1. 1 N2+ 3 H2→2 NH3

c.How many moles of nitrogen are needed to produce 12 moles of nitrogen trihydride?

Answers

Answer 1
Answer:

[tex]\displaystyle 6 \ mol \ N_2[/tex]

General Formulas and Concepts:

Math

Pre-Algebra

Order of Operations: BPEMDAS

BracketsParenthesisExponentsMultiplicationDivisionAdditionSubtractionLeft to Right

Chemistry

Atomic Structure

Writing Compounds

Stoichiometry

Using Dimensional AnalysisReactions RxNExplanation:

Step 1: Define

[RxN - Balanced] N₂ + 3H₂ → 2NH₃

[Given] 12 mol NH₃

[Solve] x mol N₂

Step 2: Identify Conversions

[RxN] 1 mol N₂ → 2 mol NH₃

Step 3: Stoich

[DA] Set up:                                                                                                   [tex]\displaystyle 12 \ mol \ NH_3(\frac{1 \ mol \ N_2}{2 \ mol \ NH_3})[/tex][DA] Multiply/Divide [Cancel out units]:                                                       [tex]\displaystyle 6 \ mol \ N_2[/tex]
Answer 2

Answer:

[tex]\boxed {\boxed {\sf 6 \ moles \ of \ N_2}}[/tex]

Explanation:

1. Balance Equation

We are given the reaction:

[tex]1 N_2+3H_2 \rightarrow 2 NH_3[/tex]

The equation is already balanced. Both sides have 2 moles of nitrogen and 6 moles of hydrogen.

2. Conversions

In this reaction, 1 mole of nitrogen produces 2 moles of nitrogen tryhdride:

[tex]1 \ mol \ N_2 \rightarrow 2 \ mol \ NH_3[/tex]

3. Stoichiometry Calculations

Use the conversion rate as a fraction.

[tex]\frac{ 1 \ mol \ N_2}{2 \ mol \ NH_3}[/tex]

Multiply the number of moles of nitrogen trihydride produced: 12 moles.

[tex]12 \ mol \ NH_3 *\frac{ 1 \ mol \ N_2}{2 \ mol \ NH_3}[/tex]

The moles of nitrogen trihydride cancel.

[tex]12 *\frac{ 1 \ mol \ N_2}{2} = \frac{ 12 \ mol \ N_2}{2}[/tex]

[tex]6 \ mol \ N_2[/tex]

6 moles of nitrogen are needed to produce 12 moles of nitrogen trihydride.


Related Questions

Which is the most soluble substance listed

Answers

I can’t see the Potomac

what is used to create motion

Answers

Answer:

These forces make objects change their motion or movement , the act of going from one place to another.

Explanation:

A combustion reaction involves the reaction of a substance with oxygen gas. The complete combustion of any hydrocarbon (binary compound of carbon and hydrogen) produces carbon dioxide and water as the only products. Heptane is a hydrocarbon that is found in gasoline. Complete combustion of heptane produces 7 liters of carbon dioxide for every 8 liters of water vapor (both measured at the same temperature and pressure). What is the ratio of carbon atoms to hydrogen atoms in a molecule of heptane

Answers

Answer:

7/16

Explanation:

The general formula for the combustion of alkanes is;

CnH2n+2 + 3n+1/2 O2  -------> nCO2 + (n+1)H2O

So, we have;

CnHn + nO2 ------> 7CO2 + 8H2O

So there are 7 carbon atoms and 16 hydrogen atoms in heptane according to the law of conservation of mass.

Therefore, heptane is; C7H16

The ratio of carbon to hydrogen is now; 7/16


When a substance breaks up into two simpler substances, the reaction
is an)
reaction.

Answers

Answer:

Decomposition.

Explanation:

Decomposition Reactions T hose reactions in which a single substance (reactant) splits up into two or more simpler substances (products) are known as decomposition reactions. These reactions are carried out by supplying energy in form of heat, electricity or light which breaks that substance into simpler substances

What is the formula for Pentasulfur heptaoxide

Answers

Answer:

S5O7

Explanation:

How many grams of sodium (Na) are in 6.2 mol of Na?

Answers

mass = mol no. x molar mass
         = 6.2 x 23
         = 142.6 g

(feso4.(Nh4) So4. 6H2o) +Kmno4+H2So4_Fe2(So4)3+K2So4+mnSo4+(Nh4)2So4+H2o​

Answers

Answer:

balancing the equation?

