Answer:
55.025g of N2O
Explanation:
2 NH3 + 2 O2 → N2O + 3 H2O
moles of O2 = 80.0/32 = 2.5 moles O2
moles of N2O = 2.5 moles O2 * 1 mole N2O
= 1.25 moles N2O
moles = mass/Molar mass
mass = moles * Molar mass = 1.25 x 44.02 = 55.025 g
Choose the more metallic element from each pair.
a . Sr or Sb,
b. As or Bi,
c. Cl or O,
d. S or As
Answer:
c
Explanation:
CI or O
Carla Vista Company has the following information available for September 2020.
Unit selling price of video game consoles $410
Unit variable costs $328
Total fixed costs $36,900
Units sold 600
Compute the unit contribution margin.
Unit contribution margin enter the unit contribution margin
Prepare a CVP income statement that shows both total and per unit amounts.
Compute Carla Vista’ break-even point in units.
Break-even point in units enter Break-even point in units units
Prepare a CVP income statement for the break-even point that shows both total and per unit amounts.
The more metallic element pair is Cl or O. Therefore, option C is correct.
What is metallic element ?Except for hydrogen, which is a nonmetal, the elements are arranged in a triangle with the metals to the left, the nonmetals to the right, and the metalloids to the immediate right of the triangle.
Metal atoms are bound together by metallic bonds to form solids known as metallic solids. Metal solids include things like copper, gold, and zinc, for instance. Since cesium is the last naturally occurring alkali metal, it has the most metallic characteristics.
The non-metal components, like as rock and rubbish, are subsequently removed from the ore during processing. The subsequent melting and combining of various metal components yields metal alloys. A solid metal alloy substance is produced when the freshly combined metal compound has cooled.
Thus, option C is correct.
To learn more about metallic element, follow the link;
https://brainly.com/question/24309770
#SPJ2
Write the equation for the acid dissociation, write the Ka expression, solve for Ht concentration, then do an ICE chart. Put the values into the Ka expression (the one you solved for Ht and find Ht, convert to pH and input that to 2 decimal place. Or use the Henderson-Hasselbalch equation:
pH = pka, + log ( Base/Acid)
Calculate the pH of a buffer solution consisting of 0.39 M HA (Ka = 8.8 x 10^-6) and 0.2 M NaA.
Answer:
The pH of the buffer is 4.77
Explanation:
Using Henderson-Hasselbalch equation we can solve the pH of the buffer:
pH = pKa + log [A⁻] / [HA]
Where pH is the pH of the buffer
pKa is -log Ka = 5.056
[A⁻] = [NaA] = 0.2M
[HA] = 0.39M
Replacing:
pH = 5.056+ log [0.2] / [0.39]
pH = 4.77
The pH of the buffer is 4.77
Which is correct order of the weather observed with each cloud type from 1 to 4?
A. Rain, thunderstorm, snow, fair
B. Light rain, fair, thunderstorm, fair
C. Light rain, thunderstorm, fair, fair
D. Hail, lightning, thunderstorm, fair
Answer:i thinks its A
Explanation:but who knows
A combustion reaction involves the reaction of a substance with oxygen gas. The complete combustion of any hydrocarbon (binary compound of carbon and hydrogen) produces carbon dioxide and water as the only products. Heptane is a hydrocarbon that is found in gasoline. Complete combustion of heptane produces 7 liters of carbon dioxide for every 8 liters of water vapor (both measured at the same temperature and pressure). What is the ratio of carbon atoms to hydrogen atoms in a molecule of heptane
Answer:
7/16
Explanation:
The general formula for the combustion of alkanes is;
CnH2n+2 + 3n+1/2 O2 -------> nCO2 + (n+1)H2O
So, we have;
CnHn + nO2 ------> 7CO2 + 8H2O
So there are 7 carbon atoms and 16 hydrogen atoms in heptane according to the law of conservation of mass.
Therefore, heptane is; C7H16
The ratio of carbon to hydrogen is now; 7/16
515282 quarts into milliliters. I
Answer:
487638640,7819
dndndnndndbxbdbdbdbdb
Which is the most soluble substance listed
PLEASE HELP!!
