The temperature scale required for gas law calculations is Kelvin , The temperature of the gas is 363 in Kelvin.
What is Gas Law ?According to Gas law , for a unit mole of ideal gas the product of pressure to volume is equal to the product of Universal Gas Constant and Temperature.
it is written as
PV = RT
It is given that A reaction forms a gas at 90.4 °C.
The temperature scale required for gas law calculation is Kelvin
Temperature in Kelvin = Temperature in degree Celsius +273
Temperature in Kelvin = 90.4 +273
Temperature in Kelvin = 363 K
To know more about Gas Law
https://brainly.com/question/12669509
#SPJ1
Which of the following is an impact of an increase in motor vehicles in cities?
Oxygen levels have increased
Carbon dioxide levels have increased
Supply of renewable resources has stopped
Supply of nonrenewable resources has become unlimited
What are other portals of entry besides needlesticks?
Answer:
Inhalation (via the respiratory tract)Absorption (via mucous membranes such as the eyes) Ingestion (via the gastrointestinal tract)
Explanation:
The opening where an infectious disease enters the host's body such as mucus membranes, open wounds, or tubes inserted in body cavities like urinary catheters or feeding tubes.
What is organic chemistry? Name at least three categories of compounds that are studied as
a part of organic chemistry.
Answer:
organic chemistry is chemistry focused on structure and composition, extending to recations and properties of compounds.
often centered around compounds with carbon.
alcohols, amines, and aldehydes are some groups that are studied on organic chemistry
SHORT ANSWER:
a) chemistry focused on the structure qnd composition of compounds
b) alcohols, amines, aldehydes
Explanation:
Organic compounds, which are the compounds associated with life processes, are the subject matter of organic chemistry. Among the numerous types of organic compounds, four major categories are found in all living things: carbohydrates, lipids, proteins, and nucleic acids.
Why are chemical equations balanced?
Answer:
The bonds between atoms in the reactants are rearranged to form new compounds in chemical reactions, but none of the atoms disappear and no new ones are formed. As a consequence, chemical equations must be balanced, meaning that the number and kinds of atoms must be the same on both sides of the reaction arrow.
Explanation:
Explanation:
because of to obey the law of conservation mass
you know the law of conservation mass states that matter is neither created nor destroyed during chemical reaction means the mass of reactants is equal to the mass of product
Which regulates the flow of electrical current to the filament of the x-ray tube? a. high-voltage circuit
b. low-voltage circuit
c. high-voltage transformer
d. low-voltage transformer
Which is the best One to One tutoring website?
Answer:
Brainly or Chegg tutors.
Explanation:
Try those!
6a. 0.898 mol sample of hydrogen gas at a temperature of 20.0 °C is found to occupy a volume of 24.5 liters. The pressure of this gas sample is
mm Hg.
6b. A sample of helium gas collected at a pressure of 991 mm Hg and a temperature of 300 K has a mass of 2.82 grams. The volume of the sample is
L.
8a. What volume is occupied by a 0.814 mol sample of xenon gas at a temperature of 0 °C and a pressure of 1 atm?
8b. A 1.21 mol sample of oxygen gas occupies a volume of
L at STP.
9b.What volume of carbon dioxide is produced when 7.95 liters of butane (C4H10) react according to the following reaction? (All gases are at the same temperature and pressure.)
butane (C4H10)(g) + oxygen(g) carbon dioxide(g) + water(g)
liters carbon dioxide
10b. What volume of carbon dioxide is produced when 0.504 mol of calcium carbonate reacts completely according to the following reaction at 0°C and 1 atm?
calcium carbonate ( s ) calcium oxide ( s ) + carbon dioxide ( g )
liters carbon dioxide
Gas law refers to the relationship between the temperature, volume and pressure of a gas.
What is gas laws?The term gas law refers to the relationship between the temperature, volume and pressure of a gas.
6a) PV =nRT
P = nRT/V
P = 0.898 * 0.082 * 293/24.5
P = 0.88 atm
6b) Number of moles of helium = 2.82 g/4 g/mol = 0.705 moles
Pressure = 991 mm Hg or 1.3 atm
V = nRT/P
V = 0.705 * 0.082 * 300/1.3
V = 13.3 L
8a) V = nRT/P
V = 0.814 * 0.082 * 273/1
V = 18.22 L
8b) 1 mole of oxygen occupies 22.4 L
1.21 mole of oxygen occupies 1.21 mole * 22.4 L/ 1 mole
= 27.1 l
9b) C4H10(g) + 13/2O2 -----> 4CO2 + 5H20
1 moles of butane produces 4 moles of CO2, It then follows that the volume of carbon dioxide produced is 4( 7.95 liters) = 31.8 litres
10b) CaCO3 ------> CO2 + CaO
Since the reaction is 1:1, 0.504 mol of CO2 is produced
PV =nRT
V = 0.504 * 0.082 * 273/1 atm
V = 11.3 L
Learn more about the ideal gas equation:https://brainly.com/question/79835
#SPJ1
How many moles of H2 are needed to react with 4.8 mol of O2 ?