Explain why anhydrous aluminium chloride is fairly soluble in organic solvent while anhydrous magnesium chloride is insoluble​

Answers

Answer:

The correct answer is - anhydrous aluminum chloride is covalent whereas anhydrous magnesium chloride is ionic.

Explanation:

Anhydrous aluminum chloride is a covalent compound and we know that covalent compounds have less or no polarity. Organic compounds or solvents are mostly non-polar in nature. And it is a thumb rule that like-dissolves-like.

Thus they dissolve covalent molecules like anhydrous aluminum chloride.

Anhydrous magnesium chloride is an ionic compound that tends to interact with a polar solvent but not in a non-polar solvent such as organic solvents.

Anhydrous aluminum chloride is fairly soluble in the organic solvent while anhydrous magnesium chloride is insoluble​ because anhydrous aluminum chloride is covalent whereas anhydrous magnesium chloride is ionic.

Why is AlCl3 soluble in organic solvent?

AlCl3 quite simply accepts electrons from other atoms, in an try and get a full valence shell of eight electrons. It's why it normally behaves as a Lewis acid. In the response under, the Al atom accepts a lone pair of electrons from a Cl atom.

Why is AlCl3 soluble in water?

AlCl3 is hygroscopic and has a great affinity for water. Therefore, aluminum chloride dissolves in water partially.

Learn more about anhydrous aluminum chloride here: https://brainly.com/question/21626996

#SPJ2

what is the effect of heat and light on chemical reaction​

Answers

when reactants are heated, the average kinetic energy of the molecules increases. When more molecules hit each other with enough energy to react, the rate of the reaction increases. The greater the light intensity on a reaction, the more reactant molecules are likely to gain the required activation energy to react, therefore reaction speed increases. basically both heat and light activate a reaction and speed it up.

anyone wanna do my chem test for 500 points? my insta is niqsariot_1 hmu if your interested and for everyone else FREE 100 POINTS

Answers

Answer:

I would be if I do it your no learning anything but I would but I don't have insta yet

Explanation:

sorry

Answer:

k

Explanation:

on analysis an ammonium salt of an alkanoic acid gave 60.5% C and 6.5% H if 0.309g of the salt yield 0.0313g of Nitrogen determine the empirical formula of the salt [ H = 1, C =12, N = 14, O= 16]​

Answers

Answer: C7H9NO2

Explanation:

%N = 0.0313/0.309 x 100

= 10.1%

%0 = 100 — (60.5 + 6.5 + 10.1)

= 22.9

C; 60.5/12 H; 6.5/1 N; 10.1/14 O; 22.9/16

C; 5.04/0.72 H; 6.5/0.72 N; 0.72/0.72 O; 1.43/0.72

Empirical formula — C7H9NO2

PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP

DUE IN 5 MINUTES CHEMISTRY DIMENSIONAL ANALYSIS

In 2009, Usain Bolt ran 100 meters in 9.58 seconds. What is this speed in km/hr? (!! DIMENSIONAL ANALYSIS!! NOT A REGULAR PROBLEM)

Answers

100 m = 0.1 km
9.58 sec = 9.58/3600 = 0.00266 hr
Speed = 0.1/0.00266= 37.6 km/hr
Can you mark it brainliest?

A 1,900-m3 water tower has been cleaned with a chlorine solution. The vapors of chlorine in the tower exceed allowable concentrations for the work crew to enter and finish repairs. If the chlorine concentration is 15 mg/m3 and the allowable concentration is 0.0015 mg/L, how long must the workers vent the tank with clean air flowing at 2.35 m3/s

Answers

Answer:

t = 1862 s

Explanation:

To do this, we need first to determine the theorical detention time, which can be determined with the following expression:

t₀ = ∀/Q  (1)

Where:

t₀: detention time

∀: Volume of the fluid in the reactor

Q: Flow rate in the reactor

With this time, we must use the following expression to determine the time that the workers will take to vent the tank:

C = C₀ e^(-t/t₀)   (2)

From here, we must solve for time t, and the expression will be:

t = ln(C₀/C) * t₀   (3)

Now that we know the expression to use, let's solve for t. Using (1) to determine the detention time, ∀ is 1900 m³, and Q is 2.35 m³/s so:

t₀ = 1900 / 2.35 = 808.51 s

Now, let's solve for the time t. C will be 0.0015 mg/L (or 1.5 mg/m³ cause in 1 m³ we have 1000 L) and C₀ 15 mg/m³:

t = ln(15/1.5) * 808.51

t = 1861.66 s or simply 1862 s

Hope this helps

Which statement describes the movement of the medium by a transverse wave?


