change from red to yellow at the titration's endpoint.
Learn more about acid-base indicator here: brainly.com/question/1918667
#SPJ1
what volume of a 60.0% solution by mass is made with 45.0g of solute
The volume of a 60% solution by mass that is prepared with 45 grams of a particular solute is 75 mL.
How do you calculate the volume of a 60.0% solution made with 45.0g of solute?Firstly, to calculate the volume of the solution, we need to know the density of the solution. Since it is not mentioned in the question, we can assume it to be 1 g/ml.
Next, we can use the formula:
mass of solute = (mass of solution) x (percent by mass)
Here, the mass of solution is the mass of solute plus the mass of solvent.
Or, the mass of solute + the mass of solvent = the mass of solution
Therefore,
The mass of solvent = the mass of solution - the mass of solute
Substituting the values provided in the question, we get:
mass of solvent = (45) / (0.6) - 45 (since the solution is 60%)
mass of solvent = 75 - 45 = 30 g
Thus, mass of the solvent = 30g
Since volume = mass / density
The volume of the 60% solution = mass of solution / density
volume of solution = (45 + 30) / (1)
volume of solution = 75 mL
Thus, 75 mL of the 60% solution by mass is made with 45g of solute.
Learn more about volume and density here:
https://brainly.com/question/10821730
#SPJ1
a ___ weather front forms when a warm air mass pushes into a cooler air mass
a) cold
b) warm
c) stationary
Answer:
b) warm
Explanation:
A warm weather front forms when a warm air mass pushes into a cooler air mass. Therefore, the answer is b) warm.
I'm sorry to bother you but can you please mark me BRAINLEIST if this ans is helpfull
I need help with this
As a result, the ideal gas law is applied, and the pressure of the gas in the container is 1.44 atm.
How does Charles Law compute pressure?The Kelvin temperature and hence the volume are going to be in direct proportion when the pressure on a sample of a dry gas is held constant, according to the definition of the Charles Law Formula. PV = k is the law's equation, and k might be a constant.
This issue can be resolved by applying the ideal gas law:
PV = nR
T = -52 °C + 273.15 = 221.15 K
n = 0.642 mol
V = 8.6 L
T = 221.15 K
[tex]R = 0.0821 L·atm/mol·K (gas constant for ideal gases)[/tex]
PV = nRT
P = nRT/V
P = (0.642 mol)(0.0821 L·atm/mol·K)(221.15 K)/(8.6 L)
P = 1.44 atm
To know more about ideal gas visit:-
https://brainly.com/question/28257995
#SPJ1