Answer:
9.6 mol
Explanation:
Start by writing out the balanced equation of the reaction.
2[tex]H_{2}[/tex] + [tex]O_{2}[/tex] ⇒ 2[tex]H_{2}O[/tex]
Here you will see 2 mol of hydrogen for every 1 mol of oxygen. Using this ratio, you can assume the amount of hydrogen will always be double that of oxygen. In this case, 4.8 * 2 = 9.6
What is the rule when "ao" or "oo" are together when naming covalent bonds
They are converted into a single “o” when "ao" or "oo" are together when naming covalent bonds.
What is a covalent bond?A covalent bond consists of the mutual sharing of one or more pairs of electrons between two atoms.
Sometimes, while naming the chemical compounds, a problem arises when compounds with “ao” and “oo” are written with -ide name. Conventionally, they are converted into a single “o”.
For example, the “ao” in the dichlorine hept-ao-xide ([tex]Cl_2O_7[/tex]). This “ao” in the [tex]Cl_2O_7[/tex] can be converted into “o”. As the result, the correct name of this compound would be dichlorine hept-o-xide.
Hence, they are converted into a single “o” when "ao" or "oo" are together when naming covalent bonds.
Learn more about the covalent bond here:
https://brainly.com/question/12661797
#SPJ1
A hot air balloon is filled with 1.89 x 10² liters of air at 21°C. If atmospheric pressure does not change,
how hot must the air become in order to increase the volume to 4.5 x 10² liters?
Answer:
7.0k x 10^2k
Explanation:
Solve for x , where M is molar and s is seconds.
Enter the answer. Include units. Use the exponent key above the answer box to indicate any exponent on your units.
x=(3.7×103M−2s−1)(0.37M)3
Answer:
187.416 M/s
Explanation:
First the units M^-2 s^-1 * M^3 = M/s
now the numbers
3700 * .37^3 = 187.416
An imaginary element, Y, has two different isotopes.
y has a percentage abundance of 25% and 29y has a percentage abundance of
75%.
Which of the following is the relative atomic mass of Y?
26
25
27
28
Answer:
kliujhygfdsalikumjyhbtgvf
Explanation:
The answer is:
28
I just got this answer so I don't know how to work it out but i hope it helps.
How many moles of zinc, Zn, are in 1.31×1024 Zn atoms?
Answer:
=7.89013× 10^47 moles of zinc
Explanation:
1 atom contains 6.023×10^23 moles.
1.31×10^24 atoms of zinc contain6.023×10^24×1.31×10^.24
Activity 1.3 Put an unlit incense stick in a corner of your class. How close do you have to go near it so as to get its smell? Now light the incense stick. What happens? Do you get the smell sitting at a distance? Record your observations.
A 1dm3 solution was made by mixing 0.0040 mol of HCl(aq) and 0.0025 mol of NaOH(aq). What was the pH of the resulting solution?
The pH of the resulting solution is 2.82.
What is pH ?pH is the measure of acidity and alkalinity of a solution , It has a range of 1 to 14.
HCl + NaOH → NaCl + H₂O
0.0040 .0025 0 0
0.0040 -0.0025 0 0.0025 0.0025
Moles of HCl = 0.0015
As 0.0025 moles of NaOH reacts with 0.0025 moles of HCl leaving behind 0.0015 moles of HCl
Concentration of HCl = 0.0015/ 1 = 0.0015 M
[ H⁺] = 0.0015 M
pH = -log [ H⁺]
pH = -log [ 0.0015]
pH = 2.82
Therefore the pH of the resulting solution is 2.82.
To know more about pH
https://brainly.com/question/15289741
#SPJ1
IUPAC NAME OF CH3CH2CH(CH3)CH2CH(C3H7)-CH3?
Answer:
the IUPAC name is: 2-ethyl-3-methyl-pentanal
Answer:
Thus IUPAC name is: 3-methylpentane. Was this answer helpful?
Explanation:
hope it will help you
What is the balanced form of the chemical equation shown below?
C₂H5OH() + O₂(g) → H₂O(A) + CO₂(g)
Answer: C(2)H(5)OH + 3O(2) —> 3H(2)O + 2CO(2)
Explanation:
*The number in parentheses or
( ) represents the subscript of the element
Carbon-2
Hydrogen-6
Oxygen-7
I hope this is helpful.