A. at an obtuse angle to the wave

B. parallel to the wave

C. at a right angle to the wave

D. at an acute angle to the wave

Answers

Answer:

A

Explanation:

But I'm not sure just my instinct

The statement that described the movement of the medium via the transverse wave should be that it should be parallel to the wave.

What is a transverse wave?

It is the waves in which the motion considered all the points that should be on the wave oscillate along the paths at the right angles with respect to the wave of the direction. An example of this kind of wave should be electromagnetic, etc. Here, the movement should be parallel to the wave.

Hence, the correct option is b.

Learn more about transverse wave here: https://brainly.com/question/21890036

Please help I’m so confused on this it’s stoichiometry

Answers

Answer:

48.27g Na

Explanation:

To start we need to balance the equation. The trick is to make sure both sides have equal amounts of each atom:

2Na + Cl2 --> 2NaCl

Now we can use sociometry

We have 75 g of Cl2, and for every 1 mole of Cl2, there are 70.9 grams:

[tex]75g Cl2 * \frac{1mole Cl2}{70.9g Cl2}= 1.05 mole Cl2[/tex]

Now we have moles of Cl2. To get to grams of Na, we need to first use mole to mole ratio:

[tex]1.05mole Cl2 *\frac{2 mole Na}{1 mole Cl2} =2.1 mole Na[/tex]

 From here we convert moles of Na into grams of Na

[tex]2.1mol Na*\frac{22.99g Na}{1 mole Na} = 48.27g Na[/tex]

It's usually easier to just make one singular equation with all of these smaller equations.

[tex]75gNa*\frac{1molCl2}{70.9gCl2} *\frac{2mol Na}{1 mol Cl2} *\frac{22.99g Na}{1 mol Na}=48.27 gNa[/tex]

The trick to sociometry is making sure your units cancel out until you only have the unit you want. If there are moles of Na in the numerator, there needs to be moles of Na in the denominator. If there are grams of Cl2 in the numerator, there needs to be grams of Cl2 in the denominator and so one and so on

The hydrolysis of adenosine triphosphate (ATP) is represented by the equation below. This reaction is critically important in cellular biology, but the reaction itself proceeds at a very slow rate. Based on the information given, which of the following best explains why an enzyme (biological catalyst) is required for the reaction to occur at a faster rate?

ATP+ H2O ADP+ Pi
ΔG= -30.5Kj/mol

a. Because ΔG < 0, the hydrolysis of ATP is not thermodynamically favorable. In cells, ΔS is increased by increasing the amount of H2O consumed, resulting in ΔG >0 and an increase in the reaction rate.
b. Because ΔG < 0, the hydrolysis of ATP is not thermodynamically favorable. In cells, enzymes act as catalysts that decrease ΔH for the reaction, resulting in ΔG >0 and an increase in the reaction rate.
c. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a small activation energy.
d. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a large activation energy.

Answers

Answer:

d. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a large activation energy.

Explanation:

Hello!

In this case, since negative Gibbs free energies of reaction stand for thermodynamically favored processes, we can immediately rule out choices a. and b.

Moreover, since the reaction is slow without the presence of a catalyst, which the context of biochemistry is an enzyme, we infer that correct choice is d. Although the hydrolysis of ATP is thermodynamically favorable, without a catalyst the reaction occurs at a very slow rate because it has a large activation energy because the higher the activation energy the slower the reaction according to the Arrhenius equation.

Best regards!

g When water and perchloric acid (HClO4) are mixed, heat is released. The resulting solution is not an ideal solution, in terms of Raoult’s Law. How should the boiling point and the vapor pressure of a solution of HClO4 in H2O differ from what is expected for an ideal solution? A) boiling point higher than expected, vapor pressure lower than expected B) boiling point higher than expected, vapor pressure higher than expected C) boiling point lower than expected, vapor pressure lower than expected D) boiling point lower than expected, vapor pressure higher than expected E) boiling point and vapor pressure are both the same as expected for an ideal solution

Answers

Answer:

A) boiling point higher than expected vapor pressure lower than expected.

Explanation:

When water is introduced with heat it vaporize at a temperature of 100 degree centigrade. When hydrochloric acid is added to the water its boiling point of water increases slightly. The difference in the boiling point is due to the presence of heavier molecules in acid.


PLEASE HELP!!
15POINTS!!! And brainliest

Answers

Answer: a. 3.36 L

b. 33.2 g

Explanation:

According to avogadro's law, 1 mole of every substance occupies 22.4 L at STP and contains avogadro's number [tex]6.023\times 10^{23}[/tex] of particles.