15POINTS!!! And brainliest
Answer: a. 3.36 L
b. 33.2 g
Explanation:
According to avogadro's law, 1 mole of every substance occupies 22.4 L at STP and contains avogadro's number [tex]6.023\times 10^{23}[/tex] of particles.
Standard condition of temperature (STP) is 273 K and atmospheric pressure is 1 atm respectively.
To calculate the number of moles, we use the equation:
[tex]\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}[/tex]
[tex]\text{Number of moles of} Fe_2O_3=\frac{16.0g}{159.69g/mol}=0.1mole[/tex]
[tex]3O_2(g)+4Fe(s)\rightarrow 2Fe_2O_3(s)[/tex]
a. 2 moles of [tex]Fe_2O_3[/tex] are produced by = [tex]3\times 22.4L=67.2L[/tex] of [tex]O_2[/tex]
Thus 0.1 moles of [tex]Fe_2O_3[tex] are produced by =[tex]\frac{67.2}{2}\times 0.1=3.36L[/tex] of [tex]O_2[/tex]
b. [tex]3\times 22.4L=67.2L[/tex] of [tex]O_2[/tex] react with = [tex]4\times 55.8=223.2g[/tex] of iron
Thus 10.0 L of [tex]O_2[/tex] react with = [tex]\frac{223.2}{67.2}\times 10=33.2g[/tex] of iron
Practice Problem 12.39 Partially correct answer. Your answer is partially correct. Try again. Acid-catalyzed hydration of 1-methylcyclohexene yields two alcohols. The major product does not undergo oxidation, while the minor product will undergo oxidation because the major product is Entry field with incorrect answer 2-methylcyclohexanol , which is a Entry field with incorrect answer secondary alcohol. These alcohols do not generally undergo oxidation. The minor product (Entry field with incorrect answer 1-methylcyclohexan-2-ol ) is asecondary alcohol and can undergo oxidation to yield a(n)
Answer:
See explanation and image attached
Explanation:
The acid-catalyzed hydration of 1-methylcyclohexene proceeds by an SN1 mechanism. The reaction involves the formation of carbocations.
Two carbocations are formed leading to the major and minor products. The major product is obtained from the tertiary (more stable) carbocation while the minor product is obtained from the secondary (less stable carbocation).
Tertiary alcohols are not oxidized, hence the major product does not undergo oxidation. However, secondary alcohols are oxidized to ketones.
how much energy must be released by 50.0 g of steam to decrease its temperature from 125.0 degrees Celsius to 100.0 degrees Celsius ?
Answer:
5250 Joules
Explanation:
Mass = 50g
Initial Temperature = 125.0 degrees Celsius
Final Temperature = 100 degrees Celsius
Temperature change = Final - Initial = 100 - 125 = -25
Heat = ?
These quantities are related by the equation;
H = mCΔT
where c = specific hear capacity = 4.2 J/g°C
H = 50 * 4.2 * (-25)
H = -5250 J (The negative sign is because heat is being released)
Gold is yellow, shiny, smooth, and is found in the ground. A geologist finds a material that she thinks may be gold. Which of the following tests would reveal that
the material is not gold and not an element?