Combustion reactions are ones that always include elemental oxygen as a reactant. When a hydrocarbon (substance made up of carbon and hydrogen) reacts with oxygen, the products of the combustion reaction are carbon dioxide and water.
Drag and drop the products to the correct reactants for these combustion reactions. The reactants have the correct coefficients for making balanced reactions.
1. CH4 + 2O2 = CO2 + 2H20 B.
2. 2CH2H6 + 7O2 = 4CO2 + 6H20 A
3. C3H8 + 502 = 3CO2 + 4H20 C
To find the appropriate end products, use the following rules
The hydrogen ratio should be the same on both the product and reactant sidesThe oxygen ratio should be the same on both the product and reactant sidesThe carbon ratio should be the same on both sides.Thus for equation;
1. CH4 + 2O2 = CO2 + 2H20 B.
2. 2CH2H6 + 2O2 = 4CO2 + 6H20 A
3. C2H8 + 502 = 2CO2 + 4H20 C
Learn more about balancing equations here:
https://brainly.com/question/26694427
#SPJ1
5. The rate of diffusion of a gas depends on its
molecular mass and the temperature.
Which combination of molecular mass and
temperature gives the slowest rate of diffusion?
molecular mass
temperature
A.high
high
B.low
low
C.high
low
D.high
low
Answer:
A
Explanation:
because rate of diffusion is inversely proportional to molecular mass
The combination of high molecular mass and low temperature gives the slowest rate of diffusion.The correct option is c.
When it comes to diffusion, the rate at which a gas spreads out depends on its molecular mass and temperature.
Molecular mass refers to the weight of the gas molecules. The larger the molecules, the slower they move and the slower they diffuse. Therefore, gases with higher molecular mass diffuse more slowly than those with lower molecular mass.
Temperature also affects the rate of diffusion. At higher temperatures, gas molecules have more energy and move faster, resulting in a faster diffusion rate. On the other hand, at lower temperatures, gas molecules have less energy and move slower, leading to a slower diffusion rate.
So, when we combine high molecular mass and low temperature, we have both factors working against a fast diffusion rate. The gas molecules are heavy, which slows down their movement, and the low temperature reduces their energy and speed. As a result, this combination gives us the slowest rate of diffusion.
In summary, the combination of high molecular mass and low temperature gives the slowest rate of diffusion.The correct option is C.
Learn more about diffusion,here:
https://brainly.com/question/33792345
#SPJ7
Under which conditions will gases best dissolve in liquids?
A. when the pressure is low and the temperature is low
B. when the pressure is high and the temperature is high
C. when the pressure is low and the temperature is high
D. when the pressure is high and the temperature is low
c option is correct answer
What is the mass in grams of carbon dioxide that would be required to react with 75.8 g of LiOH in the following chemical reaction? 2 LiOH(s) + CO₂(g) → Li₂CO₃(s) + H₂O(l)
Answer:
69.6 g CO₂
Explanation:
To find the mass of carbon dioxide, you need to (1) convert grams LiOH to moles LiOH (via molar mass from periodic table values), then (2) convert moles LiOH to moles CO₂ (via mole-to-mole ratio from reaction coefficients), and then (3) convert moles CO₂ to grams CO₂ (via molar mass). It is important to arrange the ratios/conversions in a way that allows for the cancellation of units (desired unit in the numerator). The final answer should have 3 sig figs to reflect the given value's sig figs.
Molar Mass (LiOH): 6.9410 g/mol + 15.998 g/mol + 1.008 g/mol
Molar Mass (LiOH): 23.947 g/mol
2 LiOH(s) + 1 CO₂(g) ----> Li₂CO₃(s) + H₂O(l)
Molar Mass (CO₂): 12.011 g/mol + 2(15.998 g/mol)
Molar Mass (CO₂): 44.007 g/mol
75.8 g LiOH 1 mole 1 mole CO₂ 44.007 g
------------------ x ---------------- x ----------------------- x ------------------- =
23.947 g 2 moles LiOH 1 mole
= 69.6 g CO₂
The mass in grams of carbon dioxide that would be required to react with 75.8 g of LiOH is 69.3g
What is Mole?The mole is an amount unit similar to familiar units like pair, dozen, gross, etc. It provides a specific measure of the number of atoms or molecules in a bulk sample of matter.
A mole is defined as the amount of substance containing the same number of atoms, molecules, ions, etc. as the number of atoms in a sample of pure 12C weighing exactly 12 g.