Standard condition of temperature (STP)  is 273 K and atmospheric pressure is 1 atm respectively.

To calculate the number of moles, we use the equation:

[tex]\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}[/tex]

[tex]\text{Number of moles of} Fe_2O_3=\frac{16.0g}{159.69g/mol}=0.1mole[/tex]

[tex]3O_2(g)+4Fe(s)\rightarrow 2Fe_2O_3(s)[/tex]

a. 2 moles of [tex]Fe_2O_3[/tex] are produced by = [tex]3\times 22.4L=67.2L[/tex] of [tex]O_2[/tex]

Thus 0.1 moles of  [tex]Fe_2O_3[tex] are produced by =[tex]\frac{67.2}{2}\times 0.1=3.36L[/tex] of [tex]O_2[/tex]

b. [tex]3\times 22.4L=67.2L[/tex] of [tex]O_2[/tex] react with = [tex]4\times 55.8=223.2g[/tex] of iron

Thus 10.0 L of [tex]O_2[/tex] react with = [tex]\frac{223.2}{67.2}\times 10=33.2g[/tex] of iron

A student dissolves 10.2 g of sodium hydroxide (NaOH) in 250. g of water in a well-insulated open cup. He then observes the temperature of the water rise from 21.0 °C to 32.7 °C over the course of 3.7 minutes. Use this data, and any information you need from the ALEKS Data resource, to answer the questions below about this reaction: NAOH(s) → Na" (aq) + OH (aq) You can make any reasonable assumptions about the physical properties of the solution. Be sure answers you calculate using measured data are rounded to 3 significant digits. do Note for advanced students: Its possible the student did not do the experiment carefully, and the values you calculate may not be the same as the known and published values for this reaction. O exothermic Is this reaction exothermic, endothermic, or neither? O endothermic O neither If you said the reaction was exothermic or endothermic, calculate the amount of heat that was released or absorbed by the reaction in this case. kJ Calculate the reaction enthalpy AH per mole of NaOH. mol

Answers

Answer:

A) The reaction is an exothermic reaction

B) 12.744 kJ

c) 49.976 KJ/mol . NaOH

Explanation:

A)  The reaction is an exothermic reaction

B) calculate the amount of heat that was released or absorbed by the reaction in this case. kJ

Assuming : specific heat of solution = specific heat of water = 4.186 J/g°C

mass of solution = 10.2 + 250 = 260.2 g

determine The heat released in the reaction

= mass of solution * specific heat of solution * temperature change

= 260.2 * 4.186 * ( 32.7 - 21 )

= 12.744 kJ

C) Calculate the reaction enthalpy ΔH per mole of NaOH. mol

Reaction enthalpy = - heat released / ( 10.2 /40 )

                               =  - 12.744 / ( 10.2/40 ) =  - 49.976 KJ/mol . NaOH

Practice Problem 12.39 Partially correct answer. Your answer is partially correct. Try again. Acid-catalyzed hydration of 1-methylcyclohexene yields two alcohols. The major product does not undergo oxidation, while the minor product will undergo oxidation because the major product is Entry field with incorrect answer 2-methylcyclohexanol , which is a Entry field with incorrect answer secondary alcohol. These alcohols do not generally undergo oxidation. The minor product (Entry field with incorrect answer 1-methylcyclohexan-2-ol ) is asecondary alcohol and can undergo oxidation to yield a(n)

Answers

Answer:

See explanation and image attached

Explanation:

The acid-catalyzed hydration of 1-methylcyclohexene proceeds by an SN1 mechanism. The reaction involves the formation of carbocations.

Two carbocations are formed leading to the major and minor products. The major product is obtained from the tertiary (more stable) carbocation while the minor product is obtained from the secondary (less stable carbocation).

Tertiary alcohols are not oxidized, hence the major product does not undergo oxidation. However, secondary alcohols are oxidized to ketones.

Gold is yellow, shiny, smooth, and is found in the ground. A geologist finds a material that she thinks may be gold. Which of the following tests would reveal that
the material is not gold and not an element?

A. Its density is different from that of gold.
B. Its melting point is different from that of gold.
C. The material is composed of two different substances.
D. Its boiling point differs from that of gold.

Answers

I think the answer is D

2NH3+2O2- N2o+3H2O

If 80.0 grams of O2 are reacted in the above reaction,how many grams of N2O will be produced?