A. Its density is different from that of gold.
B. Its melting point is different from that of gold.
C. The material is composed of two different substances.
D. Its boiling point differs from that of gold.
A 1,900-m3 water tower has been cleaned with a chlorine solution. The vapors of chlorine in the tower exceed allowable concentrations for the work crew to enter and finish repairs. If the chlorine concentration is 15 mg/m3 and the allowable concentration is 0.0015 mg/L, how long must the workers vent the tank with clean air flowing at 2.35 m3/s
Answer:
t = 1862 s
Explanation:
To do this, we need first to determine the theorical detention time, which can be determined with the following expression:
t₀ = ∀/Q (1)
Where:
t₀: detention time
∀: Volume of the fluid in the reactor
Q: Flow rate in the reactor
With this time, we must use the following expression to determine the time that the workers will take to vent the tank:
C = C₀ e^(-t/t₀) (2)
From here, we must solve for time t, and the expression will be:
t = ln(C₀/C) * t₀ (3)
Now that we know the expression to use, let's solve for t. Using (1) to determine the detention time, ∀ is 1900 m³, and Q is 2.35 m³/s so:
t₀ = 1900 / 2.35 = 808.51 s
Now, let's solve for the time t. C will be 0.0015 mg/L (or 1.5 mg/m³ cause in 1 m³ we have 1000 L) and C₀ 15 mg/m³:
t = ln(15/1.5) * 808.51
t = 1861.66 s or simply 1862 sHope this helps
g When water and perchloric acid (HClO4) are mixed, heat is released. The resulting solution is not an ideal solution, in terms of Raoult’s Law. How should the boiling point and the vapor pressure of a solution of HClO4 in H2O differ from what is expected for an ideal solution? A) boiling point higher than expected, vapor pressure lower than expected B) boiling point higher than expected, vapor pressure higher than expected C) boiling point lower than expected, vapor pressure lower than expected D) boiling point lower than expected, vapor pressure higher than expected E) boiling point and vapor pressure are both the same as expected for an ideal solution
Answer:
A) boiling point higher than expected vapor pressure lower than expected.
Explanation:
When water is introduced with heat it vaporize at a temperature of 100 degree centigrade. When hydrochloric acid is added to the water its boiling point of water increases slightly. The difference in the boiling point is due to the presence of heavier molecules in acid.
Which statement describes the movement of the medium by a transverse wave?
A. at an obtuse angle to the wave
B. parallel to the wave
C. at a right angle to the wave
D. at an acute angle to the wave
Answer:
A
Explanation:
But I'm not sure just my instinct
The statement that described the movement of the medium via the transverse wave should be that it should be parallel to the wave.
What is a transverse wave?It is the waves in which the motion considered all the points that should be on the wave oscillate along the paths at the right angles with respect to the wave of the direction. An example of this kind of wave should be electromagnetic, etc. Here, the movement should be parallel to the wave.
Hence, the correct option is b.
Learn more about transverse wave here: https://brainly.com/question/21890036
what is used to create motion
Answer:
These forces make objects change their motion or movement , the act of going from one place to another.
Explanation:
The hydrolysis of adenosine triphosphate (ATP) is represented by the equation below. This reaction is critically important in cellular biology, but the reaction itself proceeds at a very slow rate. Based on the information given, which of the following best explains why an enzyme (biological catalyst) is required for the reaction to occur at a faster rate?
ATP+ H2O ADP+ Pi
ΔG= -30.5Kj/mol
a. Because ΔG < 0, the hydrolysis of ATP is not thermodynamically favorable. In cells, ΔS is increased by increasing the amount of H2O consumed, resulting in ΔG >0 and an increase in the reaction rate.
b. Because ΔG < 0, the hydrolysis of ATP is not thermodynamically favorable. In cells, enzymes act as catalysts that decrease ΔH for the reaction, resulting in ΔG >0 and an increase in the reaction rate.
c. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a small activation energy.
d. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a large activation energy.
Answer:
d. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a large activation energy.
Explanation:
Hello!
In this case, since negative Gibbs free energies of reaction stand for thermodynamically favored processes, we can immediately rule out choices a. and b.
Moreover, since the reaction is slow without the presence of a catalyst, which the context of biochemistry is an enzyme, we infer that correct choice is d. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a large activation energy because the higher the activation energy the slower the reaction according to the Arrhenius equation.
Best regards!
How many grams of sodium (Na) are in 6.2 mol of Na?