Given,
Mass of LiOH = 75.8g
Moles of LiOH = mass / molar mass
= 75.8 / 24 = 3.15 moles
From the reaction,
2 moles of LiOH react with 1 mole of CO₂
1 mole of LiOH needs 0.5 moles of CO₂
thus, 3.15 moles will need 0.5 × 3.15 moles = 1.575 moles of CO₂
Mass of Carbon dioxide = 1.575 × 44
= 69.3g of carbon dioxide
Therefore, the mass in grams of carbon dioxide that would be required to react with 75.8 g of LiOH is 69.3g
Learn more about Moles, here:
https://brainly.com/question/26416088
#SPJ2
QUESTION TO
What would I have to change to have a lunar eclipse happen every month?
You would have to fix the tilt of the Moon's orbit and make the Moon orbit planet Earth within the same plane that the Earth orbits the Sun.
What is a lunar eclipse?A lunar eclipse can be defined as a phenomenon which occurs when the planet Earth comes in between the Moon and the Sun, thereby causing the Earth to cover the Moon with its shadow.
In order to have a lunar eclipse occur every month, you would have to fix the tilt of the Moon's orbit and make the Moon orbit planet Earth within the same plane that the Earth orbits the Sun, so as to block any ray of sunlight from reaching the Moon.
Read more on lunar eclipse here: https://brainly.com/question/17067406
#SPJ1
Question 4 (3 points)
The mass of Jupiter is 1.90 x 1027 kg, and the mass of the Sun is 1.99 x 1030 kg. The average
distance between Jupiter and the Sun is 7.78 x 1011 m. What is the gravitational force they exert
on each other?
Answer:
=4.16×10^23Newton
Explanation:
By using formula,
F= GMm/d^2
How many molecules in HNO3?
Determine the hybrid orbital of this molecule.
There are three sigma bonds, so hybridization of the molecule will be sp²
Which are the product(s) of this chemical reaction? FeCl 3 + 3NH 4OH ->
a. 3NH4Fe + Cl3OH
b. 3FeCl3NH4OH
c. 3NH4Cl + 3FeOH
d. Fe(OH)3 + 3NH4Cl
How would you describe the kinetic energy of the particles in a solid?
Answer:
Solid objects have the least kinetic energy
Explanation:
because solid particles vibrate in place. Gases have the most kinetic energy because their particles move very quickly.
A temperature of 300 Kelvin is how many degrees Celsius?
A. 273
B. 27
C. 573
D. 300
Answer:
The answer is B, to convert kelvin to temperature you :
Subtract 273 (k - 273)
Please help thanks in advance
Calculate the equilibrium constant K for the following reaction at 25°C from standard electrode potentials. Fe³(aq) + Cu(s) = Fe²(aq) + Cu²(aq)
The equation is not balanced. Use standard reduction electrode potentials.
The equilibrium constant K for the following reaction at 25°C from standard electrode potentials is Antilog (37.5).
What is chemical equilibrium?Chemical equilibrium is the condition in the course of a reversible chemical reaction in which no net change in the amounts of reactants and products occurs.
Reduction Half-Reaction
[tex]Fe^{3+}[/tex](aq)+[tex]e^-[/tex] →[tex]Fe^{2+}[/tex](aq)
Standard reduction electrode potentials = +0.77
Oxidation Half-Reaction
Cu(s) = [tex]Cu^{+2}[/tex](aq) + 2[tex]e^-[/tex]
Standard reduction electrode potentials = -0.34
E° cell= E°cathode- E°anode
E° cell= +0.77+0.34
E° cell=1.11
E°cell= 0.0592÷n logK
From the redox reaction equations above, n=2
1.11 V= 0.0592÷2 logK
37.5 = logK
K= Antilog (37.5)
Hence, the equilibrium constant K for the following reaction at 25°C from standard electrode potentials is Antilog (37.5).
Learn more about chemical equilibrium here:
https://brainly.com/question/4289021
#SPJ1
Write and balance the equation for the combustion of the fatty acid stearic acid, (C18H36O2).Express your answer as a chemical equation. Identify all of the phases in your answer.
The combustion of the fatty acid called stearic acid has the the complete equation; C18H36O2(s) + 26O2(g) ------> 18CO2 (g) + 18 H2O(g)
What is combustion?The term combustion has to do with the burning of a substance in air. For organic compounds, we get carbon dioxide and water as the products.
Thus, for the combustion of the fatty acid called stearic acid, the complete equation is; C18H36O2(s) + 26O2(g) ------> 18CO2 (g) + 18 H2O(g)
Learn more about combustion:https://brainly.com/question/15117038?
#SPJ1