Answers

Answer:

55.025g of N2O

Explanation:

2 NH3 + 2 O2 → N2O + 3 H2O

moles of O2 = 80.0/32 = 2.5 moles O2

moles of N2O = 2.5 moles O2 * 1 mole N2O

= 1.25 moles N2O

moles = mass/Molar mass

mass = moles * Molar mass = 1.25 x 44.02 = 55.025 g

A balloon full of air has a volume of 1.00L at a temperature of 23 °C. What is the balloon's volume at 33°C?
Answer:1.03L
How do I solve this?

Answers

Answer:

V2= 1.03L

Explanation:

Start off with what you are given.

V^1: 1.00L

T^1: 23°C

V^2?

T^2: 33°C

If you know your gas laws, you have to utilise a certain gas law called Charles' Law:

V^1/T^1 = V^2/T^2

Remember to convert Celsius values to Kelvin whenever you are dealing with gas problems. This can be done by adding 273 to whatever value in Celsius you have.

(23+273 = 296)     (33+273 = 306)

Multiply crisscross

1.00/296= V^2/306

296V^2 = 306

Dividing both sides by 296 to isolate V2, we get

306/296 = 1.0337837837837837837837837837838

V2= 1.03L

Which is correct order of the weather observed with each cloud type from 1 to 4?


A. Rain, thunderstorm, snow, fair

B. Light rain, fair, thunderstorm, fair

C. Light rain, thunderstorm, fair, fair

D. Hail, lightning, thunderstorm, fair

Answers

Answer:i thinks its A

Explanation:but who knows

A normal adult jawbone contains 200 mg of Carbon-14 in a living person. If scientists found a jawbone that only had 50mg of Carbon-14, how old is the bone? (The half-life of C-14 is 5730 years).

Answers

Carbon-14 is a radioisotope of carbon that decays following first-order kinetics. There are four values of interest in this problem: the "normal" (or original) amount of carbon-14 for a jawbone ([tex]\mathrm{N_0}[/tex]), the actual amount of carbon-14 in a jawbone ([tex]\mathrm{N}[/tex]), the half-life of carbon-14 ([tex]\mathrm{t_{1/2}}[/tex]), and the actual time elapsed ([tex]\mathrm{t}[/tex]) from the original time. There is an equation that ties all these values in together,

[tex]N= N_0 e^{-kt}[/tex]

where k is the rate constant, which, for first-order decay, is related to the half-life by

[tex]k = \dfrac{\ln 2}{ t_{1/2} }.[/tex]

What you want to find here is the time elapsed (t). So, you can substitute the latter equation for k into the k in the former equation to get

[tex]N= N_0 e^{\frac{-\ln 2 \;t}{t_{1/2}}.[/tex]

Rearranging to solve for t, the equation becomes

[tex]t = \left(\dfrac{\ln \dfrac{N_0}{N}}{\ln 2} \right) t_{1/2}.[/tex]

You are given all three of the values necessary to solve for t: The normal amount of carbon-14 is 200 mg; the actual amount of carbon-14 in the sample is 50 mg; and the half-life of carbon-14 is 5730 years. Plugging them into the above equation, we get

[tex]t = \left(\dfrac{\ln \dfrac{200 \text{ mg}}{50 \text{ mg}}}{\ln 2} \right) \left(5730 \text{ years} \right) = 11460 \text{ years}.[/tex]

So the jawbone found is 11460 years old (or 11000 if accounting for sig figs).

plzzzzzzz help asap its just one question plzzzzz its in the file <3

Answers

Answer:

There are 6 atoms of oxygen in 2Ca(NO3)2

515282 quarts into milliliters. I

Answers

Answer:

487638640,7819

dndndnndndbxbdbdbdbdb

In Universe L , recently discovered by an intrepid team of chemists who also happen to have studied interdimensional travel, quantum mechanics works just as it does in our universe, except that there are four d orbitals instead of the usual number we observe here. Use these facts to write the ground-state electron configurations of the third and fourth elements in the first transition series in Universe L .

Answers

Answer:

See explanation

Explanation:

The third element in the first transition series is Vanadium

The fourth element in the first transition series is chromium

Given that we have four d orbitals in universe L instead of five as we have on earth;

The electronic configuration of Vanadium in universe L is;

Ar 3d3 4s2

The electronic configuration of chromium in universe L is;

[Ar] 3d4 4s2

Write the equation for the acid dissociation, write the Ka expression, solve for Ht concentration, then do an ICE chart. Put the values into the Ka expression (the one you solved for Ht and find Ht, convert to pH and input that to 2 decimal place. Or use the Henderson-Hasselbalch equation:
pH = pka, + log ( Base/Acid)
Calculate the pH of a buffer solution consisting of 0.39 M HA (Ka = 8.8 x 10^-6) and 0.2 M NaA.