mass = mol no. x molar mass
= 6.2 x 23
= 142.6 g
A student dissolves 10.2 g of sodium hydroxide (NaOH) in 250. g of water in a well-insulated open cup. He then observes the temperature of the water rise from 21.0 °C to 32.7 °C over the course of 3.7 minutes. Use this data, and any information you need from the ALEKS Data resource, to answer the questions below about this reaction: NAOH(s) → Na" (aq) + OH (aq) You can make any reasonable assumptions about the physical properties of the solution. Be sure answers you calculate using measured data are rounded to 3 significant digits. do Note for advanced students: Its possible the student did not do the experiment carefully, and the values you calculate may not be the same as the known and published values for this reaction. O exothermic Is this reaction exothermic, endothermic, or neither? O endothermic O neither If you said the reaction was exothermic or endothermic, calculate the amount of heat that was released or absorbed by the reaction in this case. kJ Calculate the reaction enthalpy AH per mole of NaOH. mol
Answer:
A) The reaction is an exothermic reaction
B) 12.744 kJ
c) 49.976 KJ/mol . NaOH
Explanation:
A) The reaction is an exothermic reaction
B) calculate the amount of heat that was released or absorbed by the reaction in this case. kJ
Assuming : specific heat of solution = specific heat of water = 4.186 J/g°C
mass of solution = 10.2 + 250 = 260.2 g
determine The heat released in the reaction
= mass of solution * specific heat of solution * temperature change
= 260.2 * 4.186 * ( 32.7 - 21 )
= 12.744 kJ
C) Calculate the reaction enthalpy ΔH per mole of NaOH. mol
Reaction enthalpy = - heat released / ( 10.2 /40 )
= - 12.744 / ( 10.2/40 ) = - 49.976 KJ/mol . NaOH
In Universe L , recently discovered by an intrepid team of chemists who also happen to have studied interdimensional travel, quantum mechanics works just as it does in our universe, except that there are four d orbitals instead of the usual number we observe here. Use these facts to write the ground-state electron configurations of the third and fourth elements in the first transition series in Universe L .
Answer:
See explanation
Explanation:
The third element in the first transition series is Vanadium
The fourth element in the first transition series is chromium
Given that we have four d orbitals in universe L instead of five as we have on earth;
The electronic configuration of Vanadium in universe L is;
Ar 3d3 4s2
The electronic configuration of chromium in universe L is;
[Ar] 3d4 4s2
A balloon full of air has a volume of 1.00L at a temperature of 23 °C. What is the balloon's volume at 33°C?
Answer:1.03L
How do I solve this?
Answer:
V2= 1.03L
Explanation:
Start off with what you are given.
V^1: 1.00L
T^1: 23°C
V^2?
T^2: 33°C
If you know your gas laws, you have to utilise a certain gas law called Charles' Law:
V^1/T^1 = V^2/T^2
Remember to convert Celsius values to Kelvin whenever you are dealing with gas problems. This can be done by adding 273 to whatever value in Celsius you have.
(23+273 = 296) (33+273 = 306)
Multiply crisscross
1.00/296= V^2/306
296V^2 = 306
Dividing both sides by 296 to isolate V2, we get
306/296 = 1.0337837837837837837837837837838
V2= 1.03L
what is the effect of heat and light on chemical reaction
on analysis an ammonium salt of an alkanoic acid gave 60.5% C and 6.5% H if 0.309g of the salt yield 0.0313g of Nitrogen determine the empirical formula of the salt [ H = 1, C =12, N = 14, O= 16]
Answer: C7H9NO2
Explanation:
%N = 0.0313/0.309 x 100
= 10.1%
%0 = 100 — (60.5 + 6.5 + 10.1)
= 22.9
C; 60.5/12 H; 6.5/1 N; 10.1/14 O; 22.9/16
C; 5.04/0.72 H; 6.5/0.72 N; 0.72/0.72 O; 1.43/0.72
Empirical formula — C7H9NO2
What is the formula for Pentasulfur heptaoxide
Answer:
S5O7
Explanation:
Consider the reaction between a solution of molecule A and a solid block of molecule B. In general, for a reaction to occur, the reactant molecules must be in contact with each other. Therefore, increasing the frequency of collisions between A and B molecules allows the reaction to occur more quickly. Identify the change in reaction condition that will increase the frequency of the molecular collisions.
Answer:
Decreasing the volume of solvent in the solution of molecule A
Explanation:
We know that one of the factors that affect the rate of reaction is the concentration of the reactants. The greater the concentration of reactants, the faster the rate of reaction (the greater the frequency of collision between reactants).