Answers

Answer:

The pH of the buffer is 4.77

Explanation:

Using Henderson-Hasselbalch equation we can solve the pH of the buffer:

pH = pKa + log [A⁻] / [HA]

Where pH is the pH of the buffer

pKa is -log Ka = 5.056

[A⁻] = [NaA] = 0.2M

[HA] = 0.39M

Replacing:

pH = 5.056+ log [0.2] / [0.39]

pH = 4.77

The pH of the buffer is 4.77

Need help fast help help help. Help

Answers

Answer:

fjnjfzgnf

Explanation:

Answer:

it blank !

Explanation:

Other Questions
Por qu crees que un escritor puede influir en sus lectores y en las sociedades que estos conforman? help now please I am begging you The foam football Coach Johnson left in his chair will stay there until hemoves it to sit in the chair.A. Newtons first law B. Newtons second law C. Newtons third law PLsssss I have this due in 10 minutes!!!!Stress and strain causes rock layers to fold. The process of folding is illustrated in the diagrams below.Which of the following correctly uses the Law of Superposition to compare the rock layers in diagram C?Diagram C shows that layer P is above layer R and is the youngest layer. Diagram C shows that layer P is below layer Q and remains the oldest layer.Diagram C shows that layers P through T are in the same order as in diagram A.Diagram C shows that layers Q through T are on the surface and are all the same age. 0.009 in scientific notation Carl transfers land to Cardinal Corporation for 90% of the stock in Cardinal Corporation worth $20,000 plus a note payable to Carl in the amount of $40,000 and the assumption by Cardinal Corporation of a mortgage on the land in the amount of $100,000. The land, which has a basis to Carl of $70,000, is worth $160,000. a. Cardinal Corporation will have a basis of $160,000 in the land transferred by Carl. b. Carl will have a recognized gain on the transfer of $30,000 c. Carl will have a recognized gain on the transfer of $90,000. d. Cardinal Corporation will have a basis of $70,000 in the land transferred by Carl. e. None of these choices are correct. Clara states that r 2 1 5r 1 3r is an equivalent expression to 9r. Why is Claras statement incorrect? Choose all that apply. A The expression r 2 1 5r 1 3r simplifies to r 2 1 8, which is not equivalent to 9r. B When you substitute 1 for r in both expressions, r 2 1 5r 1 3r has a value of 10 and 9r has a value of 9. These values are not equal. C The expression r 2 1 5r 1 3r simplifies to 10r, which is not equivalent to 9r. D When you substitute 2 for r in both expressions, r 2 1 5r 1 3r has a value of 20 and 9r has a value of 18. These values are not equal. E When you substitute 4 for r in both expressions, r 2 1 5r 1 3r has a value of 48 and 9r has a value of 36. These values are not equal. F The expression r 2 1 5r 1 3r simplifies to r(r 1 8), which is not equivalent to 9r. Storm water picks up pollutants off of these types of surfaces because they are not able to absorb rainfall QUESTION 10 of 10: You are planning to place an ad in a local newspaper. The size of the ad is 6 inches long by 5 columns wide. Thenewspaper's rate per column inch is $20. How much will the ad cost?a) $600b) $625c) $635d) $645 Two forms of energy found in all systems are kinetic energy and Has any one read The Night Before the Invasion by Rachel Howard? please help write an opinion about world war one Which step in a criminal case is when a defendant enters a plea of guilty or not guilty?trialarraignmentsentencingindictment A sample of an oxide of nitrogen is found to contain 30.4% nitrogen. What is its empirical formula? Learning task 1week 7 the water supplied by a pump fills a drum of 200 liters in 20 seconds. what is the flow rate of this pump A vehicle of mass 3200kg moving with a velocity of 10m/s increases it's velocity to 20m/s in 5 sec. calculate the magnitude of the force exerted on the engine why is there a need for interdependence? what is the pie chart 40 points for this and have a bless day _______________________________________________________________The main way in which Georgias port cities contribute to the states economy today is byA.) refusing to accept imported goods from other countries.B.) importing and exporting goods from around the world.C.) helping Georgia control the worlds wood pulp market.D.) importing large amounts of cotton from Asia and Africa.