Hence, when we decrease the volume of solvent in the solution of molecule A, the concentration of the solution increases and consequently more particles of molecule A are available to collide with particles of molecule B resulting in a higher rate of reaction.
plzzzzzzz help asap its just one question plzzzzz its in the file <3
Answer:
There are 6 atoms of oxygen in 2Ca(NO3)2
Need help fast help help help. Help
Answer:
fjnjfzgnf
Explanation:
Answer:
it blank !
Explanation:
Explain why anhydrous aluminium chloride is fairly soluble in organic solvent while anhydrous magnesium chloride is insoluble
Answer:
The correct answer is - anhydrous aluminum chloride is covalent whereas anhydrous magnesium chloride is ionic.
Explanation:
Anhydrous aluminum chloride is a covalent compound and we know that covalent compounds have less or no polarity. Organic compounds or solvents are mostly non-polar in nature. And it is a thumb rule that like-dissolves-like.
Thus they dissolve covalent molecules like anhydrous aluminum chloride.
Anhydrous magnesium chloride is an ionic compound that tends to interact with a polar solvent but not in a non-polar solvent such as organic solvents.
Anhydrous aluminum chloride is fairly soluble in the organic solvent while anhydrous magnesium chloride is insoluble because anhydrous aluminum chloride is covalent whereas anhydrous magnesium chloride is ionic.
Why is AlCl3 soluble in organic solvent?AlCl3 quite simply accepts electrons from other atoms, in an try and get a full valence shell of eight electrons. It's why it normally behaves as a Lewis acid. In the response under, the Al atom accepts a lone pair of electrons from a Cl atom.
Why is AlCl3 soluble in water?AlCl3 is hygroscopic and has a great affinity for water. Therefore, aluminum chloride dissolves in water partially.
Learn more about anhydrous aluminum chloride here: https://brainly.com/question/21626996
#SPJ2
Please help I’m so confused on this it’s stoichiometry
Answer:
48.27g Na
Explanation:
To start we need to balance the equation. The trick is to make sure both sides have equal amounts of each atom:
2Na + Cl2 --> 2NaCl
Now we can use sociometry
We have 75 g of Cl2, and for every 1 mole of Cl2, there are 70.9 grams:
[tex]75g Cl2 * \frac{1mole Cl2}{70.9g Cl2}= 1.05 mole Cl2[/tex]
Now we have moles of Cl2. To get to grams of Na, we need to first use mole to mole ratio:
[tex]1.05mole Cl2 *\frac{2 mole Na}{1 mole Cl2} =2.1 mole Na[/tex]
From here we convert moles of Na into grams of Na
[tex]2.1mol Na*\frac{22.99g Na}{1 mole Na} = 48.27g Na[/tex]
It's usually easier to just make one singular equation with all of these smaller equations.
[tex]75gNa*\frac{1molCl2}{70.9gCl2} *\frac{2mol Na}{1 mol Cl2} *\frac{22.99g Na}{1 mol Na}=48.27 gNa[/tex]
The trick to sociometry is making sure your units cancel out until you only have the unit you want. If there are moles of Na in the numerator, there needs to be moles of Na in the denominator. If there are grams of Cl2 in the numerator, there needs to be grams of Cl2 in the denominator and so one and so on
A compound X has the following percentage composition 66.7% carbon, 11.1% hydrogen and 22.2% oxygen .Calculate the empirical formula of X.The relative molecular mass of X is 72 calculate the molecular formula
Explanation:
c. h. o
66.7%. 11.1%. 22.2%
____. ____. ____
12. 1. 16
1.558. 11.1. 1.39. (divide by the smallest)
1. 8. 1
empirical formula=ch8o
When a substance breaks up into two simpler substances, the reaction
is an)
reaction.
Answer:
Decomposition.
Explanation:
Decomposition Reactions T hose reactions in which a single substance (reactant) splits up into two or more simpler substances (products) are known as decomposition reactions. These reactions are carried out by supplying energy in form of heat, electricity or light which breaks that substance into simpler substances
(feso4.(Nh4) So4. 6H2o) +Kmno4+H2So4_Fe2(So4)3+K2So4+mnSo4+(Nh4)2So4+H2o
Answer:
balancing the equation?
